Compare commits

..

56 Commits

Author SHA1 Message Date
udlbook
e9fa659fee Created using Colaboratory 2023-10-23 09:34:50 +01:00
udlbook
5db96e8a3d Created using Colaboratory 2023-10-22 20:38:00 +01:00
udlbook
6ac37b5548 Created using Colaboratory 2023-10-22 18:51:09 +01:00
udlbook
9acd27c8b3 Created using Colaboratory 2023-10-22 16:55:29 +01:00
udlbook
a481425005 Created using Colaboratory 2023-10-22 11:00:04 +01:00
udlbook
41e60e8597 Created using Colaboratory 2023-10-20 13:14:40 +01:00
udlbook
ec748ecc18 Created using Colaboratory 2023-10-19 20:56:53 +01:00
udlbook
467a36bed8 Created using Colaboratory 2023-10-19 11:30:16 +01:00
udlbook
351b050e7e Add files via upload 2023-10-18 15:31:24 +01:00
udlbook
5f19405c51 Delete Notebooks/Chap19/4_ReinforcementPenguin.png 2023-10-18 15:31:10 +01:00
udlbook
ad5339a972 Add files via upload 2023-10-18 15:26:09 +01:00
udlbook
1d8a9af439 Created using Colaboratory 2023-10-18 15:24:54 +01:00
udlbook
55a96289fe Created using Colaboratory 2023-10-18 13:08:24 +01:00
udlbook
d72143ff42 Created using Colaboratory 2023-10-18 10:43:37 +01:00
udlbook
a1154e2262 Created using Colaboratory 2023-10-18 09:06:27 +01:00
udlbook
b419f52791 Created using Colaboratory 2023-10-18 08:48:11 +01:00
udlbook
8c0bec30ff Created using Colaboratory 2023-10-17 13:17:00 +01:00
udlbook
87cfb0a846 Created using Colaboratory 2023-10-16 16:36:58 +01:00
udlbook
0fcfa4fe36 Created using Colaboratory 2023-10-16 15:54:36 +01:00
udlbook
8e6fd1bf81 Merge pull request #95 from krishnams0ni/newBranch
A better site
2023-10-14 18:42:10 +01:00
udlbook
7a2a7cd2e8 Merge pull request #91 from dillonplunkett/1.1-notebook-typos
fix a couple of typos in notebook 1.1
2023-10-14 18:37:54 +01:00
udlbook
f46ae30bf2 Merge pull request #93 from ritog/patch-1
Minor typo correction- Update 9_1_L2_Regularization.ipynb
2023-10-14 18:37:17 +01:00
udlbook
24206afa50 Created using Colaboratory 2023-10-14 18:28:15 +01:00
Krishnam Soni
77ec015669 Delete .idea directory 2023-10-14 22:37:14 +05:30
krishnams0ni
1c40b09e48 better site 2023-10-14 22:34:36 +05:30
udlbook
972e035974 Created using Colaboratory 2023-10-14 15:17:59 +01:00
udlbook
d7a792785f Update index.html 2023-10-13 18:48:44 +01:00
udlbook
80ef390e45 Created using Colaboratory 2023-10-13 18:46:12 +01:00
udlbook
f70dd6e60a Update index.html 2023-10-13 15:37:26 +01:00
udlbook
a7d840f204 Update index.html 2023-10-13 12:06:32 +01:00
udlbook
50d1c5e255 Created using Colaboratory 2023-10-12 18:42:59 +01:00
udlbook
9a3517629a Created using Colaboratory 2023-10-12 18:37:05 +01:00
udlbook
af77c76435 Created using Colaboratory 2023-10-12 18:07:26 +01:00
udlbook
0515940ace Created using Colaboratory 2023-10-12 17:39:48 +01:00
udlbook
5d578df07b Created using Colaboratory 2023-10-12 17:25:40 +01:00
udlbook
d174c9f34c Created using Colaboratory 2023-10-12 15:15:13 +01:00
udlbook
dbb3d4b666 Created using Colaboratory 2023-10-11 18:22:52 +01:00
udlbook
39ad6413ce Created using Colaboratory 2023-10-11 18:21:04 +01:00
udlbook
3e51d89714 Created using Colaboratory 2023-10-10 12:01:50 +01:00
udlbook
5680e5d7f7 Created using Colaboratory 2023-10-10 11:52:48 +01:00
udlbook
0a5a97f55d Created using Colaboratory 2023-10-10 11:51:31 +01:00
udlbook
0dc94ead03 Created using Colaboratory 2023-10-09 16:55:44 +01:00
udlbook
c7e7e731b3 Created using Colaboratory 2023-10-06 16:57:48 +01:00
udlbook
06f197c787 Created using Colaboratory 2023-10-06 15:31:42 +01:00
udlbook
ff29fc34e8 Created using Colaboratory 2023-10-05 09:19:41 +01:00
udlbook
2653116c47 Created using Colaboratory 2023-10-04 18:57:52 +01:00
udlbook
f50de74496 Created using Colaboratory 2023-10-04 17:03:39 +01:00
udlbook
aa5d89adf3 Created using Colaboratory 2023-10-04 12:46:08 +01:00
udlbook
18e827842c Created using Colaboratory 2023-10-04 08:32:27 +01:00
udlbook
22b6b18660 Created using Colaboratory 2023-10-03 18:52:37 +01:00
udlbook
ed060b6b08 Created using Colaboratory 2023-10-03 17:22:46 +01:00
udlbook
df0132505b Created using Colaboratory 2023-10-03 08:58:32 +01:00
udlbook
67fb0f5990 Update index.html 2023-10-01 18:22:32 +01:00
udlbook
ecd01f2992 Delete Notesbooks/Chap11 directory 2023-10-01 18:19:38 +01:00
Ritobrata Ghosh
a32260c39f Minor typo correction- Update 9_1_L2_Regularization.ipynb 2023-09-12 19:42:35 +05:30
Dillon Plunkett
6b2288665f fix a couple of typos in 1.1 notebook 2023-08-13 18:12:25 -04:00
35 changed files with 8796 additions and 476 deletions

View File

@@ -332,9 +332,7 @@
"2. What is $\\mbox{exp}[1]$?\n", "2. What is $\\mbox{exp}[1]$?\n",
"3. What is $\\mbox{exp}[-\\infty]$?\n", "3. What is $\\mbox{exp}[-\\infty]$?\n",
"4. What is $\\mbox{exp}[+\\infty]$?\n", "4. What is $\\mbox{exp}[+\\infty]$?\n",
"5. A function is convex if we can draw a straight line between any two points on the\n", "5. A function is convex if we can draw a straight line between any two points on the function, and this line always lies above the function. Similarly, a function is concave if a straight line between any two points always lies below the function. Is the exponential function convex or concave or neither?\n"
"function, and this line always lies above the function. Similarly, a function is concave\n",
"if a straight line between any two points always lies below the function. Is the exponential function convex or concave or neither?\n"
] ]
}, },
{ {
@@ -343,7 +341,7 @@
"id": "R6A4e5IxIWCu" "id": "R6A4e5IxIWCu"
}, },
"source": [ "source": [
"Now let's consider the logarithm function $y=\\log[x]$. Throughout the book we always use natural (base $e$) logarithms. The log funcction maps non-negative numbers $[0,\\infty]$ to real numbers $[-\\infty,\\infty]$. It is the inverse of the exponential function. So when we compute $\\log[x]$ we are really asking \"What is the number $y$ so that $e^y=x$?\"" "Now let's consider the logarithm function $y=\\log[x]$. Throughout the book we always use natural (base $e$) logarithms. The log function maps non-negative numbers $[0,\\infty]$ to real numbers $[-\\infty,\\infty]$. It is the inverse of the exponential function. So when we compute $\\log[x]$ we are really asking \"What is the number $y$ so that $e^y=x$?\""
] ]
}, },
{ {
@@ -384,15 +382,6 @@
"6. What is $\\mbox{log}[-1]$?\n", "6. What is $\\mbox{log}[-1]$?\n",
"7. Is the logarithm function concave or convex?\n" "7. Is the logarithm function concave or convex?\n"
] ]
},
{
"cell_type": "code",
"source": [],
"metadata": {
"id": "XG0CKLiPJI7I"
},
"execution_count": null,
"outputs": []
} }
], ],
"metadata": { "metadata": {
@@ -420,4 +409,4 @@
}, },
"nbformat": 4, "nbformat": 4,
"nbformat_minor": 0 "nbformat_minor": 0
} }

File diff suppressed because one or more lines are too long

View File

@@ -4,7 +4,7 @@
"metadata": { "metadata": {
"colab": { "colab": {
"provenance": [], "provenance": [],
"authorship_tag": "ABX9TyPFqKOqd6BjlymOawCRkmfn", "authorship_tag": "ABX9TyNk2dAhwwRxGpfVSC3b2Owv",
"include_colab_link": true "include_colab_link": true
}, },
"kernelspec": { "kernelspec": {
@@ -182,7 +182,7 @@
{ {
"cell_type": "markdown", "cell_type": "markdown",
"source": [ "source": [
"Now we'll extend this model to have two outputs $y_1$ and $y_2$, each of which can be visualized with a separate heatmap. You will now have sets of parameters $\\phi_{10}, \\phi_{11},\\phi_{12}$ and $\\phi_{2}, \\phi_{21},\\phi_{22}$ that correspond to each of these outputs." "Now we'll extend this model to have two outputs $y_1$ and $y_2$, each of which can be visualized with a separate heatmap. You will now have sets of parameters $\\phi_{10}, \\phi_{11},\\phi_{12}$ and $\\phi_{20}, \\phi_{21},\\phi_{22}$ that correspond to each of these outputs."
], ],
"metadata": { "metadata": {
"id": "Xl6LcrUyM7Lh" "id": "Xl6LcrUyM7Lh"
@@ -238,7 +238,7 @@
"def shallow_2_2_3(x1,x2, activation_fn, phi_10,phi_11,phi_12,phi_13, phi_20,phi_21,phi_22,phi_23, theta_10, theta_11,\\\n", "def shallow_2_2_3(x1,x2, activation_fn, phi_10,phi_11,phi_12,phi_13, phi_20,phi_21,phi_22,phi_23, theta_10, theta_11,\\\n",
" theta_12, theta_20, theta_21, theta_22, theta_30, theta_31, theta_32):\n", " theta_12, theta_20, theta_21, theta_22, theta_30, theta_31, theta_32):\n",
"\n", "\n",
" # TODO -- write this function -- replace the dummy code blow\n", " # TODO -- write this function -- replace the dummy code below\n",
" pre_1 = np.zeros_like(x1)\n", " pre_1 = np.zeros_like(x1)\n",
" pre_2 = np.zeros_like(x1)\n", " pre_2 = np.zeros_like(x1)\n",
" pre_3 = np.zeros_like(x1)\n", " pre_3 = np.zeros_like(x1)\n",

View File

@@ -4,7 +4,7 @@
"metadata": { "metadata": {
"colab": { "colab": {
"provenance": [], "provenance": [],
"authorship_tag": "ABX9TyMhLSGU8+odPS/CoW5PwKna", "authorship_tag": "ABX9TyNioITtfAcfxEfM3UOfQyb9",
"include_colab_link": true "include_colab_link": true
}, },
"kernelspec": { "kernelspec": {
@@ -62,7 +62,7 @@
"source": [ "source": [
"The number of regions $N$ created by a shallow neural network with $D_i$ inputs and $D$ hidden units is given by Zaslavsky's formula:\n", "The number of regions $N$ created by a shallow neural network with $D_i$ inputs and $D$ hidden units is given by Zaslavsky's formula:\n",
"\n", "\n",
"\\begin{equation}N = \\sum_{j=1}^{D_{i}}\\binom{D}{j}=\\sum_{j=1}^{D_{i}} \\frac{D!}{(D-j)!j!} \\end{equation} <br>\n", "\\begin{equation}N = \\sum_{j=0}^{D_{i}}\\binom{D}{j}=\\sum_{j=0}^{D_{i}} \\frac{D!}{(D-j)!j!} \\end{equation} <br>\n",
"\n" "\n"
], ],
"metadata": { "metadata": {
@@ -79,7 +79,7 @@
"source": [ "source": [
"def number_regions(Di, D):\n", "def number_regions(Di, D):\n",
" # TODO -- implement Zaslavsky's formula\n", " # TODO -- implement Zaslavsky's formula\n",
" # You will need to use math.factorial() https://www.geeksforgeeks.org/factorial-in-python/\n", " # You can use math.com() https://www.w3schools.com/python/ref_math_comb.asp\n",
" # Replace this code\n", " # Replace this code\n",
" N = 1;\n", " N = 1;\n",
"\n", "\n",
@@ -115,7 +115,7 @@
{ {
"cell_type": "markdown", "cell_type": "markdown",
"source": [ "source": [
"This works but there is a complication. If the number of hidden units $D$ is fewer than the number of hidden dimensions $D_i$ , the formula will fail. When this is the case, there are just $2^D$ regions (see figure 3.10 to understand why).\n", "This works but there is a complication. If the number of hidden units $D$ is fewer than the number of input dimensions $D_i$ , the formula will fail. When this is the case, there are just $2^D$ regions (see figure 3.10 to understand why).\n",
"\n", "\n",
"Let's demonstrate this:" "Let's demonstrate this:"
], ],
@@ -142,7 +142,7 @@
{ {
"cell_type": "code", "cell_type": "code",
"source": [ "source": [
"# Let's do the calculation properly when D<Di\n", "# Let's do the calculation properly when D<Di (see figure 3.10 from the book)\n",
"D = 8; Di = 10\n", "D = 8; Di = 10\n",
"N = np.power(2,D)\n", "N = np.power(2,D)\n",
"# We can equivalently do this by calling number_regions with the D twice\n", "# We can equivalently do this by calling number_regions with the D twice\n",
@@ -191,7 +191,7 @@
"cell_type": "code", "cell_type": "code",
"source": [ "source": [
"# Now let's compute and plot the number of regions as a function of the number of parameters as in figure 3.9b\n", "# Now let's compute and plot the number of regions as a function of the number of parameters as in figure 3.9b\n",
"# First let's write a function that computes the number of parameters as a function of the input dimension and number of hidden layers (assuming just one output)\n", "# First let's write a function that computes the number of parameters as a function of the input dimension and number of hidden units (assuming just one output)\n",
"\n", "\n",
"def number_parameters(D_i, D):\n", "def number_parameters(D_i, D):\n",
" # TODO -- replace this code with the proper calculation\n", " # TODO -- replace this code with the proper calculation\n",
@@ -210,7 +210,7 @@
"source": [ "source": [
"# Now let's test the code\n", "# Now let's test the code\n",
"N = number_parameters(10, 8)\n", "N = number_parameters(10, 8)\n",
"print(f\"Di=10, D=8, Number of parameters = {int(N)}, True value = 90\")" "print(f\"Di=10, D=8, Number of parameters = {int(N)}, True value = 97\")"
], ],
"metadata": { "metadata": {
"id": "VbhDmZ1gwkQj" "id": "VbhDmZ1gwkQj"
@@ -233,7 +233,7 @@
" for c_hidden in range(1, 200):\n", " for c_hidden in range(1, 200):\n",
" # Iterate over different ranges of number hidden variables for different input sizes\n", " # Iterate over different ranges of number hidden variables for different input sizes\n",
" D = int(c_hidden * 500 / D_i)\n", " D = int(c_hidden * 500 / D_i)\n",
" params[c_dim, c_hidden] = D_i * D +1 + D +1\n", " params[c_dim, c_hidden] = D_i * D +D + D +1\n",
" regions[c_dim, c_hidden] = number_regions(np.min([D_i,D]), D)\n", " regions[c_dim, c_hidden] = number_regions(np.min([D_i,D]), D)\n",
"\n", "\n",
"fig, ax = plt.subplots()\n", "fig, ax = plt.subplots()\n",

View File

@@ -4,7 +4,7 @@
"metadata": { "metadata": {
"colab": { "colab": {
"provenance": [], "provenance": [],
"authorship_tag": "ABX9TyOu5BvK3aFb7ZEQKG5vfOZ1", "authorship_tag": "ABX9TyPmra+JD+dm2M3gCqx3bMak",
"include_colab_link": true "include_colab_link": true
}, },
"kernelspec": { "kernelspec": {
@@ -185,7 +185,7 @@
"The ReLU isn't the only kind of activation function. For a long time, people used sigmoid functions. A logistic sigmoid function is defined by the equation\n", "The ReLU isn't the only kind of activation function. For a long time, people used sigmoid functions. A logistic sigmoid function is defined by the equation\n",
"\n", "\n",
"\\begin{equation}\n", "\\begin{equation}\n",
"f[h] = \\frac{1}{1+\\exp{[-10 z ]}}\n", "f[z] = \\frac{1}{1+\\exp{[-10 z ]}}\n",
"\\end{equation}\n", "\\end{equation}\n",
"\n", "\n",
"(Note that the factor of 10 is not standard -- but it allow us to plot on the same axes as the ReLU examples)" "(Note that the factor of 10 is not standard -- but it allow us to plot on the same axes as the ReLU examples)"

View File

@@ -4,7 +4,7 @@
"metadata": { "metadata": {
"colab": { "colab": {
"provenance": [], "provenance": [],
"authorship_tag": "ABX9TyMbJGN6f2+yKzzsVep/wi5U", "authorship_tag": "ABX9TyPyaqr0yJlxfIcTpfLSHDrP",
"include_colab_link": true "include_colab_link": true
}, },
"kernelspec": { "kernelspec": {
@@ -274,7 +274,7 @@
"cell_type": "code", "cell_type": "code",
"source": [ "source": [
"# define sizes\n", "# define sizes\n",
"D_i=4; D_1=5; D_2=2; D_3=1; D_o=1\n", "D_i=4; D_1=5; D_2=2; D_3=4; D_o=1\n",
"# We'll choose the inputs and parameters of this network randomly using np.random.normal\n", "# We'll choose the inputs and parameters of this network randomly using np.random.normal\n",
"# For example, we'll set the input using\n", "# For example, we'll set the input using\n",
"n_data = 4;\n", "n_data = 4;\n",

View File

@@ -4,7 +4,7 @@
"metadata": { "metadata": {
"colab": { "colab": {
"provenance": [], "provenance": [],
"authorship_tag": "ABX9TyNkBMOVt5gO7Awn9JMn4N8Z", "authorship_tag": "ABX9TyPX88BLalmJTle9GSAZMJcz",
"include_colab_link": true "include_colab_link": true
}, },
"kernelspec": { "kernelspec": {
@@ -307,7 +307,7 @@
"# Return the negative log likelihood of the data under the model\n", "# Return the negative log likelihood of the data under the model\n",
"def compute_negative_log_likelihood(y_train, mu, sigma):\n", "def compute_negative_log_likelihood(y_train, mu, sigma):\n",
" # TODO -- compute the likelihood of the data -- don't use the likelihood function above -- compute the negative sum of the log probabilities\n", " # TODO -- compute the likelihood of the data -- don't use the likelihood function above -- compute the negative sum of the log probabilities\n",
" # Bottom line of equation 5.3 in the notes\n", " # Equation 5.4 in the notes\n",
" # You will need np.sum(), np.log()\n", " # You will need np.sum(), np.log()\n",
" # Replace the line below\n", " # Replace the line below\n",
" nll = 0\n", " nll = 0\n",

View File

@@ -341,7 +341,7 @@
"source": [ "source": [
"# Computes the regularization term\n", "# Computes the regularization term\n",
"def compute_reg_term(phi0,phi1):\n", "def compute_reg_term(phi0,phi1):\n",
" # TODO compute the regularization term (term in large brackets in the above equstion)\n", " # TODO compute the regularization term (term in large brackets in the above equation)\n",
" # Replace this line\n", " # Replace this line\n",
" reg_term = 0.0\n", " reg_term = 0.0\n",
"\n", "\n",
@@ -535,4 +535,4 @@
} }
} }
] ]
} }

View File

@@ -0,0 +1,314 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyNXqwmC4yEc1mGv9/74b0jY",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap13/13_3_Neighborhood_Sampling.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 13.3: Neighborhood sampling**\n",
"\n",
"This notebook investigates neighborhood sampling of graphs as in figure 13.10 from the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"import networkx as nx"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's construct the graph from figure 13.10, which has 23 nodes."
],
"metadata": {
"id": "UNleESc7k5uB"
}
},
{
"cell_type": "code",
"source": [
"# Define adjacency matrix\n",
"A = np.array([[0,1,1,1,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [1,0,1,0,0, 0,0,0,1,1, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [1,1,0,1,0, 0,0,0,0,1, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [1,0,1,0,1, 0,1,1,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [0,0,0,1,0, 1,0,1,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [0,0,0,0,1, 0,0,1,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [0,0,0,1,0, 0,0,1,0,1, 1,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [0,0,0,1,1, 1,1,0,0,0, 1,0,0,1,0, 0,0,0,0,0, 0,0,0],\n",
" [0,1,0,0,0, 0,0,0,0,1, 0,0,0,0,0, 0,0,0,0,0, 0,0,0],\n",
" [0,1,1,0,0, 0,1,0,1,0, 0,1,1,0,0, 0,1,0,0,0, 0,0,0],\n",
" [0,0,0,0,0, 0,1,1,0,0, 0,0,1,0,0, 0,0,0,0,0, 0,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,1, 0,0,0,0,1, 1,1,0,0,0, 0,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,1, 1,0,0,1,0, 0,1,1,0,0, 0,0,0],\n",
" [0,0,0,0,0, 0,0,1,0,0, 0,0,1,0,0, 0,0,1,1,0, 0,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,1,0,0,0, 1,0,0,0,1, 0,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,1,0,0,1, 0,1,0,0,1, 0,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,1, 0,1,1,0,0, 1,0,1,0,1, 0,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,0,1,1,0, 0,1,0,1,0, 1,1,1],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,0,0,1,0, 0,0,1,0,0, 0,0,1],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,0,0,0,1, 1,1,0,0,0, 1,0,0],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,1,0,1, 0,1,0],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,1,0,0, 1,0,1],\n",
" [0,0,0,0,0, 0,0,0,0,0, 0,0,0,0,0, 0,0,1,1,0, 0,1,0]]);\n",
"print(A)"
],
"metadata": {
"id": "fHgH5hdG_W1h"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Routine to draw graph structure, highlighting original node (brown in fig 13.10)\n",
"# and neighborhood nodes (orange in figure 13.10)\n",
"def draw_graph_structure(adjacency_matrix, original_node, neighborhood_nodes=None):\n",
"\n",
" G = nx.Graph()\n",
" n_node = adjacency_matrix.shape[0]\n",
" for i in range(n_node):\n",
" for j in range(i):\n",
" if adjacency_matrix[i,j]:\n",
" G.add_edge(i,j)\n",
"\n",
" color_map = []\n",
"\n",
" for node in G:\n",
" if original_node[node]:\n",
" color_map.append('brown')\n",
" else:\n",
" if neighborhood_nodes[node]:\n",
" color_map.append('orange')\n",
" else:\n",
" color_map.append('white')\n",
"\n",
" nx.draw(G, nx.spring_layout(G, seed = 7), with_labels=True,node_color=color_map)\n",
" plt.show()"
],
"metadata": {
"id": "TIrihEw-7DRV"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"n_nodes = A.shape[0]\n",
"\n",
"# Define a single output layer node\n",
"output_layer_nodes=np.zeros((n_nodes,1)); output_layer_nodes[16]=1\n",
"# Define the neighboring nodes to draw (none)\n",
"neighbor_nodes = np.zeros((n_nodes,1))\n",
"print(\"Output layer:\")\n",
"draw_graph_structure(A, output_layer_nodes, neighbor_nodes)"
],
"metadata": {
"id": "gKBD5JsPfrkA"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's imagine that we want to form a batch for a node labelling task that consists of just node 16 in the output layer (highlighted). The network consists of the input, hidden layer 1, hidden layer2, and the output layer."
],
"metadata": {
"id": "JaH3g_-O-0no"
}
},
{
"cell_type": "code",
"source": [
"# TODO Find the nodes in hidden layer 2 that connect to node 16 in the output layer\n",
"# using the adjacency matrix\n",
"# Replace this line:\n",
"hidden_layer2_nodes = np.zeros((n_nodes,1));\n",
"\n",
"print(\"Hidden layer 2:\")\n",
"draw_graph_structure(A, output_layer_nodes, hidden_layer2_nodes)"
],
"metadata": {
"id": "9oSiuP3B3HNS"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO - Find the nodes in hidden layer 1 that connect that connect to node 16 in the output layer\n",
"# using the adjacency matrix\n",
"# Replace this line:\n",
"hidden_layer1_nodes = np.zeros((n_nodes,1));\n",
"\n",
"print(\"Hidden layer 1:\")\n",
"draw_graph_structure(A, output_layer_nodes, hidden_layer1_nodes)"
],
"metadata": {
"id": "zZFxw3m1_wWr"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO Find the nodes in the input layer that connect to node 16 in the output layer\n",
"# using the adjacency matrix\n",
"# Replace this line:\n",
"input_layer_nodes = np.zeros((n_nodes,1));\n",
"\n",
"print(\"Input layer:\")\n",
"draw_graph_structure(A, output_layer_nodes, input_layer_nodes)"
],
"metadata": {
"id": "EL3N8BXyCu0F"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"This is bad news. This is a fairly sparsely connected graph (i.e. adjacency matrix is mostly zeros) and there are only two hidden layers. Nonetheless, we have to involve almost all the nodes in the graph to compute the loss at this output.\n",
"\n",
"To resolve this problem, we'll use neighborhood sampling. We'll start again with a single node in the output layer."
],
"metadata": {
"id": "CE0WqytvC7zr"
}
},
{
"cell_type": "code",
"source": [
"print(\"Output layer:\")\n",
"draw_graph_structure(A, output_layer_nodes, neighbor_nodes)"
],
"metadata": {
"id": "59WNys3KC5y6"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define umber of neighbors to sample\n",
"n_sample = 3"
],
"metadata": {
"id": "uCoJwpcTNFdI"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO Find the nodes in hidden layer 2 that connect to node 16 in the output layer\n",
"# using the adjacency matrix. Then sample n_sample of these nodes randomly without\n",
"# replacement.\n",
"\n",
"# Replace this line:\n",
"hidden_layer2_nodes = np.zeros((n_nodes,1));\n",
"\n",
"draw_graph_structure(A, output_layer_nodes, hidden_layer2_nodes)"
],
"metadata": {
"id": "_WEop6lYGNhJ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO Find the nodes in hidden layer 1 that connect to the nodes in hidden layer 2\n",
"# using the adjacency matrix. Then sample n_sample of these nodes randomly without\n",
"# replacement. Make sure not to sample nodes that were already included in hidden layer 2 our the ouput layer.\n",
"# The nodes at hidden layer 1 are the union of these nodes and the nodes in hidden layer 2\n",
"\n",
"# Replace this line:\n",
"hidden_layer1_nodes = np.zeros((n_nodes,1));\n",
"\n",
"draw_graph_structure(A, output_layer_nodes, hidden_layer1_nodes)\n"
],
"metadata": {
"id": "k90qW_LDLpNk"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO Find the nodes in the input layer that connect to the nodes in hidden layer 1\n",
"# using the adjacency matrix. Then sample n_sample of these nodes randomly without\n",
"# replacement. Make sure not to sample nodes that were already included in hidden layer 1,2, or the output layer.\n",
"# The nodes at the input layer are the union of these nodes and the nodes in hidden layers 1 and 2\n",
"\n",
"# Replace this line:\n",
"input_layer_nodes = np.zeros((n_nodes,1));\n",
"\n",
"draw_graph_structure(A, output_layer_nodes, input_layer_nodes)"
],
"metadata": {
"id": "NDEYUty_O3Zr"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"If you did this correctly, there should be 9 yellow nodes in the figure. The \"receptive field\" of node 16 in the output layer increases much more slowly as we move back through the layers of the network."
],
"metadata": {
"id": "vu4eJURmVkc5"
}
}
]
}

View File

@@ -0,0 +1,213 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyOdSkjfQnSZXnffGsZVM7r5",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap13/13_4_Graph_Attention_Networks.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 13.4: Graph attention networks**\n",
"\n",
"This notebook builds a graph attention mechanism from scratch, as discussed in section 13.8.6 of the book and illustrated in figure 13.12c\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions.\n",
"\n"
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The self-attention mechanism maps $N$ inputs $\\mathbf{x}_{n}\\in\\mathbb{R}^{D}$ and returns $N$ outputs $\\mathbf{x}'_{n}\\in \\mathbb{R}^{D}$. \n",
"\n"
],
"metadata": {
"id": "9OJkkoNqCVK2"
}
},
{
"cell_type": "code",
"source": [
"# Set seed so we get the same random numbers\n",
"np.random.seed(1)\n",
"# Number of nodes in the graph\n",
"N = 8\n",
"# Number of dimensions of each input\n",
"D = 4\n",
"\n",
"# Define a graph\n",
"A = np.array([[0,1,0,1,0,0,0,0],\n",
" [1,0,1,1,1,0,0,0],\n",
" [0,1,0,0,1,0,0,0],\n",
" [1,1,0,0,1,0,0,0],\n",
" [0,1,1,1,0,1,0,1],\n",
" [0,0,0,0,1,0,1,1],\n",
" [0,0,0,0,0,1,0,0],\n",
" [0,0,0,0,1,1,0,0]]);\n",
"print(A)\n",
"\n",
"# Let's also define some random data\n",
"X = np.random.normal(size=(D,N))"
],
"metadata": {
"id": "oAygJwLiCSri"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We'll also need the weights and biases for the keys, queries, and values (equations 12.2 and 12.4)"
],
"metadata": {
"id": "W2iHFbtKMaDp"
}
},
{
"cell_type": "code",
"source": [
"# Choose random values for the parameters\n",
"omega = np.random.normal(size=(D,D))\n",
"beta = np.random.normal(size=(D,1))\n",
"phi = np.random.normal(size=(1,2*D))"
],
"metadata": {
"id": "79TSK7oLMobe"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We'll need a softmax operation that operates on the columns of the matrix and a ReLU function as well"
],
"metadata": {
"id": "iYPf6c4MhCgq"
}
},
{
"cell_type": "code",
"source": [
"# Define softmax operation that works independently on each column\n",
"def softmax_cols(data_in):\n",
" # Exponentiate all of the values\n",
" exp_values = np.exp(data_in) ;\n",
" # Sum over columns\n",
" denom = np.sum(exp_values, axis = 0);\n",
" # Replicate denominator to N rows\n",
" denom = np.matmul(np.ones((data_in.shape[0],1)), denom[np.newaxis,:])\n",
" # Compute softmax\n",
" softmax = exp_values / denom\n",
" # return the answer\n",
" return softmax\n",
"\n",
"\n",
"# Define the Rectified Linear Unit (ReLU) function\n",
"def ReLU(preactivation):\n",
" activation = preactivation.clip(0.0)\n",
" return activation\n"
],
"metadata": {
"id": "obaQBdUAMXXv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
" # Now let's compute self attention in matrix form\n",
"def graph_attention(X,omega, beta, phi, A):\n",
"\n",
" # TODO -- Write this function (see figure 13.12c)\n",
" # 1. Compute X_prime\n",
" # 2. Compute S\n",
" # 3. To apply the mask, set S to a very large negative number (e.g. -1e20) everywhere where A+I is zero\n",
" # 4. Run the softmax function to compute the attention values\n",
" # 5. Postmultiply X' by the attention values\n",
" # 6. Apply the ReLU function\n",
" # Replace this line:\n",
" output = np.ones_like(X) ;\n",
"\n",
" return output;"
],
"metadata": {
"id": "gb2WvQ3SiH8r"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Test out the graph attention mechanism\n",
"np.set_printoptions(precision=3)\n",
"output = graph_attention(X, omega, beta, phi, A);\n",
"print(\"Correct answer is:\")\n",
"print(\"[[1.796 1.346 0.569 1.703 1.298 1.224 1.24 1.234]\")\n",
"print(\" [0.768 0.672 0. 0.529 3.841 4.749 5.376 4.761]\")\n",
"print(\" [0.305 0.129 0. 0.341 0.785 1.014 1.113 1.024]\")\n",
"print(\" [0. 0. 0. 0. 0.35 0.864 1.098 0.871]]]\")\n",
"\n",
"\n",
"print(\"Your answer is:\")\n",
"print(output)"
],
"metadata": {
"id": "d4p6HyHXmDh5"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"TODO -- Try to construct a dot-product self-attention mechanism as in practical 12.1 that respects the geometry of the graph and has zero attention between non-neighboring nodes by combining figures 13.12a and 13.12b.\n"
],
"metadata": {
"id": "QDEkIrcgrql-"
}
}
]
}

View File

@@ -0,0 +1,419 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyM0StKV3FIZ3MZqfflqC0Rv",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap15/15_1_GAN_Toy_Example.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 15.1: GAN Toy example**\n",
"\n",
"This notebook investigates the GAN toy example as illustred in figure 15.1 in the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Get a batch of real data. Our goal is to make data that looks like this.\n",
"def get_real_data_batch(n_sample):\n",
" np.random.seed(0)\n",
" x_true = np.random.normal(size=(1,n_sample)) + 7.5\n",
" return x_true"
],
"metadata": {
"id": "y_OkVWmam4Qx"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Define our generator. This takes a standard normally-distributed latent variable $z$ and adds a scalar $\\theta$ to this, where $\\theta$ is the single parameter of this generative model according to:\n",
"\n",
"\\begin{equation}\n",
"x_i = z_i + \\theta.\n",
"\\end{equation}\n",
"\n",
"Obviously this model can generate the family of Gaussian distributions with unit variance, but different means."
],
"metadata": {
"id": "RFpL0uCXoTpV"
}
},
{
"cell_type": "code",
"source": [
"# This is our generator -- takes the single parameter theta\n",
"# of the generative model and generates n samples\n",
"def generator(z, theta):\n",
" x_gen = z + theta\n",
" return x_gen"
],
"metadata": {
"id": "OtLQvf3Enfyw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now, we define our disriminator. This is a simple logistic regression model (1D linear model passed through sigmoid) that returns the probability that the data is real"
],
"metadata": {
"id": "Xrzd8aehYAYR"
}
},
{
"cell_type": "code",
"source": [
"# Define our discriminative model\n",
"\n",
"# Logistic sigmoid, maps from [-infty,infty] to [0,1]\n",
"def sig(data_in):\n",
" return 1.0 / (1.0+np.exp(-data_in))\n",
"\n",
"# Discriminator computes y\n",
"def discriminator(x, phi0, phi1):\n",
" return sig(phi0 + phi1 * x)"
],
"metadata": {
"id": "vHBgAFZMsnaC"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Draws a figure like Figure 15.1a\n",
"def draw_data_model(x_real, x_syn, phi0=None, phi1=None):\n",
" fix, ax = plt.subplots();\n",
"\n",
" for x in x_syn:\n",
" ax.plot([x,x],[0,0.33],color='#f47a60')\n",
" for x in x_real:\n",
" ax.plot([x,x],[0,0.33],color='#7fe7dc')\n",
"\n",
" if phi0 is not None:\n",
" x_model = np.arange(0,10,0.01)\n",
" y_model = discriminator(x_model, phi0, phi1)\n",
" ax.plot(x_model, y_model,color='#dddddd')\n",
" ax.set_xlim([0,10])\n",
" ax.set_ylim([0,1])\n",
"\n",
"\n",
" plt.show()"
],
"metadata": {
"id": "V1FiDBhepcQJ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Get data batch\n",
"x_real = get_real_data_batch(10)\n",
"\n",
"# Initialize generator and synthesize a batch of examples\n",
"theta = 3.0\n",
"np.random.seed(1)\n",
"z = np.random.normal(size=(1,10))\n",
"x_syn = generator(z, theta)\n",
"\n",
"# Initialize discriminator model\n",
"phi0 = -2\n",
"phi1 = 1\n",
"\n",
"draw_data_model(x_real, x_syn, phi0, phi1)"
],
"metadata": {
"id": "U8pFb497x36n"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"You can see that the synthesized (orange) samples don't look much like the real (cyan) ones, and the initial model to discriminate them (gray line represents probability of being real) is pretty bad as well.\n",
"\n",
"Let's deal with the discriminator first. Let's define the loss"
],
"metadata": {
"id": "SNDV1G5PYhcQ"
}
},
{
"cell_type": "code",
"source": [
"# Discriminator loss\n",
"def compute_discriminator_loss(x_real, x_syn, phi0, phi1):\n",
"\n",
" # TODO -- compute the loss for the discriminator\n",
" # Run the real data and the synthetic data through the discriminator\n",
" # Then use the standard binary cross entropy loss with the y=1 for the real samples\n",
" # and y=0 for the synthesized ones.\n",
" # Replace this line\n",
" loss = 0.0\n",
"\n",
"\n",
" return loss"
],
"metadata": {
"id": "Bc3VwCabYcfg"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Test the loss\n",
"loss = compute_discriminator_loss(x_real, x_syn, phi0, phi1)\n",
"print(\"True Loss = 13.814757170851447, Your loss=\", loss )"
],
"metadata": {
"id": "MiqM3GXSbn0z"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Gradient of loss (cheating, using finite differences)\n",
"def compute_discriminator_gradient(x_real, x_syn, phi0, phi1):\n",
" delta = 0.0001;\n",
" loss1 = compute_discriminator_loss(x_real, x_syn, phi0, phi1)\n",
" loss2 = compute_discriminator_loss(x_real, x_syn, phi0+delta, phi1)\n",
" loss3 = compute_discriminator_loss(x_real, x_syn, phi0, phi1+delta)\n",
" dl_dphi0 = (loss2-loss1) / delta\n",
" dl_dphi1 = (loss3-loss1) / delta\n",
"\n",
" return dl_dphi0, dl_dphi1\n",
"\n",
"# This routine performs gradient descent with the discriminator\n",
"def update_discriminator(x_real, x_syn, n_iter, phi0, phi1):\n",
"\n",
" # Define learning rate\n",
" alpha = 0.01\n",
"\n",
" # Get derivatives\n",
" print(\"Initial discriminator loss = \", compute_discriminator_loss(x_real, x_syn, phi0, phi1))\n",
" for iter in range(n_iter):\n",
" # Get gradient\n",
" dl_dphi0, dl_dphi1 = compute_discriminator_gradient(x_real, x_syn, phi0, phi1)\n",
" # Take a gradient step downhill\n",
" phi0 = phi0 - alpha * dl_dphi0 ;\n",
" phi1 = phi1 - alpha * dl_dphi1 ;\n",
"\n",
" print(\"Final Discriminator Loss= \", compute_discriminator_loss(x_real, x_syn, phi0, phi1))\n",
"\n",
" return phi0, phi1"
],
"metadata": {
"id": "zAxUPo3p0CIW"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Let's update the discriminator (sigmoid curve)\n",
"n_iter = 100\n",
"print(\"Initial parameters (phi0,phi1)\", phi0, phi1)\n",
"phi0, phi1 = update_discriminator(x_real, x_syn, n_iter, phi0, phi1)\n",
"print(\"Final parameters (phi0,phi1)\", phi0, phi1)\n",
"draw_data_model(x_real, x_syn, phi0, phi1)"
],
"metadata": {
"id": "FE_DeweeAbMc"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's update the generator"
],
"metadata": {
"id": "pRv9myh0d3Xm"
}
},
{
"cell_type": "code",
"source": [
"def compute_generator_loss(z, theta, phi0, phi1):\n",
" # TODO -- Run the generator on the latent variables z with the parameters theta\n",
" # to generate new data x_syn\n",
" # Then run the discriminator on the new data to get the probability of being real\n",
" # The loss is the total negative log probability of being synthesized (i.e. of not being real)\n",
" # Replace this code\n",
" loss = 1\n",
"\n",
"\n",
" return loss"
],
"metadata": {
"id": "5uiLrFBvJFAr"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Test generator loss to check you have it correct\n",
"loss = compute_generator_loss(z, theta, -2, 1)\n",
"print(\"True Loss = 13.78437035945412, Your loss=\", loss )"
],
"metadata": {
"id": "cqnU3dGPd6NK"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def compute_generator_gradient(z, theta, phi0, phi1):\n",
" delta = 0.0001\n",
" loss1 = compute_generator_loss(z,theta, phi0, phi1) ;\n",
" loss2 = compute_generator_loss(z,theta+delta, phi0, phi1) ;\n",
" dl_dtheta = (loss2-loss1)/ delta\n",
" return dl_dtheta\n",
"\n",
"def update_generator(z, theta, n_iter, phi0, phi1):\n",
" # Define learning rate\n",
" alpha = 0.02\n",
"\n",
" # Get derivatives\n",
" print(\"Initial generator loss = \", compute_generator_loss(z, theta, phi0, phi1))\n",
" for iter in range(n_iter):\n",
" # Get gradient\n",
" dl_dtheta = compute_generator_gradient(x_real, x_syn, phi0, phi1)\n",
" # Take a gradient step (uphill, since we are trying to make synthesized data less well classified by discriminator)\n",
" theta = theta + alpha * dl_dtheta ;\n",
"\n",
" print(\"Final generator loss = \", compute_generator_loss(z, theta, phi0, phi1))\n",
" return theta\n"
],
"metadata": {
"id": "P1Lqy922dqal"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"n_iter = 10\n",
"theta = 3.0\n",
"print(\"Theta before\", theta)\n",
"theta = update_generator(z, theta, n_iter, phi0, phi1)\n",
"print(\"Theta after\", theta)\n",
"\n",
"x_syn = generator(z,theta)\n",
"draw_data_model(x_real, x_syn, phi0, phi1)"
],
"metadata": {
"id": "Q6kUkMO1P8V0"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Now let's define a full GAN loop\n",
"\n",
"# Initialize the parameters\n",
"theta = 3\n",
"phi0 = -2\n",
"phi1 = 1\n",
"\n",
"# Number of iterations for updating generator and discriminator\n",
"n_iter_discrim = 300\n",
"n_iter_gen = 3\n",
"\n",
"print(\"Final parameters (phi0,phi1)\", phi0, phi1)\n",
"for c_gan_iter in range(5):\n",
"\n",
" # Run generator to product syntehsized data\n",
" x_syn = generator(z, theta)\n",
" draw_data_model(x_real, x_syn, phi0, phi1)\n",
"\n",
" # Update the discriminator\n",
" print(\"Updating discriminator\")\n",
" phi0, phi1 = update_discriminator(x_real, x_syn, n_iter_discrim, phi0, phi1)\n",
" draw_data_model(x_real, x_syn, phi0, phi1)\n",
"\n",
" # Update the generator\n",
" print(\"Updating generator\")\n",
" theta = update_generator(z, theta, n_iter_gen, phi0, phi1)\n"
],
"metadata": {
"id": "pcbdK2agTO-y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"You can see that the synthesized data (orange) is becoming closer to the true data (cyan). However, this is extremely unstable -- as you will find if you mess around with the number of iterations of each optimization and the total iterations overall."
],
"metadata": {
"id": "loMx0TQUgBs7"
}
}
]
}

View File

@@ -0,0 +1,246 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyNyLnpoXgKN+RGCuTUszCAZ",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap15/15_2_Wasserstein_Distance.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 15.2: Wassserstein Distance**\n",
"\n",
"This notebook investigates the GAN toy example as illustred in figure 15.1 in the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from matplotlib import cm\n",
"from matplotlib.colors import ListedColormap\n",
"from scipy.optimize import linprog"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define two probability distributions\n",
"p = np.array([5, 3, 2, 1, 8, 7, 5, 9, 2, 1])\n",
"q = np.array([4, 10,1, 1, 4, 6, 3, 2, 0, 1])\n",
"p = p/np.sum(p);\n",
"q= q/np.sum(q);\n",
"\n",
"# Draw those distributions\n",
"fig, ax =plt.subplots(2,1);\n",
"x = np.arange(0,p.size,1)\n",
"ax[0].bar(x,p, color=\"#cccccc\")\n",
"ax[0].set_ylim([0,0.35])\n",
"ax[0].set_ylabel(\"p(x=i)\")\n",
"\n",
"ax[1].bar(x,q,color=\"#f47a60\")\n",
"ax[1].set_ylim([0,0.35])\n",
"ax[1].set_ylabel(\"q(x=j)\")\n",
"plt.show()"
],
"metadata": {
"id": "ZIfQwhd-AV6L"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO Define the distance matrix from figure 15.8d\n",
"# Replace this line\n",
"dist_mat = np.zeros((10,10))\n",
"\n",
"# vectorize the distance matrix\n",
"c = dist_mat.flatten()"
],
"metadata": {
"id": "EZSlZQzWBKTm"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define pretty colormap\n",
"my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
"my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
"r = np.floor(my_colormap_vals_dec/(256*256))\n",
"g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
"b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
"my_colormap = ListedColormap(np.vstack((r,g,b)).transpose()/255.0)\n",
"\n",
"def draw_2D_heatmap(data, title, my_colormap):\n",
" # Make grid of intercept/slope values to plot\n",
" xv, yv = np.meshgrid(np.linspace(0, 1, 10), np.linspace(0, 1, 10))\n",
" fig,ax = plt.subplots()\n",
" fig.set_size_inches(4,4)\n",
" plt.imshow(data, cmap=my_colormap)\n",
" ax.set_title(title)\n",
" ax.set_xlabel('$q$'); ax.set_ylabel('$p$')\n",
" plt.show()"
],
"metadata": {
"id": "ABRANmp6F8iQ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"draw_2D_heatmap(dist_mat,'Distance $|i-j|$', my_colormap)"
],
"metadata": {
"id": "G0HFPBXyHT6V"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define b to be the verticalconcatenation of p and q\n",
"b = np.hstack((p,q))[np.newaxis].transpose()"
],
"metadata": {
"id": "SfqeT3KlHWrt"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO: Now construct the matrix A that has the initial distribution constraints\n",
"# so that Ap=b where p is the transport plan P vectorized rows first so p = np.flatten(P)\n",
"# Replace this line:\n",
"A = np.zeros((20,100))\n"
],
"metadata": {
"id": "7KrybL96IuNW"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now we have all of the things we need. The vectorized distance matrix $\\mathbf{c}$, the constraint matrix $\\mathbf{A}$, the vectorized and concatenated original distribution $\\mathbf{b}$. We can run the linear programming optimization."
],
"metadata": {
"id": "zEuEtU33S8Ly"
}
},
{
"cell_type": "code",
"source": [
"# We don't need the constraint that p>0 as this is the default\n",
"opt = linprog(c, A_eq=A, b_eq=b)\n",
"print(opt)"
],
"metadata": {
"id": "wCfsOVbeSmF5"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Extract the answer and display"
],
"metadata": {
"id": "vpkkOOI2agyl"
}
},
{
"cell_type": "code",
"source": [
"P = np.array(opt.x).reshape(10,10)\n",
"draw_2D_heatmap(P,'Transport plan $\\mathbf{P}$', my_colormap)"
],
"metadata": {
"id": "nZGfkrbRV_D0"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Compute the Wasserstein distance\n"
],
"metadata": {
"id": "ZEiRYRVgalsJ"
}
},
{
"cell_type": "code",
"source": [
"was = np.sum(P * dist_mat)\n",
"print(\"Wasserstein distance = \", was)"
],
"metadata": {
"id": "yiQ_8j-Raq3c"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"TODO -- Compute the\n",
"\n",
"* Forward KL divergence $D_{KL}[p,q]$ between these distributions\n",
"* Reverse KL divergence $D_{KL}[q,p]$ between these distributions\n",
"* Jensen-Shannon divergence $D_{JS}[p,q]$ between these distributions\n",
"\n",
"What do you conclude?"
],
"metadata": {
"id": "zf8yTusua71s"
}
}
]
}

View File

@@ -0,0 +1,235 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyMJLViYIpiivB2A7YIuZmzU",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap16/16_1_1D_Normalizing_Flows.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 16.1: 1D normalizing flows**\n",
"\n",
"This notebook investigates a 1D normalizing flows example similar to that illustrated in figures 16.1 to 16.3 in the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"First we start with a base probability density function"
],
"metadata": {
"id": "IyVn-Gi-p7wf"
}
},
{
"cell_type": "code",
"source": [
"# Define the base pdf\n",
"def gauss_pdf(z, mu, sigma):\n",
" pr_z = np.exp( -0.5 * (z-mu) * (z-mu) / (sigma * sigma))/(np.sqrt(2*3.1413) * sigma)\n",
" return pr_z"
],
"metadata": {
"id": "ZIfQwhd-AV6L"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"z = np.arange(-3,3,0.01)\n",
"pr_z = gauss_pdf(z, 0, 1)\n",
"\n",
"fig,ax = plt.subplots()\n",
"ax.plot(z, pr_z)\n",
"ax.set_xlim([-3,3])\n",
"ax.set_xlabel('$z$')\n",
"ax.set_ylabel('$Pr(z)$')\n",
"plt.show();"
],
"metadata": {
"id": "gGh8RHmFp_Ls"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's define a nonlinear function that maps from the latent space $z$ to the observed data $x$."
],
"metadata": {
"id": "wVXi5qIfrL9T"
}
},
{
"cell_type": "code",
"source": [
"# Define a function that maps from the base pdf over z to the observed space x\n",
"def f(z):\n",
" x1 = 6/(1+np.exp(-(z-0.25)*1.5))-3\n",
" x2 = z\n",
" p = z * z/9\n",
" x = (1-p) * x1 + p * x2\n",
" return x\n",
"\n",
"# Compute gradient of that function using finite differences\n",
"def df_dz(z):\n",
" return (f(z+0.0001)-f(z-0.0001))/0.0002"
],
"metadata": {
"id": "shHdgZHjp52w"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"x = f(z)\n",
"fig, ax = plt.subplots()\n",
"ax.plot(z,x)\n",
"ax.set_xlim(-3,3)\n",
"ax.set_ylim(-3,3)\n",
"ax.set_xlabel('Latent variable, $z$')\n",
"ax.set_ylabel('Observed variable, $x$')\n",
"plt.show()"
],
"metadata": {
"id": "sz7bnCLUq3Qs"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's evaluate the density in the observed space using equation 16.1"
],
"metadata": {
"id": "rmI0BbuQyXoc"
}
},
{
"cell_type": "code",
"source": [
"# TODO -- plot the density in the observed space\n",
"# Replace these line\n",
"x = np.ones_like(z)\n",
"pr_x = np.ones_like(pr_z)\n"
],
"metadata": {
"id": "iPdiT_5gyNOD"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Plot the density in the observed space\n",
"fig,ax = plt.subplots()\n",
"ax.plot(x, pr_x)\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([0, 0.5])\n",
"ax.set_xlabel('$x$')\n",
"ax.set_ylabel('$Pr(x)$')\n",
"plt.show();"
],
"metadata": {
"id": "Jlks8MW3zulA"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's draw some samples from the new distribution (see section 16.1)"
],
"metadata": {
"id": "1c5rO0HHz-FV"
}
},
{
"cell_type": "code",
"source": [
"np.random.seed(1)\n",
"n_sample = 20\n",
"\n",
"# TODO -- Draw samples from the modeled density\n",
"# Replace this line\n",
"x_samples = np.ones((n_sample, 1))\n",
"\n"
],
"metadata": {
"id": "LIlTRfpZz2k_"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Draw the samples\n",
"fig,ax = plt.subplots()\n",
"ax.plot(x, pr_x)\n",
"for x_sample in x_samples:\n",
" ax.plot([x_sample, x_sample], [0,0.1], 'r-')\n",
"\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([0, 0.5])\n",
"ax.set_xlabel('$x$')\n",
"ax.set_ylabel('$Pr(x)$')\n",
"plt.show();"
],
"metadata": {
"id": "JS__QPNv0vUA"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,307 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyMe8jb5kLJqkNSE/AwExTpa",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap16/16_2_Autoregressive_Flows.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 16.2: 1D autoregressive flows**\n",
"\n",
"This notebook investigates a 1D normalizing flows example similar to that illustrated in figure 16.7 in the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"First we'll define an invertible one dimensional function as in figure 16.5"
],
"metadata": {
"id": "jTK456TUd2FV"
}
},
{
"cell_type": "code",
"source": [
"# First let's make the 1D piecewise linear mapping as illustated in figure 16.5\n",
"def g(h, phi):\n",
" # TODO -- write this function (equation 16.12)\n",
" # Note: If you have the first printing of the book, there is a mistake in equation 16.12\n",
" # Check the errata for the correct equation (or figure it out yourself!)\n",
" # Replace this line:\n",
" h_prime = 1\n",
"\n",
"\n",
" return h_prime"
],
"metadata": {
"id": "zceww_9qFi00"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Let's test this out. If you managed to vectorize the routine above, then good for you\n",
"# but I'll assume you didn't and so we'll use a loop\n",
"\n",
"# Define the parameters\n",
"phi = np.array([0.2, 0.1, 0.4, 0.05, 0.25])\n",
"\n",
"# Run the function on an array\n",
"h = np.arange(0,1,0.01)\n",
"h_prime = np.zeros_like(h)\n",
"for i in range(len(h)):\n",
" h_prime[i] = g(h[i], phi)\n",
"\n",
"# Draw the function\n",
"fig, ax = plt.subplots()\n",
"ax.plot(h,h_prime, 'b-')\n",
"ax.set_xlim([0,1])\n",
"ax.set_ylim([0,1])\n",
"ax.set_xlabel('Input, $h$')\n",
"ax.set_ylabel('Output, $h^\\prime$')\n",
"plt.show()\n"
],
"metadata": {
"id": "CLXhYl9ZIuRN"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We will also need the inverse of this function"
],
"metadata": {
"id": "zOCMYC0leOyZ"
}
},
{
"cell_type": "code",
"source": [
"# Define the inverse function\n",
"def g_inverse(h_prime, phi):\n",
" # Lot's of ways to do this, but we'll just do it by bracketing\n",
" h_low = 0\n",
" h_mid = 0.5\n",
" h_high = 0.999\n",
"\n",
" thresh = 0.0001\n",
" c_iter = 0\n",
" while(c_iter < 20 and h_high - h_low > thresh):\n",
" h_prime_low = g(h_low, phi)\n",
" h_prime_mid = g(h_mid, phi)\n",
" h_prime_high = g(h_high, phi)\n",
" if h_prime_mid < h_prime:\n",
" h_low = h_mid\n",
" else:\n",
" h_high = h_mid\n",
"\n",
" h_mid = h_low+(h_high-h_low)/2\n",
" c_iter+=1\n",
"\n",
" return h_mid"
],
"metadata": {
"id": "OIqFAgobeSM8"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's define an autogressive flow. Let's switch to looking at figure 16.7.# We'll assume that our piecewise function will use five parameters phi1,phi2,phi3,phi4,phi5"
],
"metadata": {
"id": "t8XPxipfd7hz"
}
},
{
"cell_type": "code",
"source": [
"\n",
"def ReLU(preactivation):\n",
" activation = preactivation.clip(0.0)\n",
" return activation\n",
"\n",
"def softmax(x):\n",
" x = np.exp(x) ;\n",
" x = x/ np.sum(x) ;\n",
" return x\n",
"\n",
"# Return value of phi that doesn't depend on any of the iputs\n",
"def get_phi():\n",
" return np.array([0.2, 0.1, 0.4, 0.05, 0.25])\n",
"\n",
"# Compute values of phi that depend on h1\n",
"def shallow_network_phi_h1(h1, n_hidden=10):\n",
" # For neatness of code, we'll just define the parameters in the network definition itself\n",
" n_input = 1\n",
" np.random.seed(n_input)\n",
" beta0 = np.random.normal(size=(n_hidden,1))\n",
" Omega0 = np.random.normal(size=(n_hidden, n_input))\n",
" beta1 = np.random.normal(size=(5,1))\n",
" Omega1 = np.random.normal(size=(5, n_hidden))\n",
" return softmax(beta1 + Omega1 @ ReLU(beta0 + Omega0 @ np.array([[h1]])))\n",
"\n",
"# Compute values of phi that depend on h1 and h2\n",
"def shallow_network_phi_h1h2(h1,h2,n_hidden=10):\n",
" # For neatness of code, we'll just define the parameters in the network definition itself\n",
" n_input = 2\n",
" np.random.seed(n_input)\n",
" beta0 = np.random.normal(size=(n_hidden,1))\n",
" Omega0 = np.random.normal(size=(n_hidden, n_input))\n",
" beta1 = np.random.normal(size=(5,1))\n",
" Omega1 = np.random.normal(size=(5, n_hidden))\n",
" return softmax(beta1 + Omega1 @ ReLU(beta0 + Omega0 @ np.array([[h1],[h2]])))\n",
"\n",
"# Compute values of phi that depend on h1, h2, and h3\n",
"def shallow_network_phi_h1h2h3(h1,h2,h3, n_hidden=10):\n",
" # For neatness of code, we'll just define the parameters in the network definition itself\n",
" n_input = 3\n",
" np.random.seed(n_input)\n",
" beta0 = np.random.normal(size=(n_hidden,1))\n",
" Omega0 = np.random.normal(size=(n_hidden, n_input))\n",
" beta1 = np.random.normal(size=(5,1))\n",
" Omega1 = np.random.normal(size=(5, n_hidden))\n",
" return softmax(beta1 + Omega1 @ ReLU(beta0 + Omega0 @ np.array([[h1],[h2],[h3]])))"
],
"metadata": {
"id": "PnHGlZtcNEAI"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The forward mapping as shown in figure 16.7 a"
],
"metadata": {
"id": "8fXeG4V44GVH"
}
},
{
"cell_type": "code",
"source": [
"def forward_mapping(h1,h2,h3,h4):\n",
" #TODO implement the forward mapping\n",
" #Replace this line:\n",
" h_prime1 = 0 ; h_prime2=0; h_prime3=0; h_prime4 = 0\n",
"\n",
" return h_prime1, h_prime2, h_prime3, h_prime4"
],
"metadata": {
"id": "N1zjnIoX0TRP"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The backward mapping as shown in figure 16.7b"
],
"metadata": {
"id": "H8vQfFwI4L7r"
}
},
{
"cell_type": "code",
"source": [
"def backward_mapping(h1_prime,h2_prime,h3_prime,h4_prime):\n",
" #TODO implement the backward mapping\n",
" #Replace this line:\n",
" h1=0; h2=0; h3=0; h4 = 0\n",
"\n",
" return h1,h2,h3,h4"
],
"metadata": {
"id": "HNcQTiVE4DMJ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Finally, let's make sure that the network really can be inverted"
],
"metadata": {
"id": "W2IxFkuyZJyn"
}
},
{
"cell_type": "code",
"source": [
"# Test the network to see if it does invert correctly\n",
"h1 = 0.22; h2 = 0.41; h3 = 0.83; h4 = 0.53\n",
"print(\"Original h values %3.3f,%3.3f,%3.3f,%3.3f\"%(h1,h2,h3,h4))\n",
"h1_prime, h2_prime, h3_prime, h4_prime = forward_mapping(h1,h2,h3,h4)\n",
"print(\"h_prime values %3.3f,%3.3f,%3.3f,%3.3f\"%(h1_prime,h2_prime,h3_prime,h4_prime))\n",
"h1,h2,h3,h4 = backward_mapping(h1_prime,h2_prime,h3_prime,h4_prime)\n",
"print(\"Reconstructed h values %3.3f,%3.3f,%3.3f,%3.3f\"%(h1,h2,h3,h4))"
],
"metadata": {
"id": "RT7qvEFp700I"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [],
"metadata": {
"id": "sDknSPMLZmzh"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,294 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyNeCWINUqqUGKMcxsqPFTAh",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap16/16_3_Contraction_Mappings.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 16.3: Contraction mappings**\n",
"\n",
"This notebook investigates a 1D normalizing flows example similar to that illustrated in figure 16.9 in the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define a function that is a contraction mapping\n",
"def f(z):\n",
" return 0.3 + 0.5 *z + 0.02 * np.sin(z*15)"
],
"metadata": {
"id": "4Pfz2KSghdVI"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def draw_function(f, fixed_point=None):\n",
" z = np.arange(0,1,0.01)\n",
" z_prime = f(z)\n",
"\n",
" # Draw this function\n",
" fig, ax = plt.subplots()\n",
" ax.plot(z, z_prime,'c-')\n",
" ax.plot([0,1],[0,1],'k--')\n",
" if fixed_point!=None:\n",
" ax.plot(fixed_point, fixed_point, 'ro')\n",
" ax.set_xlim(0,1)\n",
" ax.set_ylim(0,1)\n",
" ax.set_xlabel('Input, $z$')\n",
" ax.set_ylabel('Output, f$[z]$')\n",
" plt.show()"
],
"metadata": {
"id": "zEwCbIx0hpAI"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"draw_function(f)"
],
"metadata": {
"id": "k4e5Yu0fl8bz"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's find where $\\mbox{f}[z]=z$ using fixed point iteration"
],
"metadata": {
"id": "DfgKrpCAjnol"
}
},
{
"cell_type": "code",
"source": [
"# Takes a function f and a starting point z\n",
"def fixed_point_iteration(f, z0):\n",
" # TODO -- write this function\n",
" # Print out the iterations as you go, so you can see the progress\n",
" # Set the maximum number of iterations to 20\n",
" # Replace this line\n",
" z_out = 0.5;\n",
"\n",
"\n",
"\n",
" return z_out"
],
"metadata": {
"id": "bAOBvZT-j3lv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's test that and plot the solution"
],
"metadata": {
"id": "CAS0lgIomAa0"
}
},
{
"cell_type": "code",
"source": [
"# Now let's test that\n",
"z = fixed_point_iteration(f, 0.2)\n",
"draw_function(f, z)"
],
"metadata": {
"id": "EYQZJdNPk8Lg"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Let's define another function\n",
"def f2(z):\n",
" return 0.7 + -0.6 *z + 0.03 * np.sin(z*15)\n",
"draw_function(f2)"
],
"metadata": {
"id": "4DipPiqVlnwJ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Now let's test that\n",
"# TODO Before running this code, predict what you think will happen\n",
"z = fixed_point_iteration(f2, 0.9)\n",
"draw_function(f2, z)"
],
"metadata": {
"id": "tYOdbWcomdEE"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Let's define another function\n",
"# Define a function that is a contraction mapping\n",
"def f3(z):\n",
" return -0.2 + 1.5 *z + 0.1 * np.sin(z*15)\n",
"draw_function(f3)"
],
"metadata": {
"id": "Mni37RUpmrIu"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Now let's test that\n",
"# TODO Before running this code, predict what you think will happen\n",
"z = fixed_point_iteration(f3, 0.7)\n",
"draw_function(f3, z)"
],
"metadata": {
"id": "agt5mfJrnM1O"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Finally, let's invert a problem of the form $y = z+ f[z]$ for a given value of $y$. What is the $z$ that maps to it?"
],
"metadata": {
"id": "n6GI46-ZoQz6"
}
},
{
"cell_type": "code",
"source": [
"def f4(z):\n",
" return -0.3 + 0.5 *z + 0.02 * np.sin(z*15)"
],
"metadata": {
"id": "dy6r3jr9rjPf"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def fixed_point_iteration_z_plus_f(f, y, z0):\n",
" # TODO -- write this function\n",
" # Replace this line\n",
" z_out = 1\n",
"\n",
" return z_out"
],
"metadata": {
"id": "GMX64Iz0nl-B"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def draw_function2(f, y, fixed_point=None):\n",
" z = np.arange(0,1,0.01)\n",
" z_prime = z+f(z)\n",
"\n",
" # Draw this function\n",
" fig, ax = plt.subplots()\n",
" ax.plot(z, z_prime,'c-')\n",
" ax.plot(z, y-f(z),'r-')\n",
" ax.plot([0,1],[0,1],'k--')\n",
" if fixed_point!=None:\n",
" ax.plot(fixed_point, y, 'ro')\n",
" ax.set_xlim(0,1)\n",
" ax.set_ylim(0,1)\n",
" ax.set_xlabel('Input, $z$')\n",
" ax.set_ylabel('Output, z+f$[z]$')\n",
" plt.show()"
],
"metadata": {
"id": "uXxKHad5qT8Y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Test this out and draw\n",
"y = 0.8\n",
"z = fixed_point_iteration_z_plus_f(f4,y,0.2)\n",
"draw_function2(f4,y,z)\n",
"# If you have done this correctly, the red dot should be\n",
"# where the cyan curve has a y value of 0.8"
],
"metadata": {
"id": "mNEBXC3Aqd_1"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,396 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyMBYNsjj1iTgHUYhAXqUYJd",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap17/17_1_Latent_Variable_Models.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 17.1: Latent variable models**\n",
"\n",
"This notebook investigates a non-linear latent variable model similar to that in figures 17.2 and 17.3 of the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"import scipy\n",
"from matplotlib.colors import ListedColormap\n",
"from matplotlib import cm"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We'll assume that our base distribution over the latent variables is a 1D standard normal so that\n",
"\n",
"\\begin{equation}\n",
"Pr(z) = \\mbox{Norm}_{z}[0,1]\n",
"\\end{equation}\n",
"\n",
"As in figure 17.2, we'll assume that the output is two dimensional, we we need to define a function that maps from the 1D latent variable to two dimensions. Usually, we would use a neural network, but in this case, we'll just define an arbitrary relationship.\n",
"\n",
"\\begin{eqnarray}\n",
"x_{1} &=& 0.5\\cdot\\exp\\Bigl[\\sin\\bigl[2+ 3.675 z \\bigr]\\Bigr]\\\\\n",
"x_{2} &=& \\sin\\bigl[2+ 2.85 z \\bigr]\n",
"\\end{eqnarray}"
],
"metadata": {
"id": "IyVn-Gi-p7wf"
}
},
{
"cell_type": "code",
"source": [
"# The function that maps z to x1 and x2\n",
"def f(z):\n",
" x_1 = np.exp(np.sin(2+z*3.675)) * 0.5\n",
" x_2 = np.cos(2+z*2.85)\n",
" return x_1, x_2"
],
"metadata": {
"id": "ZIfQwhd-AV6L"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's plot the 3D relation between the two observed variables $x_{1}$ and $x_{2}$ and the latent variables $z$ as in figure 17.2 of the book. We'll use the opacity to represent the prior probability $Pr(z)$."
],
"metadata": {
"id": "KB9FU34onW1j"
}
},
{
"cell_type": "code",
"source": [
"def draw_3d_projection(z,pr_z, x1,x2):\n",
" alpha = pr_z / np.max(pr_z)\n",
" ax = plt.axes(projection='3d')\n",
" fig = plt.gcf()\n",
" fig.set_size_inches(18.5, 10.5)\n",
" for i in range(len(z)-1):\n",
" ax.plot([z[i],z[i+1]],[x1[i],x1[i+1]],[x2[i],x2[i+1]],'r-', alpha=pr_z[i])\n",
" ax.set_xlabel('$z$',)\n",
" ax.set_ylabel('$x_1$')\n",
" ax.set_zlabel('$x_2$')\n",
" ax.set_xlim(-3,3)\n",
" ax.set_ylim(0,2)\n",
" ax.set_zlim(-1,1)\n",
" ax.set_box_aspect((3,1,1))\n",
" plt.show()"
],
"metadata": {
"id": "lW08xqAgnP4q"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Compute the prior\n",
"def get_prior(z):\n",
" return scipy.stats.multivariate_normal.pdf(z)"
],
"metadata": {
"id": "9DUTauMi6tPk"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define the latent variable values\n",
"z = np.arange(-3.0,3.0,0.01)\n",
"# Find the probability distribution over z\n",
"pr_z = get_prior(z)\n",
"# Compute x1 and x2 for each z\n",
"x1,x2 = f(z)\n",
"# Plot the function\n",
"draw_3d_projection(z,pr_z, x1,x2)"
],
"metadata": {
"id": "PAzHq461VqvF"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The likelihood is defined as:\n",
"\\begin{eqnarray}\n",
" Pr(x_1,x_2|z) &=& \\mbox{Norm}_{[x_1,x_2]}\\Bigl[\\mathbf{f}[z],\\sigma^{2}\\mathbf{I}\\Bigr]\n",
"\\end{eqnarray}\n",
"\n",
"so we will also need to define the noise level $\\sigma^2$"
],
"metadata": {
"id": "sQg2gKR5zMrF"
}
},
{
"cell_type": "code",
"source": [
"sigma_sq = 0.04"
],
"metadata": {
"id": "In_Vg4_0nva3"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Draws a heatmap to represent a probability distribution, possibly with samples overlaed\n",
"def plot_heatmap(x1_mesh,x2_mesh,y_mesh, x1_samples=None, x2_samples=None, title=None):\n",
" # Define pretty colormap\n",
" my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
" my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
" r = np.floor(my_colormap_vals_dec/(256*256))\n",
" g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
" b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
" my_colormap = ListedColormap(np.vstack((r,g,b)).transpose()/255.0)\n",
"\n",
" fig,ax = plt.subplots()\n",
" fig.set_size_inches(8,8)\n",
" ax.contourf(x1_mesh,x2_mesh,y_mesh,256,cmap=my_colormap)\n",
" ax.contour(x1_mesh,x2_mesh,y_mesh,8,colors=['#80808080'])\n",
" if title is not None:\n",
" ax.set_title(title);\n",
" if x1_samples is not None:\n",
" ax.plot(x1_samples, x2_samples, 'c.')\n",
" ax.set_xlim([-0.5,2.5])\n",
" ax.set_ylim([-1.5,1.5])\n",
" ax.set_xlabel('$x_1$'); ax.set_ylabel('$x_2$')\n",
" plt.show()\n",
"\n"
],
"metadata": {
"id": "6P6d-AgAqxXZ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Returns the likelihood\n",
"def get_likelihood(x1_mesh, x2_mesh, z_val):\n",
" # Find the corresponding x1 and x2 values\n",
" x1,x2 = f(z_val)\n",
"\n",
" # Calculate the probability for a mesh of x1,x2 values.\n",
" mn = scipy.stats.multivariate_normal([x1, x2], [[sigma_sq, 0], [0, sigma_sq]])\n",
" pr_x1_x2_given_z_val = mn.pdf(np.dstack((x1_mesh, x2_mesh)))\n",
" return pr_x1_x2_given_z_val"
],
"metadata": {
"id": "diYKb7_ZgjlJ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's plot the likelihood $Pr(x_1,x_2|z)$ as in fig 17.3b in the book."
],
"metadata": {
"id": "0X4NwixzqxtZ"
}
},
{
"cell_type": "code",
"source": [
"# Choose some z value\n",
"z_val = 1.8\n",
"\n",
"# Compute the conditional distribution on a grid\n",
"x1_mesh, x2_mesh = np.meshgrid(np.arange(-0.5,2.5,0.01), np.arange(-1.5,1.5,0.01))\n",
"pr_x1_x2_given_z_val = get_likelihood(x1_mesh,x2_mesh, z_val)\n",
"\n",
"# Plot the result\n",
"plot_heatmap(x1_mesh, x2_mesh, pr_x1_x2_given_z_val, title=\"Conditional distribution $Pr(x1,x2|z)$\")\n",
"\n",
"# TODO -- Experiment with different values of z and make sure that you understand the what is happening."
],
"metadata": {
"id": "hWfqK-Oz5_DT"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The data density is found by marginalizing over the latent variables $z$:\n",
"\n",
"\\begin{eqnarray}\n",
" Pr(x_1,x_2) &=& \\int Pr(x_1,x_2, z) dz \\nonumber \\\\\n",
" &=& \\int Pr(x_1,x_2 | z) \\cdot Pr(z)dz\\nonumber \\\\\n",
" &=& \\int \\mbox{Norm}_{[x_1,x_2]}\\Bigl[\\mathbf{f}[z],\\sigma^{2}\\mathbf{I}\\Bigr]\\cdot \\mbox{Norm}_{z}\\left[\\mathbf{0},\\mathbf{I}\\right]dz.\n",
"\\end{eqnarray}"
],
"metadata": {
"id": "25xqXnmFo-PH"
}
},
{
"cell_type": "code",
"source": [
"# TODO Compute the data density\n",
"# We can't integrate this function in closed form\n",
"# So let's approximate it as a sum over the z values (z = np.arange(-3,3,0.01))\n",
"# You will need the functions get_likelihood() and get_prior()\n",
"# To make this a valid probability distribution, you need to divide\n",
"# By the z-increment (0.01)\n",
"# Replace this line\n",
"pr_x1_x2 = np.zeros_like(x1_mesh)\n",
"\n",
"\n",
"# Plot the result\n",
"plot_heatmap(x1_mesh, x2_mesh, pr_x1_x2, title=\"Data density $Pr(x1,x2)$\")\n"
],
"metadata": {
"id": "H0Ijce9VzeCO"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's draw some samples from the model"
],
"metadata": {
"id": "W264N7By_h9y"
}
},
{
"cell_type": "code",
"source": [
"def draw_samples(n_sample):\n",
" # TODO Write this routine to draw n_sample samples from the model\n",
" # First draw a random value of z from the prior (a standard normal distribution)\n",
" # Then draw a sample from Pr(x1,x2|z)\n",
" # Replace this line\n",
" x1_samples=0; x2_samples = 0;\n",
"\n",
" return x1_samples, x2_samples"
],
"metadata": {
"id": "Li3mK_I48k0k"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's plot those samples on top of the heat map."
],
"metadata": {
"id": "D7N7oqLe-eJO"
}
},
{
"cell_type": "code",
"source": [
"x1_samples, x2_samples = draw_samples(500)\n",
"# Plot the result\n",
"plot_heatmap(x1_mesh, x2_mesh, pr_x1_x2, x1_samples, x2_samples, title=\"Data density $Pr(x1,x2)$\")\n"
],
"metadata": {
"id": "XRmWv99B-BWO"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Return the posterior distribution\n",
"def get_posterior(x1,x2):\n",
" z = np.arange(-3,3, 0.01)\n",
" # TODO -- write this function\n",
" # Again, we can't integrate, but we can sum\n",
" # We don't know the constant in the denominator of equation 17.19, but we can just normalize\n",
" # by the sum of the numerators for all values of z\n",
" # Replace this line:\n",
" pr_z_given_x1_x2 = np.ones_like(z)\n",
"\n",
"\n",
" return z, pr_z_given_x1_x2"
],
"metadata": {
"id": "PwOjzPD5_1OF"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"x1 = 0.9; x2 = -0.9\n",
"z, pr_z_given_x1_x2 = get_posterior(x1,x2)\n",
"\n",
"\n",
"fig, ax = plt.subplots()\n",
"ax.plot(z, pr_z_given_x1_x2, 'r-')\n",
"ax.set_xlabel(\"Latent variable $z$\")\n",
"ax.set_ylabel(\"Posterior probability $Pr(z|x_{1},x_{2})$\")\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([0,1.5 * np.max(pr_z_given_x1_x2)])\n",
"plt.show()"
],
"metadata": {
"id": "PKFUY42K-Tp7"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,423 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyOxO2/0DTH4n4zhC97qbagY",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap17/17_2_Reparameterization_Trick.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 17.2: Reparameterization trick**\n",
"\n",
"This notebook investigates the reparameterization trick as described in section 17.7 of the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The reparameterization trick computes the derivative of an expectation of a function $\\mbox{f}[x]$:\n",
"\n",
"\\begin{equation}\n",
"\\frac{\\partial}{\\partial \\boldsymbol\\phi} \\mathbb{E}_{Pr(x|\\boldsymbol\\phi)}\\bigl[\\mbox{f}[x]\\bigr],\n",
"\\end{equation}\n",
"\n",
"with respect to the parameters $\\boldsymbol\\phi$ of the distribution $Pr(x|\\boldsymbol\\phi)$ that the expectation is over.\n",
"\n",
"Let's consider a simple concrete example, where:\n",
"\n",
"\\begin{equation}\n",
"Pr(x|\\phi) = \\mbox{Norm}_{x}\\Bigl[\\mu, \\sigma^2\\Bigr]=\\mbox{Norm}_{x}\\Bigl[\\phi^3,(\\exp[\\phi])^2\\Bigr]\n",
"\\end{equation}\n",
"\n",
"and\n",
"\n",
"\\begin{equation}\n",
"\\mbox{f}[x] = x^2+\\sin[x]\n",
"\\end{equation}"
],
"metadata": {
"id": "paLz5RukZP1J"
}
},
{
"cell_type": "code",
"source": [
"# Let's approximate this expecctation for a particular value of phi\n",
"def compute_expectation(phi, n_samples):\n",
" # TODO complete this function\n",
" # 1. Compute the mean of the normal distribution, mu\n",
" # 2. Compute the standard deviation of the normal distribution, sigma\n",
" # 3. Draw n_samples samples using np.random.normal(mu, sigma, size=(n_samples, 1))\n",
" # 4. Compute f[x] for each of these samples\n",
" # 4. Approximate the expectation by taking the average of the values of f[x]\n",
" # Replace this line\n",
" expected_f_given_phi = 0\n",
"\n",
"\n",
" return expected_f_given_phi"
],
"metadata": {
"id": "FdEbMnDBY0i9"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set the seed so the random numbers are all the same\n",
"np.random.seed(0)\n",
"\n",
"# Compute the expectation for two values of phi\n",
"phi1 = 0.5\n",
"n_samples = 10000000\n",
"expected_f_given_phi1 = compute_expectation(phi1, n_samples)\n",
"print(\"Your value: \", expected_f_given_phi1, \", True value: 2.7650801613563116\")\n",
"\n",
"phi2 = -0.1\n",
"n_samples = 10000000\n",
"expected_f_given_phi2 = compute_expectation(phi2, n_samples)\n",
"print(\"Your value: \", expected_f_given_phi2, \", True value: 0.8176793102849222\")"
],
"metadata": {
"id": "FTh7LJ0llNJZ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Le't plot this expectation as a function of phi"
],
"metadata": {
"id": "r5Hl2QkimWx9"
}
},
{
"cell_type": "code",
"source": [
"phi_vals = np.arange(-1.5,1.5, 0.05)\n",
"expected_vals = np.zeros_like(phi_vals)\n",
"n_samples = 1000000\n",
"for i in range(len(phi_vals)):\n",
" expected_vals[i] = compute_expectation(phi_vals[i], n_samples)\n",
"\n",
"fig,ax = plt.subplots()\n",
"ax.plot(phi_vals, expected_vals,'r-')\n",
"ax.set_xlabel('Parameter $\\phi$')\n",
"ax.set_ylabel('$\\mathbb{E}_{Pr(x|\\phi)}[f[x]]$')\n",
"plt.show()"
],
"metadata": {
"id": "05XxVLJxmkER"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"It's this curve that we want to find the derivative of (so for example, we could run gradient descent and find the minimum.\n",
"\n",
"This is tricky though -- if you look at the computation that you performed, then there is a sampling step in the procedure (step 3). How do we compute the derivative of this?\n",
"\n",
"The answer is the reparameterization trick. We note that:\n",
"\n",
"\\begin{equation}\n",
"\\mbox{Norm}_{x}\\Bigl[\\mu, \\sigma^2\\Bigr]=\\mbox{Norm}_{x}\\Bigl[0, 1\\Bigr] \\times \\sigma + \\mu\n",
"\\end{equation}\n",
"\n",
"and so:\n",
"\n",
"\\begin{equation}\n",
"\\mbox{Norm}_{x}\\Bigl[\\phi^3,(\\exp[\\phi])^2\\Bigr] = \\mbox{Norm}_{x}\\Bigl[0, 1\\Bigr] \\times \\exp[\\phi]+ \\phi^3\n",
"\\end{equation}\n",
"\n",
"So, if we draw a sample $\\epsilon^*$ from $\\mbox{Norm}_{\\epsilon}[0, 1]$, then we can compute a sample $x^*$ as:\n",
"\n",
"\\begin{eqnarray*}\n",
"x^* &=& \\epsilon^* \\times \\sigma + \\mu \\\\\n",
"&=& \\epsilon^* \\times \\exp[\\phi]+ \\phi^3\n",
"\\end{eqnarray*}"
],
"metadata": {
"id": "zTCykVeWqj_O"
}
},
{
"cell_type": "code",
"source": [
"def compute_df_dx_star(x_star):\n",
" # TODO Compute this derivative (function defined at the top)\n",
" # Replace this line:\n",
" deriv = 0;\n",
"\n",
"\n",
"\n",
" return deriv\n",
"\n",
"def compute_dx_star_dphi(epsilon_star, phi):\n",
" # TODO Compute this derivative\n",
" # Replace this line:\n",
" deriv = 0;\n",
"\n",
"\n",
"\n",
" return deriv\n",
"\n",
"def compute_derivative_of_expectation(phi, n_samples):\n",
" # Generate the random values of epsilon\n",
" epsilon_star= np.random.normal(size=(n_samples,1))\n",
" # TODO -- write\n",
" # 1. Compute dx*/dphi using the function defined above\n",
" # 2. Compute x*\n",
" # 3. Compute df/dx* using the function you wrote above\n",
" # 4. Compute df/dphi = df/x* * dx*dphi\n",
" # 5. Average the samples of df/dphi to get the expectation.\n",
" # Replace this line:\n",
" df_dphi = 0\n",
"\n",
"\n",
"\n",
" return df_dphi"
],
"metadata": {
"id": "w13HVpi9q8nF"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set the seed so the random numbers are all the same\n",
"np.random.seed(0)\n",
"\n",
"# Compute the expectation for two values of phi\n",
"phi1 = 0.5\n",
"n_samples = 10000000\n",
"\n",
"deriv = compute_derivative_of_expectation(phi1, n_samples)\n",
"print(\"Your value: \", deriv, \", True value: 5.726338035051403\")"
],
"metadata": {
"id": "ntQT4An79kAl"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"phi_vals = np.arange(-1.5,1.5, 0.05)\n",
"deriv_vals = np.zeros_like(phi_vals)\n",
"n_samples = 1000000\n",
"for i in range(len(phi_vals)):\n",
" deriv_vals[i] = compute_derivative_of_expectation(phi_vals[i], n_samples)\n",
"\n",
"fig,ax = plt.subplots()\n",
"ax.plot(phi_vals, deriv_vals,'r-')\n",
"ax.set_xlabel('Parameter $\\phi$')\n",
"ax.set_ylabel('$\\partial/\\partial\\phi\\mathbb{E}_{Pr(x|\\phi)}[f[x]]$')\n",
"plt.show()"
],
"metadata": {
"id": "t0Jqd_IN_lMU"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"This should look plausibly like the derivative of the function we plotted above!"
],
"metadata": {
"id": "ASu4yKSwAEYI"
}
},
{
"cell_type": "markdown",
"source": [
"The reparameterization trick computes the derivative of an expectation of a function $\\mbox{f}[x]$:\n",
"\n",
"\\begin{equation}\n",
"\\frac{\\partial}{\\partial \\boldsymbol\\phi} \\mathbb{E}_{Pr(x|\\boldsymbol\\phi)}\\bigl[\\mbox{f}[x]\\bigr],\n",
"\\end{equation}\n",
"\n",
"with respect to the parameters $\\boldsymbol\\phi$ of the distribution $Pr(x|\\boldsymbol\\phi)$ that the expectation is over. This derivative can also be computed as:\n",
"\n",
"\\begin{eqnarray}\n",
"\\frac{\\partial}{\\partial \\boldsymbol\\phi} \\mathbb{E}_{Pr(x|\\boldsymbol\\phi)}\\bigl[\\mbox{f}[x]\\bigr] &=& \\mathbb{E}_{Pr(x|\\boldsymbol\\phi)}\\left[\\mbox{f}[x]\\frac{\\partial}{\\partial \\boldsymbol\\phi} \\log\\bigl[ Pr(x|\\boldsymbol\\phi)\\bigr]\\right]\\nonumber \\\\\n",
"&\\approx & \\frac{1}{I}\\sum_{i=1}^{I}\\mbox{f}[x_i]\\frac{\\partial}{\\partial \\boldsymbol\\phi} \\log\\bigl[ Pr(x_i|\\boldsymbol\\phi)\\bigr].\n",
"\\end{eqnarray}\n",
"\n",
"This method is known as the REINFORCE algorithm or score function estimator. Problem 17.5 asks you to prove this relation. Let's use this method to compute the gradient and compare.\n",
"\n",
"Recall that the expression for a univariate Gaussian is:\n",
"\n",
"\\begin{equation}\n",
" Pr(x|\\mu,\\sigma^2) = \\frac{1}{\\sqrt{2\\pi\\sigma^{2}}}\\exp\\left[-\\frac{(x-\\mu)^{2}}{2\\sigma^{2}}\\right].\n",
"\\end{equation}\n"
],
"metadata": {
"id": "xoFR1wifc8-b"
}
},
{
"cell_type": "code",
"source": [
"def d_log_pr_x_given_phi(x,phi):\n",
" # TODO -- fill in this function\n",
" # Compute the derivative of log[Pr(x|phi)]\n",
" # Replace this line:\n",
" deriv =0;\n",
"\n",
"\n",
" return deriv\n",
"\n",
"\n",
"def compute_derivative_of_expectation_score_function(phi, n_samples):\n",
" # TODO -- Compute this function\n",
" # 1. Calculate mu from phi\n",
" # 2. Calculate sigma from phi\n",
" # 3. Generate n_sample random samples of x using np.random.normal\n",
" # 4. Calculate f[x] for all of the samples\n",
" # 5. Multiply f[x] by d_log_pr_x_given_phi\n",
" # 6. Take the average of the samples\n",
" # Replace this line:\n",
" deriv = 0\n",
"\n",
"\n",
"\n",
" return deriv"
],
"metadata": {
"id": "4TUaxiWvASla"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set the seed so the random numbers are all the same\n",
"np.random.seed(0)\n",
"\n",
"# Compute the expectation for two values of phi\n",
"phi1 = 0.5\n",
"n_samples = 100000000\n",
"\n",
"deriv = compute_derivative_of_expectation_score_function(phi1, n_samples)\n",
"print(\"Your value: \", deriv, \", True value: 5.724609927313369\")"
],
"metadata": {
"id": "0RSN32Rna_C_"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"phi_vals = np.arange(-1.5,1.5, 0.05)\n",
"deriv_vals = np.zeros_like(phi_vals)\n",
"n_samples = 1000000\n",
"for i in range(len(phi_vals)):\n",
" deriv_vals[i] = compute_derivative_of_expectation_score_function(phi_vals[i], n_samples)\n",
"\n",
"fig,ax = plt.subplots()\n",
"ax.plot(phi_vals, deriv_vals,'r-')\n",
"ax.set_xlabel('Parameter $\\phi$')\n",
"ax.set_ylabel('$\\partial/\\partial\\phi\\mathbb{E}_{Pr(x|\\phi)}[f[x]]$')\n",
"plt.show()"
],
"metadata": {
"id": "EM_i5zoyElHR"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"This should look the same as the derivative that we computed with the reparameterization trick. So, is there any advantage to one way or the other? Let's compare the variances of the estimates\n"
],
"metadata": {
"id": "1TWBiUC7bQSw"
}
},
{
"cell_type": "code",
"source": [
"n_estimate = 100\n",
"n_sample = 1000\n",
"phi = 0.3\n",
"reparam_estimates = np.zeros((n_estimate,1))\n",
"score_function_estimates = np.zeros((n_estimate,1))\n",
"for i in range(n_estimate):\n",
" reparam_estimates[i]= compute_derivative_of_expectation(phi, n_samples)\n",
" score_function_estimates[i] = compute_derivative_of_expectation_score_function(phi, n_samples)\n",
"\n",
"print(\"Variance of reparameterization estimator\", np.var(reparam_estimates))\n",
"print(\"Variance of score function estimator\", np.var(score_function_estimates))"
],
"metadata": {
"id": "vV_Jx5bCbQGs"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The variance of the reparameterization estimator should be quite a bit lower than the score function estimator which is why it is preferred in this situation."
],
"metadata": {
"id": "d-0tntSYdKPR"
}
}
]
}

View File

@@ -0,0 +1,496 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyMvae+1cigwg2Htl6vt1Who",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap17/17_3_Importance_Sampling.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 17.3: Importance sampling**\n",
"\n",
"This notebook investigates importance sampling as described in section 17.8.1 of the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's approximate the expectation\n",
"\n",
"\\begin{equation}\n",
"\\mathbb{E}_{y}\\Bigl[\\exp\\bigl[- (y-1)^4\\bigr]\\Bigr] = \\int \\exp\\bigl[- (y-1)^4\\bigr] Pr(y) dy,\n",
"\\end{equation}\n",
"\n",
"where\n",
"\n",
"\\begin{equation}\n",
"Pr(y)=\\mbox{Norm}_y[0,1]\n",
"\\end{equation}\n",
"\n",
"by drawing $I$ samples $y_i$ and using the formula:\n",
"\n",
"\\begin{equation}\n",
"\\mathbb{E}_{y}\\Bigl[\\exp\\bigl[- (y-1)^4\\bigr]\\Bigr] \\approx \\frac{1}{I} \\sum_{i=1}^I \\exp\\bigl[-(y-1)^4 \\bigr]\n",
"\\end{equation}"
],
"metadata": {
"id": "f7a6xqKjkmvT"
}
},
{
"cell_type": "code",
"source": [
"def f(y):\n",
" return np.exp(-(y-1) *(y-1) *(y-1) * (y-1))\n",
"\n",
"\n",
"def pr_y(y):\n",
" return (1/np.sqrt(2*np.pi)) * np.exp(-0.5 * y * y)\n",
"\n",
"fig,ax = plt.subplots()\n",
"y = np.arange(-10,10,0.01)\n",
"ax.plot(y, f(y), 'r-', label='f$[y]$');\n",
"ax.plot(y, pr_y(y),'b-',label='$Pr(y)$')\n",
"ax.set_xlabel(\"$y$\")\n",
"ax.legend()\n",
"plt.show()"
],
"metadata": {
"id": "VjkzRr8o2ksg"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def compute_expectation(n_samples):\n",
" # TODO -- compute this expectation\n",
" # 1. Generate samples y_i using np.random.normal\n",
" # 2. Approximate the expectation of f[y]\n",
" # Replace this line\n",
" expectation = 0\n",
"\n",
"\n",
" return expectation"
],
"metadata": {
"id": "LGAKHjUJnWmy"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set the seed so the random numbers are all the same\n",
"np.random.seed(0)\n",
"\n",
"# Compute the expectation with a very large number of samples (good estimate)\n",
"n_samples = 100000000\n",
"expected_f= compute_expectation(n_samples)\n",
"print(\"Your value: \", expected_f, \", True value: 0.43160702267383166\")"
],
"metadata": {
"id": "nmvixMqgodIP"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's investigate how the variance of this approximation decreases as we increase the number of samples $N$.\n",
"\n",
"\n"
],
"metadata": {
"id": "Jr4UPcqmnXCS"
}
},
{
"cell_type": "code",
"source": [
"def compute_mean_variance(n_sample):\n",
" n_estimate = 10000\n",
" estimates = np.zeros((n_estimate,1))\n",
" for i in range(n_estimate):\n",
" estimates[i] = compute_expectation(n_sample.astype(int))\n",
" return np.mean(estimates), np.var(estimates)"
],
"metadata": {
"id": "yrDp1ILUo08j"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Compute the mean and variance for 1,2,... 20 samples\n",
"n_sample_all = np.array([1.,2,3,4,5,6,7,8,9,10,15,20,25,30,45,50,60,70,80,90,100,150,200,250,300,350,400,450,500])\n",
"mean_all = np.zeros_like(n_sample_all)\n",
"variance_all = np.zeros_like(n_sample_all)\n",
"for i in range(len(n_sample_all)):\n",
" print(\"Computing mean and variance for expectation with %d samples\"%(n_sample_all[i]))\n",
" mean_all[i],variance_all[i] = compute_mean_variance(n_sample_all[i])"
],
"metadata": {
"id": "BcUVsodtqdey"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig,ax = plt.subplots()\n",
"ax.semilogx(n_sample_all, mean_all,'r-',label='mean estimate')\n",
"ax.fill_between(n_sample_all, mean_all-2*np.sqrt(variance_all), mean_all+2*np.sqrt(variance_all))\n",
"ax.set_xlabel(\"Number of samples\")\n",
"ax.set_ylabel(\"Mean of estimate\")\n",
"ax.plot([0,500],[0.43160702267383166,0.43160702267383166],'k--',label='true value')\n",
"ax.legend()\n",
"plt.show()\n"
],
"metadata": {
"id": "feXmyk0krpUi"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"As you might expect, the more samples that we use to compute the approximate estimate, the lower the variance of the estimate."
],
"metadata": {
"id": "XTUpxFlSuOl7"
}
},
{
"cell_type": "markdown",
"source": [
" Now consider the function\n",
" \\begin{equation}\n",
" \\mbox{f}[y]= 20.446\\exp\\left[-(y-3)^4\\right],\n",
" \\end{equation}\n",
"\n",
"which decreases rapidly as we move away from the position $y=4$."
],
"metadata": {
"id": "6hxsl3Pxo1TT"
}
},
{
"cell_type": "code",
"source": [
"def f2(y):\n",
" return 20.446*np.exp(- (y-3) *(y-3) *(y-3) * (y-3))\n",
"\n",
"fig,ax = plt.subplots()\n",
"y = np.arange(-10,10,0.01)\n",
"ax.plot(y, f2(y), 'r-', label='f$[y]$');\n",
"ax.plot(y, pr_y(y),'b-',label='$Pr(y)$')\n",
"ax.set_xlabel(\"$y$\")\n",
"ax.legend()\n",
"plt.show()"
],
"metadata": {
"id": "znydVPW7sL4P"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's again, compute the expectation:\n",
"\n",
"\\begin{eqnarray}\n",
"\\mathbb{E}_{y}\\left[\\mbox{f}[y]\\right] &=& \\int \\mbox{f}[y] Pr(y) dy\\\\\n",
"&\\approx& \\frac{1}{I} \\mbox{f}[y]\n",
"\\end{eqnarray}\n",
"\n",
"where $Pr(y)=\\mbox{Norm}_y[0,1]$ by approximating with samples $y_{i}$.\n"
],
"metadata": {
"id": "G9Xxo0OJsIqD"
}
},
{
"cell_type": "code",
"source": [
"def compute_expectation2(n_samples):\n",
" y = np.random.normal(size=(n_samples,1))\n",
" expectation = np.mean(f2(y))\n",
"\n",
" return expectation"
],
"metadata": {
"id": "l8ZtmkA2vH4y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set the seed so the random numbers are all the same\n",
"np.random.seed(0)\n",
"\n",
"# Compute the expectation with a very large number of samples (good estimate)\n",
"n_samples = 100000000\n",
"expected_f2= compute_expectation2(n_samples)\n",
"print(\"Expected value: \", expected_f2)"
],
"metadata": {
"id": "dfUQyJ-svZ6F"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"I deliberately chose this function, because it's expectation is roughly the same as for the previous function.\n",
"\n",
"Again, let's look at the mean and the variance of the estimates"
],
"metadata": {
"id": "2sVDqP0BvxqM"
}
},
{
"cell_type": "code",
"source": [
"def compute_mean_variance2(n_sample):\n",
" n_estimate = 10000\n",
" estimates = np.zeros((n_estimate,1))\n",
" for i in range(n_estimate):\n",
" estimates[i] = compute_expectation2(n_sample.astype(int))\n",
" return np.mean(estimates), np.var(estimates)\n",
"\n",
"# Compute the variance for 1,2,... 20 samples\n",
"mean_all2 = np.zeros_like(n_sample_all)\n",
"variance_all2 = np.zeros_like(n_sample_all)\n",
"for i in range(len(n_sample_all)):\n",
" print(\"Computing variance for expectation with %d samples\"%(n_sample_all[i]))\n",
" mean_all2[i], variance_all2[i] = compute_mean_variance2(n_sample_all[i])"
],
"metadata": {
"id": "mHnILRkOv0Ir"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig,ax1 = plt.subplots()\n",
"ax1.semilogx(n_sample_all, mean_all,'r-',label='mean estimate')\n",
"ax1.fill_between(n_sample_all, mean_all-2*np.sqrt(variance_all), mean_all+2*np.sqrt(variance_all))\n",
"ax1.set_xlabel(\"Number of samples\")\n",
"ax1.set_ylabel(\"Mean of estimate\")\n",
"ax1.plot([1,500],[0.43160702267383166,0.43160702267383166],'k--',label='true value')\n",
"ax1.set_ylim(-5,6)\n",
"ax1.set_title(\"First function\")\n",
"ax1.legend()\n",
"\n",
"fig2,ax2 = plt.subplots()\n",
"ax2.semilogx(n_sample_all, mean_all2,'r-',label='mean estimate')\n",
"ax2.fill_between(n_sample_all, mean_all2-2*np.sqrt(variance_all2), mean_all2+2*np.sqrt(variance_all2))\n",
"ax2.set_xlabel(\"Number of samples\")\n",
"ax2.set_ylabel(\"Mean of estimate\")\n",
"ax2.plot([0,500],[0.43160428638892556,0.43160428638892556],'k--',label='true value')\n",
"ax2.set_ylim(-5,6)\n",
"ax2.set_title(\"Second function\")\n",
"ax2.legend()\n",
"plt.show()"
],
"metadata": {
"id": "FkCX-hxxAnsw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"You can see that the variance of the estimate of the second function is considerably worse than the estimate of the variance of estimate of the first function\n",
"\n",
"TODO: Think about why this is."
],
"metadata": {
"id": "EtBP6NeLwZqz"
}
},
{
"cell_type": "markdown",
"source": [
" Now let's repeat this experiment with the second function, but this time use importance sampling with auxiliary distribution:\n",
"\n",
" \\begin{equation}\n",
" q(y)=\\mbox{Norm}_{y}[3,1]\n",
" \\end{equation}\n"
],
"metadata": {
"id": "_wuF-NoQu1--"
}
},
{
"cell_type": "code",
"source": [
"def q_y(y):\n",
" return (1/np.sqrt(2*np.pi)) * np.exp(-0.5 * (y-3) * (y-3))\n",
"\n",
"def compute_expectation2b(n_samples):\n",
" # TODO -- complete this function\n",
" # 1. Draw n_samples from auxiliary distribution\n",
" # 2. Compute f[y] for those samples\n",
" # 3. Scale the results by pr_y / q_y\n",
" # 4. Compute the mean of these weighted samples\n",
" # Replace this line\n",
" expectation = 0\n",
"\n",
" return expectation"
],
"metadata": {
"id": "jPm0AVYVIDnn"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set the seed so the random numbers are all the same\n",
"np.random.seed(0)\n",
"\n",
"# Compute the expectation with a very large number of samples (good estimate)\n",
"n_samples = 100000000\n",
"expected_f2= compute_expectation2b(n_samples)\n",
"print(\"Your value: \", expected_f2,\", True value: 0.43163734204459125 \")"
],
"metadata": {
"id": "No2ByVvOM2yQ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def compute_mean_variance2b(n_sample):\n",
" n_estimate = 10000\n",
" estimates = np.zeros((n_estimate,1))\n",
" for i in range(n_estimate):\n",
" estimates[i] = compute_expectation2b(n_sample.astype(int))\n",
" return np.mean(estimates), np.var(estimates)\n",
"\n",
"# Compute the variance for 1,2,... 20 samples\n",
"mean_all2b = np.zeros_like(n_sample_all)\n",
"variance_all2b = np.zeros_like(n_sample_all)\n",
"for i in range(len(n_sample_all)):\n",
" print(\"Computing variance for expectation with %d samples\"%(n_sample_all[i]))\n",
" mean_all2b[i], variance_all2b[i] = compute_mean_variance2b(n_sample_all[i])"
],
"metadata": {
"id": "6v8Jc7z4M3Mk"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig,ax1 = plt.subplots()\n",
"ax1.semilogx(n_sample_all, mean_all,'r-',label='mean estimate')\n",
"ax1.fill_between(n_sample_all, mean_all-2*np.sqrt(variance_all), mean_all+2*np.sqrt(variance_all))\n",
"ax1.set_xlabel(\"Number of samples\")\n",
"ax1.set_ylabel(\"Mean of estimate\")\n",
"ax1.plot([1,500],[0.43160702267383166,0.43160702267383166],'k--',label='true value')\n",
"ax1.set_ylim(-5,6)\n",
"ax1.set_title(\"First function\")\n",
"ax1.legend()\n",
"\n",
"fig2,ax2 = plt.subplots()\n",
"ax2.semilogx(n_sample_all, mean_all2,'r-',label='mean estimate')\n",
"ax2.fill_between(n_sample_all, mean_all2-2*np.sqrt(variance_all2), mean_all2+2*np.sqrt(variance_all2))\n",
"ax2.set_xlabel(\"Number of samples\")\n",
"ax2.set_ylabel(\"Mean of estimate\")\n",
"ax2.plot([0,500],[0.43160428638892556,0.43160428638892556],'k--',label='true value')\n",
"ax2.set_ylim(-5,6)\n",
"ax2.set_title(\"Second function\")\n",
"ax2.legend()\n",
"plt.show()\n",
"\n",
"fig2,ax2 = plt.subplots()\n",
"ax2.semilogx(n_sample_all, mean_all2b,'r-',label='mean estimate')\n",
"ax2.fill_between(n_sample_all, mean_all2b-2*np.sqrt(variance_all2b), mean_all2b+2*np.sqrt(variance_all2b))\n",
"ax2.set_xlabel(\"Number of samples\")\n",
"ax2.set_ylabel(\"Mean of estimate\")\n",
"ax2.plot([0,500],[ 0.43163734204459125, 0.43163734204459125],'k--',label='true value')\n",
"ax2.set_ylim(-5,6)\n",
"ax2.set_title(\"Second function with importance sampling\")\n",
"ax2.legend()\n",
"plt.show()"
],
"metadata": {
"id": "C0beD4sNNM3L"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"You can see that the importance sampling technique has reduced the amount of variance for any given number of samples."
],
"metadata": {
"id": "y8rgge9MNiOc"
}
}
]
}

View File

@@ -0,0 +1,471 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyMpC8kgLnXx0XQBtwNAQ4jJ",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap18/18_1_Diffusion_Encoder.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 18.1: Diffusion Encoder**\n",
"\n",
"This notebook investigates the diffusion encoder as described in section 18.2 of the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from matplotlib.colors import ListedColormap\n",
"from operator import itemgetter"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"#Create pretty colormap as in book\n",
"my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
"my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
"r = np.floor(my_colormap_vals_dec/(256*256))\n",
"g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
"b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
"my_colormap_vals = np.vstack((r,g,b)).transpose()/255.0\n",
"my_colormap = ListedColormap(my_colormap_vals)"
],
"metadata": {
"id": "4PM8bf6lO0VE"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Probability distribution for normal\n",
"def norm_pdf(x, mu, sigma):\n",
" return np.exp(-0.5 * (x-mu) * (x-mu) / (sigma * sigma)) / np.sqrt(2*np.pi*sigma*sigma)"
],
"metadata": {
"id": "ONGRaQscfIOo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# True distribution is a mixture of four Gaussians\n",
"class TrueDataDistribution:\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
" self.mu = [1.5, -0.216, 0.45, -1.875]\n",
" self.sigma = [0.3, 0.15, 0.525, 0.075]\n",
" self.w = [0.2, 0.3, 0.35, 0.15]\n",
"\n",
" # Return PDF\n",
" def pdf(self, x):\n",
" return(self.w[0] *norm_pdf(x,self.mu[0],self.sigma[0]) + self.w[1] *norm_pdf(x,self.mu[1],self.sigma[1]) + self.w[2] *norm_pdf(x,self.mu[2],self.sigma[2]) + self.w[3] *norm_pdf(x,self.mu[3],self.sigma[3]))\n",
"\n",
" # Draw samples\n",
" def sample(self, n):\n",
" hidden = np.random.choice(4, n, p=self.w)\n",
" epsilon = np.random.normal(size=(n))\n",
" mu_list = list(itemgetter(*hidden)(self.mu))\n",
" sigma_list = list(itemgetter(*hidden)(self.sigma))\n",
" return mu_list + sigma_list * epsilon"
],
"metadata": {
"id": "gZvG0MKhfY8Y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define ground truth probability distribution that we will model\n",
"true_dist = TrueDataDistribution()\n",
"# Let's visualize this\n",
"x_vals = np.arange(-3,3,0.01)\n",
"pr_x_true = true_dist.pdf(x_vals)\n",
"fig,ax = plt.subplots()\n",
"ax.plot(x_vals, pr_x_true, 'r-')\n",
"ax.set_xlabel(\"$x$\")\n",
"ax.set_ylabel(\"$Pr(x)$\")\n",
"ax.set_ylim(0,1.0)\n",
"ax.set_xlim(-3,3)\n",
"plt.show()"
],
"metadata": {
"id": "qXmej3TUuQyp"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's first implement the forward process"
],
"metadata": {
"id": "XHdtfRP47YLy"
}
},
{
"cell_type": "code",
"source": [
"# Do one step of diffusion (equation 18.1)\n",
"def diffuse_one_step(z_t_minus_1, beta_t):\n",
" # TODO -- Implement this function\n",
" # Use np.random.normal to generate the samples epsilon\n",
" # Replace this line\n",
" z_t = np.zeros_like(z_t_minus_1)\n",
"\n",
" return z_t"
],
"metadata": {
"id": "hkApJ2VJlQuk"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's run the diffusion process for a whole bunch of samples"
],
"metadata": {
"id": "ECAUfHNi9NVW"
}
},
{
"cell_type": "code",
"source": [
"# Generate some samples\n",
"n_sample = 10000\n",
"np.random.seed(6)\n",
"x = true_dist.sample(n_sample)\n",
"\n",
"# Number of time steps\n",
"T = 100\n",
"# Noise schedule has same value at every time step\n",
"beta = 0.01511\n",
"\n",
"# We'll store the diffused samples in an array\n",
"samples = np.zeros((T+1, n_sample))\n",
"samples[0,:] = x\n",
"\n",
"for t in range(T):\n",
" samples[t+1,:] = diffuse_one_step(samples[t,:], beta)"
],
"metadata": {
"id": "M-TY5w9Q8LYW"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's, plot the evolution of a few paths as in figure 18.2"
],
"metadata": {
"id": "jYrAW6tN-gJ4"
}
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots()\n",
"t_vals = np.arange(0,101,1)\n",
"ax.plot(samples[:,0],t_vals,'r-')\n",
"ax.plot(samples[:,1],t_vals,'g-')\n",
"ax.plot(samples[:,2],t_vals,'b-')\n",
"ax.plot(samples[:,3],t_vals,'c-')\n",
"ax.plot(samples[:,4],t_vals,'m-')\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([101, 0])\n",
"ax.set_xlabel('value')\n",
"ax.set_ylabel('z_{t}')\n",
"plt.show()"
],
"metadata": {
"id": "4XU6CDZC_kFo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Notice that the samples have a tendencey to move toward the center. Now let's look at the histogram of the samples at each stage"
],
"metadata": {
"id": "SGTYGGevAktz"
}
},
{
"cell_type": "code",
"source": [
"def draw_hist(z_t,title=''):\n",
" fig, ax = plt.subplots()\n",
" fig.set_size_inches(8,2.5)\n",
" plt.hist(z_t , bins=np.arange(-3,3, 0.1), density = True)\n",
" ax.set_xlim([-3,3])\n",
" ax.set_ylim([0,1.0])\n",
" ax.set_title('title')\n",
" plt.show()"
],
"metadata": {
"id": "bn5E5NzL-evM"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"draw_hist(samples[0,:],'Original data')\n",
"draw_hist(samples[5,:],'Time step 5')\n",
"draw_hist(samples[10,:],'Time step 10')\n",
"draw_hist(samples[20,:],'Time step 20')\n",
"draw_hist(samples[40,:],'Time step 40')\n",
"draw_hist(samples[80,:],'Time step 80')\n",
"draw_hist(samples[100,:],'Time step 100')"
],
"metadata": {
"id": "pn_XD-EhBlwk"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"You can clearly see that as the diffusion process continues, the data becomes more Gaussian."
],
"metadata": {
"id": "skuLfGl5Czf4"
}
},
{
"cell_type": "markdown",
"source": [
"Now let's investigate the diffusion kernel as in figure 18.3 of the book.\n"
],
"metadata": {
"id": "s37CBSzzK7wh"
}
},
{
"cell_type": "code",
"source": [
"def diffusion_kernel(x, t, beta):\n",
" # TODO -- write this function\n",
" # Replace this line:\n",
" dk_mean = 0.0 ; dk_std = 1.0\n",
"\n",
" return dk_mean, dk_std"
],
"metadata": {
"id": "vL62Iym0LEtY"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def draw_prob_dist(x_plot_vals, prob_dist, title=''):\n",
" fig, ax = plt.subplots()\n",
" fig.set_size_inches(8,2.5)\n",
" ax.plot(x_plot_vals, prob_dist, 'b-')\n",
" ax.set_xlim([-3,3])\n",
" ax.set_ylim([0,1.0])\n",
" ax.set_title(title)\n",
" plt.show()\n",
"\n",
"def compute_and_plot_diffusion_kernels(x, T, beta, my_colormap):\n",
" x_plot_vals = np.arange(-3,3,0.01)\n",
" diffusion_kernels = np.zeros((T+1,len(x_plot_vals)))\n",
" dk_mean_all = np.ones((T+1,1))*x\n",
" dk_std_all = np.zeros((T+1,1))\n",
" for t in range(T):\n",
" dk_mean_all[t+1], dk_std_all[t+1] = diffusion_kernel(x,t+1,beta)\n",
" diffusion_kernels[t+1,:] = norm_pdf(x_plot_vals, dk_mean_all[t+1], dk_std_all[t+1])\n",
"\n",
" samples = np.ones((T+1, 5))\n",
" samples[0,:] = x\n",
"\n",
" for t in range(T):\n",
" samples[t+1,:] = diffuse_one_step(samples[t,:], beta)\n",
"\n",
" fig, ax = plt.subplots()\n",
" fig.set_size_inches(6,6)\n",
"\n",
" # Plot the image containing all the kernels\n",
" plt.imshow(diffusion_kernels, cmap=my_colormap, interpolation='nearest')\n",
"\n",
" # Plot +/- 2 standard deviations\n",
" ax.plot((dk_mean_all -2 * dk_std_all)/0.01 + len(x_plot_vals)/2, np.arange(0,101,1),'y--')\n",
" ax.plot((dk_mean_all +2 * dk_std_all)/0.01 + len(x_plot_vals)/2, np.arange(0,101,1),'y--')\n",
"\n",
" # Plot a few trajectories\n",
" ax.plot(samples[:,0]/0.01 + + len(x_plot_vals)/2, np.arange(0,101,1), 'r-')\n",
" ax.plot(samples[:,1]/0.01 + + len(x_plot_vals)/2, np.arange(0,101,1), 'g-')\n",
" ax.plot(samples[:,2]/0.01 + + len(x_plot_vals)/2, np.arange(0,101,1), 'b-')\n",
" ax.plot(samples[:,3]/0.01 + + len(x_plot_vals)/2, np.arange(0,101,1), 'c-')\n",
" ax.plot(samples[:,4]/0.01 + + len(x_plot_vals)/2, np.arange(0,101,1), 'm-')\n",
"\n",
" # Tidy up and plot\n",
" ax.set_ylabel(\"$Pr(z_{t}|x)$\")\n",
" ax.get_xaxis().set_visible(False)\n",
" ax.set_xlim([0,601])\n",
" ax.set_aspect(601/T)\n",
" plt.show()\n",
"\n",
"\n",
" draw_prob_dist(x_plot_vals, diffusion_kernels[20,:],'$q(z_{20}|x)$')\n",
" draw_prob_dist(x_plot_vals, diffusion_kernels[40,:],'$q(z_{40}|x)$')\n",
" draw_prob_dist(x_plot_vals, diffusion_kernels[80,:],'$q(z_{80}|x)$')"
],
"metadata": {
"id": "KtP1KF8wMh8o"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"x = -2\n",
"compute_and_plot_diffusion_kernels(x, T, beta, my_colormap)"
],
"metadata": {
"id": "g8TcI5wtRQsx"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"TODO -- Run this for different version of $x$ and check that you understand how the graphs change"
],
"metadata": {
"id": "-RuN2lR28-hK"
}
},
{
"cell_type": "markdown",
"source": [
"Finally, let's estimate the marginal distributions empirically and visualize them as in figure 18.4 of the book. This is only tractable because the data is in one dimension and we know the original distribution.\n",
"\n",
"The marginal distribution at time t is the sum of the diffusion kernels for each position x, weighted by the probability of seeing that value of x in the true distribution."
],
"metadata": {
"id": "n-x6Whz2J_zy"
}
},
{
"cell_type": "code",
"source": [
"def diffusion_marginal(x_plot_vals, pr_x_true, t, beta):\n",
" # If time is zero then marginal is just original distribution\n",
" if t == 0:\n",
" return pr_x_true\n",
"\n",
" # The thing we are computing\n",
" marginal_at_time_t = np.zeros_like(pr_x_true);\n",
"\n",
"\n",
" # TODO Write ths function\n",
" # 1. For each x (value in x_plot_vals):\n",
" # 2. Compute the mean and variance of the diffusion kernel at time t\n",
" # 3. Compute pdf of this Gaussian at every x_plot_val\n",
" # 4. Weight Gaussian by probability at position x and by 0.01 to componensate for bin size\n",
" # 5. Accumulate weighted Gaussian in marginal at time t.\n",
" # 6. Multiply result by 0.01 to compensate for bin size\n",
" # Replace this line:\n",
" marginal_at_time_t = marginal_at_time_t\n",
"\n",
"\n",
"\n",
" return marginal_at_time_t"
],
"metadata": {
"id": "YzN5duYpg7C-"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"x_plot_vals = np.arange(-3,3,0.01)\n",
"marginal_distributions = np.zeros((T+1,len(x_plot_vals)))\n",
"\n",
"for t in range(T+1):\n",
" marginal_distributions[t,:] = diffusion_marginal(x_plot_vals, pr_x_true , t, beta)\n",
"\n",
"fig, ax = plt.subplots()\n",
"fig.set_size_inches(6,6)\n",
"\n",
"# Plot the image containing all the kernels\n",
"plt.imshow(marginal_distributions, cmap=my_colormap, interpolation='nearest')\n",
"\n",
"# Tidy up and plot\n",
"ax.set_ylabel(\"$Pr(z_{t})$\")\n",
"ax.get_xaxis().set_visible(False)\n",
"ax.set_xlim([0,601])\n",
"ax.set_aspect(601/T)\n",
"plt.show()\n",
"\n",
"\n",
"draw_prob_dist(x_plot_vals, marginal_distributions[0,:],'$q(z_{0})$')\n",
"draw_prob_dist(x_plot_vals, marginal_distributions[20,:],'$q(z_{20})$')\n",
"draw_prob_dist(x_plot_vals, marginal_distributions[60,:],'$q(z_{60})$')"
],
"metadata": {
"id": "OgEU9sxjRaeO"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,380 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyM4DdZDGoP1xGst+Nn+rwvt",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap18/18_2_1D_Diffusion_Model.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 18.2: 1D Diffusion Model**\n",
"\n",
"This notebook investigates the diffusion encoder as described in section 18.3 and 18.4 of the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from matplotlib.colors import ListedColormap\n",
"from operator import itemgetter\n",
"from scipy import stats\n",
"from IPython.display import display, clear_output"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"#Create pretty colormap as in book\n",
"my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
"my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
"r = np.floor(my_colormap_vals_dec/(256*256))\n",
"g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
"b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
"my_colormap_vals = np.vstack((r,g,b)).transpose()/255.0\n",
"my_colormap = ListedColormap(my_colormap_vals)"
],
"metadata": {
"id": "4PM8bf6lO0VE"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Probability distribution for normal\n",
"def norm_pdf(x, mu, sigma):\n",
" return np.exp(-0.5 * (x-mu) * (x-mu) / (sigma * sigma)) / np.sqrt(2*np.pi*sigma*sigma)"
],
"metadata": {
"id": "ONGRaQscfIOo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# True distribution is a mixture of four Gaussians\n",
"class TrueDataDistribution:\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
" self.mu = [1.5, -0.216, 0.45, -1.875]\n",
" self.sigma = [0.3, 0.15, 0.525, 0.075]\n",
" self.w = [0.2, 0.3, 0.35, 0.15]\n",
"\n",
" # Return PDF\n",
" def pdf(self, x):\n",
" return(self.w[0] *norm_pdf(x,self.mu[0],self.sigma[0]) + self.w[1] *norm_pdf(x,self.mu[1],self.sigma[1]) + self.w[2] *norm_pdf(x,self.mu[2],self.sigma[2]) + self.w[3] *norm_pdf(x,self.mu[3],self.sigma[3]))\n",
"\n",
" # Draw samples\n",
" def sample(self, n):\n",
" hidden = np.random.choice(4, n, p=self.w)\n",
" epsilon = np.random.normal(size=(n))\n",
" mu_list = list(itemgetter(*hidden)(self.mu))\n",
" sigma_list = list(itemgetter(*hidden)(self.sigma))\n",
" return mu_list + sigma_list * epsilon"
],
"metadata": {
"id": "gZvG0MKhfY8Y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define ground truth probability distribution that we will model\n",
"true_dist = TrueDataDistribution()\n",
"# Let's visualize this\n",
"x_vals = np.arange(-3,3,0.01)\n",
"pr_x_true = true_dist.pdf(x_vals)\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.plot(x_vals, pr_x_true, 'r-')\n",
"ax.set_xlabel(\"$x$\")\n",
"ax.set_ylabel(\"$Pr(x)$\")\n",
"ax.set_ylim(0,1.0)\n",
"ax.set_xlim(-3,3)\n",
"plt.show()"
],
"metadata": {
"id": "iJu_uBiaeUVv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"To train the model to describe this distribution, we'll need to generate pairs of samples drawn from $Pr(z_t|x)$ (diffusion kernel) and $q(z_{t-1}|z_{t},x)$ (equation 18.15).\n",
"\n"
],
"metadata": {
"id": "DRHUG_41i4t_"
}
},
{
"cell_type": "code",
"source": [
"# The diffusion kernel returns the parameters of Pr(z_{t}|x)\n",
"def diffusion_kernel(x, t, beta):\n",
" alpha = np.power(1-beta,t)\n",
" dk_mean = x * np.sqrt(alpha)\n",
" dk_std = np.sqrt(1-alpha)\n",
" return dk_mean, dk_std\n",
"\n",
"# Compute mean and variance q(z_{t-1}|z_{t},x)\n",
"def conditional_diffusion_distribution(x,z_t,t,beta):\n",
" # TODO -- Implement this function\n",
" # Replace this line\n",
" cd_mean = 0; cd_std = 1\n",
"\n",
" return cd_mean, cd_std\n",
"\n",
"def get_data_pairs(x_train,t,beta):\n",
" # Find diffusion kernel for every x_train and draw samples\n",
" dk_mean, dk_std = diffusion_kernel(x_train, t, beta)\n",
" z_t = np.random.normal(size=x_train.shape) * dk_std + dk_mean\n",
" # Find conditional diffusion distribution for each x_train, z pair and draw samlpes\n",
" cd_mean, cd_std = conditional_diffusion_distribution(x_train,z_t,t,beta)\n",
" if t == 1:\n",
" z_tminus1 = x_train\n",
" else:\n",
" z_tminus1 = np.random.normal(size=x_train.shape) * cd_std + cd_mean\n",
"\n",
" return z_t, z_tminus1"
],
"metadata": {
"id": "x6B8t72Ukscd"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We also need models $\\mbox{f}_t[z_{t},\\phi_{t}]$ that map from $z_{t}$ to the mean of the distribution at time $z_{t-1}$. We're just going to use a very hacky non-parametric model (basically a lookup table) that tells you the result based on the (quantized) input."
],
"metadata": {
"id": "aSG_4uA8_zZ-"
}
},
{
"cell_type": "code",
"source": [
"# This code is really ugly! Don't look too closely at it!\n",
"# All you need to know is that it is a model that trains from pairs zt, zt_minus1\n",
"# And can then predict zt\n",
"class NonParametricModel():\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
"\n",
" self.inc = 0.01\n",
" self.max_val = 3.0\n",
" self.model = []\n",
"\n",
" # Learns a model that predicts z_t_minus1 given z_t\n",
" def train(self, zt, zt_minus1):\n",
" zt = np.clip(zt,-self.max_val,self.max_val)\n",
" zt_minus1 = np.clip(zt_minus1,-self.max_val,self.max_val)\n",
" bins = np.arange(-self.max_val,self.max_val+self.inc,self.inc)\n",
" numerator, *_ = stats.binned_statistic(zt, zt_minus1-zt, statistic='sum',bins=bins)\n",
" denominator, *_ = stats.binned_statistic(zt, zt_minus1-zt, statistic='count',bins=bins)\n",
" self.model = numerator / (denominator + 1)\n",
"\n",
" def predict(self, zt):\n",
" bin_index = np.floor((zt+self.max_val)/self.inc)\n",
" bin_index = np.clip(bin_index,0, len(self.model)-1).astype('uint32')\n",
" return zt + self.model[bin_index]"
],
"metadata": {
"id": "ZHViC0pL_yy5"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Sample data from distribution (this would usually be our collected training set)\n",
"n_sample = 100000\n",
"x_train = true_dist.sample(n_sample)\n",
"\n",
"# Define model parameters\n",
"T = 100\n",
"beta = 0.01511\n",
"\n",
"all_models = []\n",
"for t in range(0,T):\n",
" clear_output(wait=True)\n",
" display(\"Training timestep %d\"%(t))\n",
" zt,zt_minus1 = get_data_pairs(x_train,t+1,beta)\n",
" all_models.append(NonParametricModel())\n",
" # The model at index t maps data from z_{t+1} to z_{t}\n",
" all_models[t].train(zt,zt_minus1)"
],
"metadata": {
"id": "CzVFybWoBygu"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now that we've learned the model, let's draw some samples from it. We start at $z_{100}$ and use the model to predict $z_{99}$, then $z_{98}$ and so on until finally we get to $z_{1}$ and then $x$ (represented as $z_{0}$ here). We'll store all of the intermediate stages as well, so we can plot the trajectories. See equations 18.16."
],
"metadata": {
"id": "ZPc9SEvtl14U"
}
},
{
"cell_type": "code",
"source": [
"def sample(model, T, sigma_t, n_samples):\n",
" # Create the output array\n",
" # Each row represents a time step, first row will be sampled data\n",
" # Each column represents a different sample\n",
" samples = np.zeros((T+1,n_samples))\n",
"\n",
" # TODO -- Initialize the samples z_{T} at samples[T,:] from standard normal distribution\n",
" # Replace this line\n",
" samples[T,:] = np.zeros((1,n_samples))\n",
"\n",
"\n",
" # For t=100...99..98... ...0\n",
" for t in range(T,0,-1):\n",
" clear_output(wait=True)\n",
" display(\"Predicting z_{%d} from z_{%d}\"%(t-1,t))\n",
" # TODO Predict samples[t-1,:] from samples[t,:] using the appropriate model\n",
" # Replace this line:\n",
" samples[t-1,:] = np.zeros((1,n_samples))\n",
"\n",
"\n",
" # If not the last time step\n",
" if t>0:\n",
" # TODO Add noise to the samples at z_t-1 we just generated with mean zero, standard deviation sigma_t\n",
" # Replace this line\n",
" samples[t-1,:] = samples[t-1,:]\n",
"\n",
" return samples"
],
"metadata": {
"id": "A-ZMFOvACIOw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's run the diffusion process for a whole bunch of samples"
],
"metadata": {
"id": "ECAUfHNi9NVW"
}
},
{
"cell_type": "code",
"source": [
"sigma_t=0.12288\n",
"n_samples = 100000\n",
"samples = sample(all_models, T, sigma_t, n_samples)\n",
"\n",
"\n",
"# Plot the data\n",
"sampled_data = samples[0,:]\n",
"bins = np.arange(-3,3.05,0.05)\n",
"\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.set_xlim([-3,3])\n",
"plt.hist(sampled_data, bins=bins, density =True)\n",
"ax.set_ylim(0, 0.8)\n",
"plt.show()"
],
"metadata": {
"id": "M-TY5w9Q8LYW"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's, plot the evolution of a few of the paths as in figure 18.7 (paths are from bottom to top now)."
],
"metadata": {
"id": "jYrAW6tN-gJ4"
}
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots()\n",
"t_vals = np.arange(0,101,1)\n",
"ax.plot(samples[:,0],t_vals,'r-')\n",
"ax.plot(samples[:,1],t_vals,'g-')\n",
"ax.plot(samples[:,2],t_vals,'b-')\n",
"ax.plot(samples[:,3],t_vals,'c-')\n",
"ax.plot(samples[:,4],t_vals,'m-')\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([101, 0])\n",
"ax.set_xlabel('value')\n",
"ax.set_ylabel('z_{t}')\n",
"plt.show()"
],
"metadata": {
"id": "4XU6CDZC_kFo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Notice that the samples have a tendency to move from positions that are near the center at time 100 to positions that are high in the true probability distribution at time 0"
],
"metadata": {
"id": "SGTYGGevAktz"
}
}
]
}

View File

@@ -0,0 +1,362 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyNd+D0/IVWXtU2GKsofyk2d",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap18/18_3_Reparameterized_Model.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 18.3: 1D Reparameterized model**\n",
"\n",
"This notebook investigates the reparameterized model as described in section 18.5 of the book and implements algorithms 18.1 and 18.2.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from matplotlib.colors import ListedColormap\n",
"from operator import itemgetter\n",
"from scipy import stats\n",
"from IPython.display import display, clear_output"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"#Create pretty colormap as in book\n",
"my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
"my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
"r = np.floor(my_colormap_vals_dec/(256*256))\n",
"g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
"b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
"my_colormap_vals = np.vstack((r,g,b)).transpose()/255.0\n",
"my_colormap = ListedColormap(my_colormap_vals)"
],
"metadata": {
"id": "4PM8bf6lO0VE"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Probability distribution for normal\n",
"def norm_pdf(x, mu, sigma):\n",
" return np.exp(-0.5 * (x-mu) * (x-mu) / (sigma * sigma)) / np.sqrt(2*np.pi*sigma*sigma)"
],
"metadata": {
"id": "ONGRaQscfIOo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# True distribution is a mixture of four Gaussians\n",
"class TrueDataDistribution:\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
" self.mu = [1.5, -0.216, 0.45, -1.875]\n",
" self.sigma = [0.3, 0.15, 0.525, 0.075]\n",
" self.w = [0.2, 0.3, 0.35, 0.15]\n",
"\n",
" # Return PDF\n",
" def pdf(self, x):\n",
" return(self.w[0] *norm_pdf(x,self.mu[0],self.sigma[0]) + self.w[1] *norm_pdf(x,self.mu[1],self.sigma[1]) + self.w[2] *norm_pdf(x,self.mu[2],self.sigma[2]) + self.w[3] *norm_pdf(x,self.mu[3],self.sigma[3]))\n",
"\n",
" # Draw samples\n",
" def sample(self, n):\n",
" hidden = np.random.choice(4, n, p=self.w)\n",
" epsilon = np.random.normal(size=(n))\n",
" mu_list = list(itemgetter(*hidden)(self.mu))\n",
" sigma_list = list(itemgetter(*hidden)(self.sigma))\n",
" return mu_list + sigma_list * epsilon"
],
"metadata": {
"id": "gZvG0MKhfY8Y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define ground truth probability distribution that we will model\n",
"true_dist = TrueDataDistribution()\n",
"# Let's visualize this\n",
"x_vals = np.arange(-3,3,0.01)\n",
"pr_x_true = true_dist.pdf(x_vals)\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.plot(x_vals, pr_x_true, 'r-')\n",
"ax.set_xlabel(\"$x$\")\n",
"ax.set_ylabel(\"$Pr(x)$\")\n",
"ax.set_ylim(0,1.0)\n",
"ax.set_xlim(-3,3)\n",
"plt.show()"
],
"metadata": {
"id": "iJu_uBiaeUVv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"To train the model to describe this distribution, we'll need to generate pairs of samples drawn from $Pr(z_t|x)$ (diffusion kernel) and $q(z_{t-1}|z_{t},x)$ (equation 18.15).\n",
"\n"
],
"metadata": {
"id": "DRHUG_41i4t_"
}
},
{
"cell_type": "code",
"source": [
"# Return z_t (the argument of g_{t}[] in the loss function in algorithm 18.1) and epsilon\n",
"def get_data_pairs(x_train,t,beta):\n",
" # TODO -- write this function\n",
" # Replace these lines\n",
" epsilon = np.ones_like(x_train)\n",
" z_t = np.ones_like(x_train)\n",
"\n",
" return z_t, epsilon"
],
"metadata": {
"id": "x6B8t72Ukscd"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We also need models $\\mbox{g}_t[z_{t},\\phi_{t}]$ that map from $z_{t}$ to the noise $\\epsilon$ that was added. We're just going to use a very hacky non-parametric model (basically a lookup table) that tells you the result based on the (quantized) input."
],
"metadata": {
"id": "aSG_4uA8_zZ-"
}
},
{
"cell_type": "code",
"source": [
"# This code is really ugly! Don't look too closely at it!\n",
"# All you need to know is that it is a model that trains from pairs zt, zt_minus1\n",
"# And can then predict zt\n",
"class NonParametricModel():\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
"\n",
" self.inc = 0.01\n",
" self.max_val = 3.0\n",
" self.model = []\n",
"\n",
" # Learns a model that predicts epsilon given z_t\n",
" def train(self, zt, epsilon):\n",
" zt = np.clip(zt,-self.max_val,self.max_val)\n",
" epsilon = np.clip(epsilon,-self.max_val,self.max_val)\n",
" bins = np.arange(-self.max_val,self.max_val+self.inc,self.inc)\n",
" numerator, *_ = stats.binned_statistic(zt, epsilon, statistic='sum',bins=bins)\n",
" denominator, *_ = stats.binned_statistic(zt, epsilon, statistic='count',bins=bins)\n",
" self.model = numerator / (denominator + 1)\n",
"\n",
" def predict(self, zt):\n",
" bin_index = np.floor((zt+self.max_val)/self.inc)\n",
" bin_index = np.clip(bin_index,0, len(self.model)-1).astype('uint32')\n",
" return self.model[bin_index]"
],
"metadata": {
"id": "ZHViC0pL_yy5"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Sample data from distribution (this would usually be our collected training set)\n",
"n_sample = 100000\n",
"x_train = true_dist.sample(n_sample)\n",
"\n",
"# Define model parameters\n",
"T = 100\n",
"beta = 0.01511\n",
"\n",
"all_models = []\n",
"for t in range(0,T):\n",
" clear_output(wait=True)\n",
" display(\"Training timestep %d\"%(t))\n",
" zt,epsilon= get_data_pairs(x_train,t,beta)\n",
" all_models.append(NonParametricModel())\n",
" # The model at index t maps data from z_{t+1} to epsilon\n",
" all_models[t].train(zt,epsilon)"
],
"metadata": {
"id": "CzVFybWoBygu"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now that we've learned the model, let's draw some samples from it. We start at $z_{100}$ and use the model to predict $z_{99}$, then $z_{98}$ and so on until finally we get to $z_{1}$ and then $x$ (represented as $z_{0}$ here). We'll store all of the intermediate stages as well, so we can plot the trajectories. See algorithm 18.2"
],
"metadata": {
"id": "ZPc9SEvtl14U"
}
},
{
"cell_type": "code",
"source": [
"def sample(model, T, sigma_t, n_samples):\n",
" # Create the output array\n",
" # Each row represents a time step, first row will be sampled data\n",
" # Each column represents a different sample\n",
" samples = np.zeros((T+1,n_samples))\n",
"\n",
" # TODO -- Initialize the samples z_{T} at samples[T,:] from standard normal distribution\n",
" # Replace this line\n",
" samples[T,:] = np.zeros((1,n_samples))\n",
"\n",
"\n",
"\n",
" # For t=100...99..98... ...0\n",
" for t in range(T,0,-1):\n",
" clear_output(wait=True)\n",
" display(\"Predicting z_{%d} from z_{%d}\"%(t-1,t))\n",
" # TODO Predict samples[t-1,:] from samples[t,:] using the appropriate model\n",
" # Replace this line:\n",
" samples[t-1,:] = np.zeros((1,n_samples))\n",
"\n",
"\n",
" # If not the last time step\n",
" if t>0:\n",
" # TODO Add noise to the samples at z_t-1 we just generated with mean zero, standard deviation sigma_t\n",
" # Replace this line\n",
" samples[t-1,:] = samples[t-1,:]\n",
"\n",
" return samples"
],
"metadata": {
"id": "A-ZMFOvACIOw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's run the diffusion process for a whole bunch of samples"
],
"metadata": {
"id": "ECAUfHNi9NVW"
}
},
{
"cell_type": "code",
"source": [
"sigma_t=0.12288\n",
"n_samples = 100000\n",
"samples = sample(all_models, T, sigma_t, n_samples)\n",
"\n",
"\n",
"# Plot the data\n",
"sampled_data = samples[0,:]\n",
"bins = np.arange(-3,3.05,0.05)\n",
"\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.set_xlim([-3,3])\n",
"plt.hist(sampled_data, bins=bins, density =True)\n",
"ax.set_ylim(0, 0.8)\n",
"plt.show()"
],
"metadata": {
"id": "M-TY5w9Q8LYW"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's, plot the evolution of a few of the paths as in figure 18.7 (paths are from bottom to top now)."
],
"metadata": {
"id": "jYrAW6tN-gJ4"
}
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots()\n",
"t_vals = np.arange(0,101,1)\n",
"ax.plot(samples[:,0],t_vals,'r-')\n",
"ax.plot(samples[:,1],t_vals,'g-')\n",
"ax.plot(samples[:,2],t_vals,'b-')\n",
"ax.plot(samples[:,3],t_vals,'c-')\n",
"ax.plot(samples[:,4],t_vals,'m-')\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([101, 0])\n",
"ax.set_xlabel('value')\n",
"ax.set_ylabel('z_{t}')\n",
"plt.show()"
],
"metadata": {
"id": "4XU6CDZC_kFo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Notice that the samples have a tendency to move from positions that are near the center at time 100 to positions that are high in the true probability distribution at time 0"
],
"metadata": {
"id": "SGTYGGevAktz"
}
}
]
}

View File

@@ -0,0 +1,484 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyNFSvISBXo/Z1l+onknF2Gw",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap18/18_4_Families_of_Diffusion_Models.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 18.4: Families of diffusion models**\n",
"\n",
"This notebook investigates the reparameterized model as described in section 18.5 of the book and computers the results shown in figure 18.10c-f. These models are based on the paper \"Denoising diffusion implicit models\" which can be found [here](https://arxiv.org/pdf/2010.02502.pdf).\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from matplotlib.colors import ListedColormap\n",
"from operator import itemgetter\n",
"from scipy import stats\n",
"from IPython.display import display, clear_output"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"#Create pretty colormap as in book\n",
"my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
"my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
"r = np.floor(my_colormap_vals_dec/(256*256))\n",
"g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
"b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
"my_colormap_vals = np.vstack((r,g,b)).transpose()/255.0\n",
"my_colormap = ListedColormap(my_colormap_vals)"
],
"metadata": {
"id": "4PM8bf6lO0VE"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Probability distribution for normal\n",
"def norm_pdf(x, mu, sigma):\n",
" return np.exp(-0.5 * (x-mu) * (x-mu) / (sigma * sigma)) / np.sqrt(2*np.pi*sigma*sigma)"
],
"metadata": {
"id": "ONGRaQscfIOo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# True distribution is a mixture of four Gaussians\n",
"class TrueDataDistribution:\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
" self.mu = [1.5, -0.216, 0.45, -1.875]\n",
" self.sigma = [0.3, 0.15, 0.525, 0.075]\n",
" self.w = [0.2, 0.3, 0.35, 0.15]\n",
"\n",
" # Return PDF\n",
" def pdf(self, x):\n",
" return(self.w[0] *norm_pdf(x,self.mu[0],self.sigma[0]) + self.w[1] *norm_pdf(x,self.mu[1],self.sigma[1]) + self.w[2] *norm_pdf(x,self.mu[2],self.sigma[2]) + self.w[3] *norm_pdf(x,self.mu[3],self.sigma[3]))\n",
"\n",
" # Draw samples\n",
" def sample(self, n):\n",
" hidden = np.random.choice(4, n, p=self.w)\n",
" epsilon = np.random.normal(size=(n))\n",
" mu_list = list(itemgetter(*hidden)(self.mu))\n",
" sigma_list = list(itemgetter(*hidden)(self.sigma))\n",
" return mu_list + sigma_list * epsilon"
],
"metadata": {
"id": "gZvG0MKhfY8Y"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Define ground truth probability distribution that we will model\n",
"true_dist = TrueDataDistribution()\n",
"# Let's visualize this\n",
"x_vals = np.arange(-3,3,0.01)\n",
"pr_x_true = true_dist.pdf(x_vals)\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.plot(x_vals, pr_x_true, 'r-')\n",
"ax.set_xlabel(\"$x$\")\n",
"ax.set_ylabel(\"$Pr(x)$\")\n",
"ax.set_ylim(0,1.0)\n",
"ax.set_xlim(-3,3)\n",
"plt.show()"
],
"metadata": {
"id": "iJu_uBiaeUVv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"To train the model to describe this distribution, we'll need to generate pairs of samples drawn from $Pr(z_t|x)$ (diffusion kernel) and $q(z_{t-1}|z_{t},x)$ (equation 18.15).\n",
"\n"
],
"metadata": {
"id": "DRHUG_41i4t_"
}
},
{
"cell_type": "code",
"source": [
"# Return z_t (the argument of g_{t}[] in the loss function in algorithm 18.1) and epsilon\n",
"def get_data_pairs(x_train,t,beta):\n",
"\n",
" epsilon = np.random.standard_normal(x_train.shape)\n",
" alpha_t = np.power(1-beta,t)\n",
" z_t = x_train * np.sqrt(alpha_t) + np.sqrt(1-alpha_t) * epsilon\n",
"\n",
" return z_t, epsilon"
],
"metadata": {
"id": "x6B8t72Ukscd"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"We also need models $\\mbox{g}_t[z_{t},\\phi_{t}]$ that map from $z_{t}$ to the noise $\\epsilon$ that was added. We're just going to use a very hacky non-parametric model (basically a lookup table) that tells you the result based on the (quantized) input."
],
"metadata": {
"id": "aSG_4uA8_zZ-"
}
},
{
"cell_type": "code",
"source": [
"# This code is really ugly! Don't look too closely at it!\n",
"# All you need to know is that it is a model that trains from pairs zt, zt_minus1\n",
"# And can then predict zt\n",
"class NonParametricModel():\n",
" # Constructor initializes parameters\n",
" def __init__(self):\n",
"\n",
" self.inc = 0.01\n",
" self.max_val = 3.0\n",
" self.model = []\n",
"\n",
" # Learns a model that predicts epsilon given z_t\n",
" def train(self, zt, epsilon):\n",
" zt = np.clip(zt,-self.max_val,self.max_val)\n",
" epsilon = np.clip(epsilon,-self.max_val,self.max_val)\n",
" bins = np.arange(-self.max_val,self.max_val+self.inc,self.inc)\n",
" numerator, *_ = stats.binned_statistic(zt, epsilon, statistic='sum',bins=bins)\n",
" denominator, *_ = stats.binned_statistic(zt, epsilon, statistic='count',bins=bins)\n",
" self.model = numerator / (denominator + 1)\n",
"\n",
" def predict(self, zt):\n",
" bin_index = np.floor((zt+self.max_val)/self.inc)\n",
" bin_index = np.clip(bin_index,0, len(self.model)-1).astype('uint32')\n",
" return self.model[bin_index]"
],
"metadata": {
"id": "ZHViC0pL_yy5"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Sample data from distribution (this would usually be our collected training set)\n",
"n_sample = 100000\n",
"x_train = true_dist.sample(n_sample)\n",
"\n",
"# Define model parameters\n",
"T = 100\n",
"beta = 0.01511\n",
"\n",
"all_models = []\n",
"for t in range(0,T):\n",
" clear_output(wait=True)\n",
" display(\"Training timestep %d\"%(t))\n",
" zt,epsilon= get_data_pairs(x_train,t,beta)\n",
" all_models.append(NonParametricModel())\n",
" # The model at index t maps data from z_{t+1} to epsilon\n",
" all_models[t].train(zt,epsilon)"
],
"metadata": {
"id": "CzVFybWoBygu"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now that we've learned the model, let's draw some samples from it. We start at $z_{100}$ and use the model to predict $z_{99}$, then $z_{98}$ and so on until finally we get to $z_{1}$ and then $x$ (represented as $z_{0}$ here). We'll store all of the intermediate stages as well, so we can plot the trajectories.\n",
"\n",
"This is the same model we learned last time. The whole point of this is that it is compatible with any forward process with the same diffusion kernel.\n",
"\n",
"One such model is the denoising diffusion implicit model, which has a sampling step:\n",
"\n",
"\\begin{equation}\n",
"\\mathbf{z}_{t-1} = \\sqrt{\\alpha_{t-1}}\\left(\\frac{\\mathbf{z}_{t}-\\sqrt{1-\\alpha_{t}}\\mbox{g}_t[\\mathbf{z}_{t},\\boldsymbol\\phi]}{\\sqrt{\\alpha_{t}}}\\right) + \\sqrt{1-\\alpha_{t-1}-\\sigma^2}\\mbox{g}_t[\\mathbf{z}_{t},\\boldsymbol\\phi]+\\sigma\\epsilon\n",
"\\end{equation}\n",
"\n",
"(see equation 12 of the denoising [diffusion implicit models paper ](https://arxiv.org/pdf/2010.02502.pdf).\n"
],
"metadata": {
"id": "ZPc9SEvtl14U"
}
},
{
"cell_type": "code",
"source": [
"def sample_ddim(model, T, sigma_t, n_samples):\n",
" # Create the output array\n",
" # Each row represents a time step, first row will be sampled data\n",
" # Each column represents a different sample\n",
" samples = np.zeros((T+1,n_samples))\n",
" samples[T,:] = np.random.standard_normal(n_samples)\n",
"\n",
" # For t=100...99..98... ...0\n",
" for t in range(T,0,-1):\n",
" clear_output(wait=True)\n",
" display(\"Predicting z_{%d} from z_{%d}\"%(t-1,t))\n",
"\n",
" alpha_t = np.power(1-beta,t+1)\n",
" alpha_t_minus1 = np.power(1-beta,t)\n",
"\n",
" # TODO -- implement the DDIM sampling step\n",
" # Note the final noise term is already added in the \"if\" statement below\n",
" # Replace this line:\n",
" samples[t-1,:] = samples[t-1,:]\n",
"\n",
" # If not the last time step\n",
" if t>0:\n",
" samples[t-1,:] = samples[t-1,:]+ np.random.standard_normal(n_samples) * sigma_t\n",
" return samples"
],
"metadata": {
"id": "A-ZMFOvACIOw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's run the diffusion process for a whole bunch of samples"
],
"metadata": {
"id": "ECAUfHNi9NVW"
}
},
{
"cell_type": "code",
"source": [
"# Now we'll set the noise to a MUCH smaller level\n",
"sigma_t=0.001\n",
"n_samples = 100000\n",
"samples_low_noise = sample_ddim(all_models, T, sigma_t, n_samples)\n",
"\n",
"\n",
"# Plot the data\n",
"sampled_data = samples_low_noise[0,:]\n",
"bins = np.arange(-3,3.05,0.05)\n",
"\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.set_xlim([-3,3])\n",
"plt.hist(sampled_data, bins=bins, density =True)\n",
"ax.set_ylim(0, 0.8)\n",
"plt.show()"
],
"metadata": {
"id": "M-TY5w9Q8LYW"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Let's, plot the evolution of a few of the paths as in figure 18.7 (paths are from bottom to top now)."
],
"metadata": {
"id": "jYrAW6tN-gJ4"
}
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots()\n",
"t_vals = np.arange(0,101,1)\n",
"ax.plot(samples_low_noise[:,0],t_vals,'r-')\n",
"ax.plot(samples_low_noise[:,1],t_vals,'g-')\n",
"ax.plot(samples_low_noise[:,2],t_vals,'b-')\n",
"ax.plot(samples_low_noise[:,3],t_vals,'c-')\n",
"ax.plot(samples_low_noise[:,4],t_vals,'m-')\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([101, 0])\n",
"ax.set_xlabel('value')\n",
"ax.set_ylabel('z_{t}')\n",
"plt.show()"
],
"metadata": {
"id": "4XU6CDZC_kFo"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The samples have a tendency to move from positions that are near the center at time 100 to positions that are high in the true probability distribution at time 0"
],
"metadata": {
"id": "SGTYGGevAktz"
}
},
{
"cell_type": "markdown",
"source": [
"Let's now sample from the accelerated model, that requires fewer models. Again, we don't need to learn anything new -- this is just the reverse process that corresponds to a different forward process that is compatible with the same diffusion kernel.\n",
"\n",
"There's nothing to do here except read the code. It uses the same DDIM model as you just implemented in the previous step, but it jumps timesteps five at a time."
],
"metadata": {
"id": "Z-LZp_fMXxRt"
}
},
{
"cell_type": "code",
"source": [
"def sample_accelerated(model, T, sigma_t, n_steps, n_samples):\n",
" # Create the output array\n",
" # Each row represents a sample (i.e. fewer than the time steps), first row will be sampled data\n",
" # Each column represents a different sample\n",
" samples = np.zeros((n_steps+1,n_samples))\n",
" samples[n_steps,:] = np.random.standard_normal(n_samples)\n",
"\n",
" # For each sampling step\n",
" for c_step in range(n_steps,0,-1):\n",
" # Find the corresponding time step and previous time step\n",
" t= int(T * c_step/n_steps)\n",
" tminus1 = int(T * (c_step-1)/n_steps)\n",
" display(\"Predicting z_{%d} from z_{%d}\"%(tminus1,t))\n",
"\n",
" alpha_t = np.power(1-beta,t+1)\n",
" alpha_t_minus1 = np.power(1-beta,tminus1+1)\n",
" epsilon_est = all_models[t-1].predict(samples[c_step,:])\n",
"\n",
" samples[c_step-1,:]=np.sqrt(alpha_t_minus1)*(samples[c_step,:]-np.sqrt(1-alpha_t) * epsilon_est)/np.sqrt(alpha_t) \\\n",
" + np.sqrt(1-alpha_t_minus1 - sigma_t*sigma_t) * epsilon_est\n",
" # If not the last time step\n",
" if t>0:\n",
" samples[c_step-1,:] = samples[c_step-1,:]+ np.random.standard_normal(n_samples) * sigma_t\n",
" return samples"
],
"metadata": {
"id": "3Z0erjGbYj1u"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's draw a bunch of samples from the model"
],
"metadata": {
"id": "D3Sm_WYrcuED"
}
},
{
"cell_type": "code",
"source": [
"sigma_t=0.11\n",
"n_samples = 100000\n",
"n_steps = 20 # i.e. sample 5 times as fast as before -- should be a divisor of 100\n",
"samples_accelerated = sample_accelerated(all_models, T, sigma_t, n_steps, n_samples)\n",
"\n",
"\n",
"# Plot the data\n",
"sampled_data = samples_accelerated[0,:]\n",
"bins = np.arange(-3,3.05,0.05)\n",
"\n",
"fig,ax = plt.subplots()\n",
"fig.set_size_inches(8,2.5)\n",
"ax.set_xlim([-3,3])\n",
"plt.hist(sampled_data, bins=bins, density =True)\n",
"ax.set_ylim(0, 0.9)\n",
"plt.show()"
],
"metadata": {
"id": "UB45c7VMcGy-"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"fig, ax = plt.subplots()\n",
"step_increment = 100/ n_steps\n",
"t_vals = np.arange(0,101,5)\n",
"\n",
"for i in range(len(t_vals)-1):\n",
" ax.plot( (samples_accelerated[i,0],samples_accelerated[i+1,0]), (t_vals[i], t_vals[i+1]),'r.-')\n",
" ax.plot( (samples_accelerated[i,1],samples_accelerated[i+1,1]), (t_vals[i], t_vals[i+1]),'g.-')\n",
" ax.plot( (samples_accelerated[i,2],samples_accelerated[i+1,2]), (t_vals[i], t_vals[i+1]),'b.-')\n",
" ax.plot( (samples_accelerated[i,3],samples_accelerated[i+1,3]), (t_vals[i], t_vals[i+1]),'c.-')\n",
" ax.plot( (samples_accelerated[i,4],samples_accelerated[i+1,4]), (t_vals[i], t_vals[i+1]),'m.-')\n",
"\n",
"ax.set_xlim([-3,3])\n",
"ax.set_ylim([101, 0])\n",
"ax.set_xlabel('value')\n",
"ax.set_ylabel('z_{t}')\n",
"plt.show()"
],
"metadata": {
"id": "Luv-6w84c_qO"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [],
"metadata": {
"id": "LSJi72f0kw_e"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,736 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyPg3umHnqmIXX6jGe809Nxf",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap19/19_1_Markov_Decision_Processes.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 19.1: Markov Decision Processes**\n",
"\n",
"This notebook investigates Markov decision processes as described in section 19.1 of the book.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from PIL import Image"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Get local copies of components of images\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Empty.png\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Hole.png\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Fish.png\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Penguin.png"
],
"metadata": {
"id": "ZsvrUszPLyEG"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Ugly class that takes care of drawing pictures like in the book.\n",
"# You can totally ignore this code!\n",
"class DrawMDP:\n",
" # Constructor initializes parameters\n",
" def __init__(self, n_row, n_col):\n",
" self.empty_image = np.asarray(Image.open('Empty.png'))\n",
" self.hole_image = np.asarray(Image.open('Hole.png'))\n",
" self.fish_image = np.asarray(Image.open('Fish.png'))\n",
" self.penguin_image = np.asarray(Image.open('Penguin.png'))\n",
" self.fig,self.ax = plt.subplots()\n",
" self.n_row = n_row\n",
" self.n_col = n_col\n",
"\n",
" my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
" my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
" r = np.floor(my_colormap_vals_dec/(256*256))\n",
" g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
" b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
" self.colormap = np.vstack((r,g,b)).transpose()/255.0\n",
"\n",
"\n",
" def draw_text(self, text, row, col, position, color):\n",
" if position == 'bc':\n",
" self.ax.text( 83*col+41,83 * (row+1) -10, text, horizontalalignment=\"center\", color=color, fontweight='bold')\n",
" if position == 'tl':\n",
" self.ax.text( 83*col+5,83 * row +5, text, verticalalignment = 'top', horizontalalignment=\"left\", color=color, fontweight='bold')\n",
"\n",
" # Draws a set of states\n",
" def draw_path(self, path, color1, color2):\n",
" for i in range(len(path)-1):\n",
" row_start = np.floor(path[i]/self.n_col)\n",
" row_end = np.floor(path[i+1]/self.n_col)\n",
" col_start = path[i] - row_start * self.n_col\n",
" col_end = path[i+1] - row_end * self.n_col\n",
"\n",
" color_index = int(np.floor(255 * i/(len(path)-1.)))\n",
" self.ax.plot([col_start * 83+41 + i, col_end * 83+41 + i ],[row_start * 83+41 + i, row_end * 83+41 + i ], color=(self.colormap[color_index,0],self.colormap[color_index,1],self.colormap[color_index,2]))\n",
"\n",
"\n",
" # Draw deterministic policy\n",
" def draw_deterministic_policy(self,i, action):\n",
" row = np.floor(i/self.n_col)\n",
" col = i - row * self.n_col\n",
" center_x = 83 * col + 41\n",
" center_y = 83 * row + 41\n",
" arrow_base_width = 10\n",
" arrow_height = 15\n",
" # Draw arrow pointing upward\n",
" if action ==0:\n",
" triangle_indices = np.array([[center_x, center_y-arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y+arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y+arrow_height/2]])\n",
" # Draw arrow pointing right\n",
" if action ==1:\n",
" triangle_indices = np.array([[center_x + arrow_height/2, center_y],\n",
" [center_x - arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x - arrow_height/2, center_y+arrow_base_width/2]])\n",
" # Draw arrow pointing downward\n",
" if action ==2:\n",
" triangle_indices = np.array([[center_x, center_y+arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y-arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y-arrow_height/2]])\n",
" # Draw arrow pointing left\n",
" if action ==3:\n",
" triangle_indices = np.array([[center_x - arrow_height/2, center_y],\n",
" [center_x + arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x + arrow_height/2, center_y+arrow_base_width/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw stochastic policy\n",
" def draw_stochastic_policy(self,i, action_probs):\n",
" row = np.floor(i/self.n_col)\n",
" col = i - row * self.n_col\n",
" offset = 20\n",
" # Draw arrow pointing upward\n",
" center_x = 83 * col + 41\n",
" center_y = 83 * row + 41 - offset\n",
" arrow_base_width = 15 * action_probs[0]\n",
" arrow_height = 20 * action_probs[0]\n",
" triangle_indices = np.array([[center_x, center_y-arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y+arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y+arrow_height/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw arrow pointing right\n",
" center_x = 83 * col + 41 + offset\n",
" center_y = 83 * row + 41\n",
" arrow_base_width = 15 * action_probs[1]\n",
" arrow_height = 20 * action_probs[1]\n",
" triangle_indices = np.array([[center_x + arrow_height/2, center_y],\n",
" [center_x - arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x - arrow_height/2, center_y+arrow_base_width/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw arrow pointing downward\n",
" center_x = 83 * col + 41\n",
" center_y = 83 * row + 41 +offset\n",
" arrow_base_width = 15 * action_probs[2]\n",
" arrow_height = 20 * action_probs[2]\n",
" triangle_indices = np.array([[center_x, center_y+arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y-arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y-arrow_height/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw arrow pointing left\n",
" center_x = 83 * col + 41 -offset\n",
" center_y = 83 * row + 41\n",
" arrow_base_width = 15 * action_probs[3]\n",
" arrow_height = 20 * action_probs[3]\n",
" triangle_indices = np.array([[center_x - arrow_height/2, center_y],\n",
" [center_x + arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x + arrow_height/2, center_y+arrow_base_width/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
"\n",
"\n",
"\n",
" def draw(self, layout, state, draw_state_index= False, rewards=None, policy=None, state_values=None, action_values=None,path1=None, path2 = None):\n",
" # Construct the image\n",
" image_out = np.zeros((self.n_row * 83, self.n_col * 83, 4),dtype='uint8')\n",
" for c_row in range (self.n_row):\n",
" for c_col in range(self.n_col):\n",
" if layout[c_row * self.n_col + c_col]==0:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.empty_image\n",
" elif layout[c_row * self.n_col + c_col]==1:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.hole_image\n",
" else:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.fish_image\n",
" if state == c_row * self.n_col + c_col:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.penguin_image\n",
"\n",
" # Draw the image\n",
" plt.imshow(image_out)\n",
" self.ax.get_xaxis().set_visible(False)\n",
" self.ax.get_yaxis().set_visible(False)\n",
" self.ax.spines['top'].set_visible(False)\n",
" self.ax.spines['right'].set_visible(False)\n",
" self.ax.spines['bottom'].set_visible(False)\n",
" self.ax.spines['left'].set_visible(False)\n",
"\n",
" if draw_state_index:\n",
" for c_cell in range(layout.size):\n",
" self.draw_text(\"%d\"%(c_cell), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'tl','k')\n",
"\n",
" # Draw the policy as triangles\n",
" if policy is not None:\n",
" # If the policy is deterministic\n",
" if len(policy) == len(layout):\n",
" for i in range(len(layout)):\n",
" self.draw_deterministic_policy(i, policy[i])\n",
" # Else it is stochastic\n",
" else:\n",
" for i in range(len(layout)):\n",
" self.draw_stochastic_policy(i,policy[:,i])\n",
"\n",
"\n",
" if path1 is not None:\n",
" # self.draw_path(path1, np.array([0.81, 0.51, 0.38]), np.array([1.0, 0.2, 0.5]))\n",
" self.draw_path(path1, np.array([1.0, 0.0, 0.0]), np.array([0.0, 1.0, 1.0]))\n",
"\n",
"\n",
" plt.show()"
],
"metadata": {
"id": "Gq1HfJsHN3SB"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Let's draw the initial situation with the penguin in top right\n",
"n_rows = 4; n_cols = 4\n",
"layout = np.zeros(n_rows * n_cols)\n",
"initial_state = 0\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = initial_state, draw_state_index = True)"
],
"metadata": {
"id": "eBQ7lTpJQBSe"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Note that the states are indexed from 0 rather than 1 as in the book to make\n",
"the code neater."
],
"metadata": {
"id": "P7P40UyMunKb"
}
},
{
"cell_type": "code",
"source": [
"# Define the state probabilities\n",
"transition_probabilities = np.array( \\\n",
"[[0.00 , 0.33, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.33, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.33, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.34, 0.00, 0.00, 0.33, 0.00, 0.25, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.34, 0.00, 0.00, 0.25, 0.00, 0.33, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.33, 0.00, 0.25, 0.00, 0.00, 0.33, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.25, 0.00, 0.33, 0.00, 0.00, 0.33, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.34, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.34, 0.00 ],\n",
"])\n",
"initial_state = 0"
],
"metadata": {
"id": "wgFcIi4YQJWI"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Define a step from the Markov process"
],
"metadata": {
"id": "axllRDDuDDLS"
}
},
{
"cell_type": "code",
"source": [
"def markov_process_step(state, transition_probabilities):\n",
" # TODO -- update the state according to the appropriate transition probabilities\n",
" # One way to do this is to use np.random.choice\n",
" # Replace this line:\n",
" new_state = 0\n",
"\n",
"\n",
" return new_state"
],
"metadata": {
"id": "FrSZrS67sdbN"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Run the Markov process for 10 steps and visualise the results"
],
"metadata": {
"id": "uTj7rN6LDFXd"
}
},
{
"cell_type": "code",
"source": [
"np.random.seed(0)\n",
"T = 10\n",
"states = np.zeros(T, dtype='uint8')\n",
"states[0] = 0\n",
"for t in range(T-1):\n",
" states[t+1] = markov_process_step(states[t], transition_probabilities)\n",
"\n",
"\n",
"\n",
"print(\"Your States:\", states)\n",
"print(\"True States: [ 0 4 8 9 10 9 10 9 13 14]\")\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = states[0], path1=states, draw_state_index = True)"
],
"metadata": {
"id": "lRIdjagCwP62"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Define a Markov one step of a reward process."
],
"metadata": {
"id": "QLyjyBjjDMin"
}
},
{
"cell_type": "code",
"source": [
"def markov_reward_process_step(state, transition_probabilities, reward_structure):\n",
"\n",
" # TODO -- write this function\n",
" # Update the state. Return a reward of +1 if the Penguin lands on the fish\n",
" # or zero otherwise.\n",
" # Replace this line\n",
" new_state = 0; reward = 0\n",
"\n",
"\n",
" return new_state, reward"
],
"metadata": {
"id": "YPHSJRKx-pgO"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Run the Markov reward process for 10 steps and visualise the results"
],
"metadata": {
"id": "AIz8QEiRFoCm"
}
},
{
"cell_type": "code",
"source": [
"# Set up the reward structure so it matches figure 19.2\n",
"reward_structure = np.zeros((16,1))\n",
"reward_structure[3] = 1; reward_structure[8] = 1; reward_structure[10] = 1\n",
"\n",
"# Initialize random numbers\n",
"np.random.seed(0)\n",
"T = 10\n",
"# Set up the states, so the fish are in the same positions as figure 19.2\n",
"states = np.zeros(T, dtype='uint8')\n",
"rewards = np.zeros(T, dtype='uint8')\n",
"\n",
"states[0] = 0\n",
"for t in range(T-1):\n",
" states[t+1],rewards[t+1] = markov_reward_process_step(states[t], transition_probabilities, reward_structure)\n",
"\n",
"print(\"Your States:\", states)\n",
"print(\"Your Rewards:\", rewards)\n",
"print(\"True Rewards: [0 0 1 0 1 0 1 0 0 0]\")\n",
"\n",
"\n",
"# Draw the figure\n",
"layout = np.zeros(n_rows * n_cols)\n",
"layout[3] = 2; layout[8] = 2 ; layout[10] = 2\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = states[0], path1=states, draw_state_index = True)"
],
"metadata": {
"id": "0p1gCpGoFn4M"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's calculate the return -- the sum of discounted future rewards"
],
"metadata": {
"id": "lyz47NWrITfj"
}
},
{
"cell_type": "code",
"source": [
"def calculate_return(rewards, gamma):\n",
" # TODO -- you write this function\n",
" # It should compute one return for the start of the sequence (i.e. G_1)\n",
" # Replace this line\n",
" return_val = 0.0\n",
"\n",
"\n",
" return return_val"
],
"metadata": {
"id": "4fEuBRPnFm_N"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"gamma = 0.9\n",
"for t in range(len(states)):\n",
" print(\"Return at time %d = %3.3f\"%(t, calculate_return(rewards[t:],gamma)))\n",
"\n",
"# Reality check!\n",
"print(\"True return at time 0: 1.998\")"
],
"metadata": {
"id": "o19lQgM3JrOz"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's define the state transition function $Pr(s_{t+1}|s_{t},a)$ in full where $a$ is the actions. Here $a=0$ means try to go upward, $a=1$, right, $a=2$ down and $a=3$ right. However, the ice is slippery, so we don't always go the direction we want to.\n",
"\n",
"Note that as for the states, we've indexed the actions from zero (unlike in the book, so they map to the indices of arrays better)"
],
"metadata": {
"id": "Fhc6DzZNOjiC"
}
},
{
"cell_type": "code",
"source": [
"transition_probabilities_given_action1 = np.array(\\\n",
"[[0.00 , 0.33, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.33, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.33, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.34, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.34, 0.00, 0.00, 0.17, 0.00, 0.25, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.75, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.17, 0.00, 0.25, 0.00, 0.00, 0.50, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.75 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.25 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.25, 0.00 ],\n",
"])\n",
"\n",
"transition_probabilities_given_action2 = np.array(\\\n",
"[[0.00 , 0.25, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.75 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.50, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.25 , 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.25, 0.00, 0.00, 0.50, 0.00, 0.17, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.25, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.75, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.50, 0.00 ],\n",
"])\n",
"\n",
"transition_probabilities_given_action3 = np.array(\\\n",
"[[0.00 , 0.25, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.25 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.25, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.75 , 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.50, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.50, 0.00, 0.00, 0.16, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.75, 0.00, 0.00, 0.16, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.33, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.16, 0.00, 0.25, 0.00, 0.00, 0.33, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.16, 0.00, 0.00, 0.00, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.34, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.34, 0.00 ],\n",
"])\n",
"\n",
"transition_probabilities_given_action4 = np.array(\\\n",
"[[0.00 , 0.25, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.50, 0.00, 0.75, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.25, 0.00, 0.00, 0.33, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.33, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.17, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.25 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.50, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.75 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.25, 0.00 ],\n",
"])\n",
"\n",
"# Store all of these in a three dimension array\n",
"# Pr(s_{t+1}=2|s_{t}=1, a_{t}=3] is stored at position [2,1,3]\n",
"transition_probabilities_given_action = np.concatenate((np.expand_dims(transition_probabilities_given_action1,2),\n",
" np.expand_dims(transition_probabilities_given_action2,2),\n",
" np.expand_dims(transition_probabilities_given_action3,2),\n",
" np.expand_dims(transition_probabilities_given_action4,2)),axis=2)"
],
"metadata": {
"id": "l7rT78BbOgTi"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Now we need a policy. Let's start with the deterministic policy in figure 19.5a:\n",
"policy = [2,2,1,1, 2,1,1,1, 1,1,0,2, 1,0,1,1]\n",
"\n",
"# Let's draw the policy first\n",
"layout = np.zeros(n_rows * n_cols)\n",
"layout[15] = 2\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = states[0], policy = policy, draw_state_index = True)"
],
"metadata": {
"id": "8jWhDlkaKj7Q"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def markov_decision_process_step_deterministic(state, transition_probabilities_given_action, reward_structure, policy):\n",
" # TODO -- complete this function.\n",
" # For each state, theres is a corresponding action.\n",
" # Draw the next state based on the current state and that action\n",
" # and calculate the reward\n",
" # Replace this line:\n",
" new_state = 0; reward = 0;\n",
"\n",
" return new_state, reward\n"
],
"metadata": {
"id": "dueNbS2SUVUK"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set up the reward structure so it matches figure 19.2\n",
"reward_structure = np.zeros((16,1))\n",
"reward_structure[15] = 1\n",
"\n",
"# Initialize random number seed\n",
"np.random.seed(3)\n",
"T = 10\n",
"# Set up the states, so the fish are in the same positions as figure 19.5\n",
"states = np.zeros(T, dtype='uint8')\n",
"rewards = np.zeros(T, dtype='uint8')\n",
"\n",
"states[0] = 0\n",
"for t in range(T-1):\n",
" states[t+1],rewards[t+1] = markov_decision_process_step_deterministic(states[t], transition_probabilities_given_action, reward_structure, policy)\n",
"\n",
"print(\"Your States:\", states)\n",
"print(\"True States: [ 0 4 8 9 13 14 15 11 7 3]\")\n",
"print(\"Your Rewards:\", rewards)\n",
"print(\"True Rewards: [0 0 0 0 0 0 1 0 0 0]\")\n",
"\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = states[0], path1=states, policy = policy, draw_state_index = True)"
],
"metadata": {
"id": "4Du5aUfd2Lci"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"You can see that the Penguin usually follows the policy, (heads in the direction of the cyan arrows (when it can). But sometimes, the penguin \"slips\" to a different neighboring state\n",
"\n",
"Now let's investigate a stochastic policy"
],
"metadata": {
"id": "bLEd8xug33b-"
}
},
{
"cell_type": "code",
"source": [
"np.random.seed(0)\n",
"# Let's now choose a random policy. We'll generate a set of random numbers and pass\n",
"# them through a softmax function\n",
"stochastic_policy = np.random.normal(size=(4,n_rows*n_cols))\n",
"stochastic_policy = np.exp(stochastic_policy) / (np.ones((4,1))@ np.expand_dims(np.sum(np.exp(stochastic_policy), axis=0),0))\n",
"np.set_printoptions(precision=2)\n",
"print(stochastic_policy)\n",
"\n",
"# Let's draw the policy first\n",
"layout = np.zeros(n_rows * n_cols)\n",
"layout[15] = 2\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = states[0], path1=states, policy = stochastic_policy, draw_state_index = True)"
],
"metadata": {
"id": "o7T0b3tyilDc"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def markov_decision_process_step_stochastic(state, transition_probabilities_given_action, reward_structure, stochastic_policy):\n",
" # TODO -- complete this function.\n",
" # For each state, theres is a corresponding distribution over actions\n",
" # Draw a sample from that distribution to get the action\n",
" # Draw the next state based on the current state and that action\n",
" # and calculate the reward\n",
" # Replace this line:\n",
" new_state = 0; reward = 0;action = 0\n",
"\n",
"\n",
"\n",
" return new_state, reward, action"
],
"metadata": {
"id": "T68mTZSe6A3w"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Set up the reward structure so it matches figure 19.2\n",
"reward_structure = np.zeros((16,1))\n",
"reward_structure[15] = 1\n",
"\n",
"# Initialize random number seed\n",
"np.random.seed(0)\n",
"T = 10\n",
"# Set up the states, so the fish are in the same positions as figure 19.5\n",
"states = np.zeros(T, dtype='uint8')\n",
"rewards = np.zeros(T, dtype='uint8')\n",
"actions = np.zeros(T-1, dtype='uint8')\n",
"\n",
"states[0] = 0\n",
"for t in range(T-1):\n",
" states[t+1],rewards[t+1],actions[t] = markov_decision_process_step_stochastic(states[t], transition_probabilities_given_action, reward_structure, stochastic_policy)\n",
"\n",
"print(\"Actions\", actions)\n",
"print(\"Your States:\", states)\n",
"print(\"Your Rewards:\", rewards)\n",
"\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = states[0], path1=states, policy = stochastic_policy, draw_state_index = True)"
],
"metadata": {
"id": "hMRVYX2HtqMg"
},
"execution_count": null,
"outputs": []
}
]
}

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View File

@@ -0,0 +1,521 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyNEAhORON7DFN1dZMhDK/PO",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap19/19_4_Temporal_Difference_Methods.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 19.4: Temporal difference methods**\n",
"\n",
"This notebook investigates temporal differnece methods for tabular reinforcement learning as described in section 19.3.3 of the book\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from PIL import Image"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Get local copies of components of images\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Empty.png\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Hole.png\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Fish.png\n",
"!wget https://raw.githubusercontent.com/udlbook/udlbook/main/Notebooks/Chap19/Penguin.png"
],
"metadata": {
"id": "ZsvrUszPLyEG"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Ugly class that takes care of drawing pictures like in the book.\n",
"# You can totally ignore this code!\n",
"class DrawMDP:\n",
" # Constructor initializes parameters\n",
" def __init__(self, n_row, n_col):\n",
" self.empty_image = np.asarray(Image.open('Empty.png'))\n",
" self.hole_image = np.asarray(Image.open('Hole.png'))\n",
" self.fish_image = np.asarray(Image.open('Fish.png'))\n",
" self.penguin_image = np.asarray(Image.open('Penguin.png'))\n",
" self.fig,self.ax = plt.subplots()\n",
" self.n_row = n_row\n",
" self.n_col = n_col\n",
"\n",
" my_colormap_vals_hex =('2a0902', '2b0a03', '2c0b04', '2d0c05', '2e0c06', '2f0d07', '300d08', '310e09', '320f0a', '330f0b', '34100b', '35110c', '36110d', '37120e', '38120f', '39130f', '3a1410', '3b1411', '3c1511', '3d1612', '3e1613', '3f1713', '401714', '411814', '421915', '431915', '451a16', '461b16', '471b17', '481c17', '491d18', '4a1d18', '4b1e19', '4c1f19', '4d1f1a', '4e201b', '50211b', '51211c', '52221c', '53231d', '54231d', '55241e', '56251e', '57261f', '58261f', '592720', '5b2821', '5c2821', '5d2922', '5e2a22', '5f2b23', '602b23', '612c24', '622d25', '632e25', '652e26', '662f26', '673027', '683027', '693128', '6a3229', '6b3329', '6c342a', '6d342a', '6f352b', '70362c', '71372c', '72372d', '73382e', '74392e', '753a2f', '763a2f', '773b30', '783c31', '7a3d31', '7b3e32', '7c3e33', '7d3f33', '7e4034', '7f4134', '804235', '814236', '824336', '834437', '854538', '864638', '874739', '88473a', '89483a', '8a493b', '8b4a3c', '8c4b3c', '8d4c3d', '8e4c3e', '8f4d3f', '904e3f', '924f40', '935041', '945141', '955242', '965343', '975343', '985444', '995545', '9a5646', '9b5746', '9c5847', '9d5948', '9e5a49', '9f5a49', 'a05b4a', 'a15c4b', 'a35d4b', 'a45e4c', 'a55f4d', 'a6604e', 'a7614e', 'a8624f', 'a96350', 'aa6451', 'ab6552', 'ac6552', 'ad6653', 'ae6754', 'af6855', 'b06955', 'b16a56', 'b26b57', 'b36c58', 'b46d59', 'b56e59', 'b66f5a', 'b7705b', 'b8715c', 'b9725d', 'ba735d', 'bb745e', 'bc755f', 'bd7660', 'be7761', 'bf7862', 'c07962', 'c17a63', 'c27b64', 'c27c65', 'c37d66', 'c47e67', 'c57f68', 'c68068', 'c78169', 'c8826a', 'c9836b', 'ca846c', 'cb856d', 'cc866e', 'cd876f', 'ce886f', 'ce8970', 'cf8a71', 'd08b72', 'd18c73', 'd28d74', 'd38e75', 'd48f76', 'd59077', 'd59178', 'd69279', 'd7937a', 'd8957b', 'd9967b', 'da977c', 'da987d', 'db997e', 'dc9a7f', 'dd9b80', 'de9c81', 'de9d82', 'df9e83', 'e09f84', 'e1a185', 'e2a286', 'e2a387', 'e3a488', 'e4a589', 'e5a68a', 'e5a78b', 'e6a88c', 'e7aa8d', 'e7ab8e', 'e8ac8f', 'e9ad90', 'eaae91', 'eaaf92', 'ebb093', 'ecb295', 'ecb396', 'edb497', 'eeb598', 'eeb699', 'efb79a', 'efb99b', 'f0ba9c', 'f1bb9d', 'f1bc9e', 'f2bd9f', 'f2bfa1', 'f3c0a2', 'f3c1a3', 'f4c2a4', 'f5c3a5', 'f5c5a6', 'f6c6a7', 'f6c7a8', 'f7c8aa', 'f7c9ab', 'f8cbac', 'f8ccad', 'f8cdae', 'f9ceb0', 'f9d0b1', 'fad1b2', 'fad2b3', 'fbd3b4', 'fbd5b6', 'fbd6b7', 'fcd7b8', 'fcd8b9', 'fcdaba', 'fddbbc', 'fddcbd', 'fddebe', 'fddfbf', 'fee0c1', 'fee1c2', 'fee3c3', 'fee4c5', 'ffe5c6', 'ffe7c7', 'ffe8c9', 'ffe9ca', 'ffebcb', 'ffeccd', 'ffedce', 'ffefcf', 'fff0d1', 'fff2d2', 'fff3d3', 'fff4d5', 'fff6d6', 'fff7d8', 'fff8d9', 'fffada', 'fffbdc', 'fffcdd', 'fffedf', 'ffffe0')\n",
" my_colormap_vals_dec = np.array([int(element,base=16) for element in my_colormap_vals_hex])\n",
" r = np.floor(my_colormap_vals_dec/(256*256))\n",
" g = np.floor((my_colormap_vals_dec - r *256 *256)/256)\n",
" b = np.floor(my_colormap_vals_dec - r * 256 *256 - g * 256)\n",
" self.colormap = np.vstack((r,g,b)).transpose()/255.0\n",
"\n",
"\n",
" def draw_text(self, text, row, col, position, color):\n",
" if position == 'bc':\n",
" self.ax.text( 83*col+41,83 * (row+1) -5, text, horizontalalignment=\"center\", color=color, fontweight='bold')\n",
" if position == 'tc':\n",
" self.ax.text( 83*col+41,83 * (row) +10, text, horizontalalignment=\"center\", color=color, fontweight='bold')\n",
" if position == 'lc':\n",
" self.ax.text( 83*col+2,83 * (row) +41, text, verticalalignment=\"center\", color=color, fontweight='bold', rotation=90)\n",
" if position == 'rc':\n",
" self.ax.text( 83*(col+1)-5,83 * (row) +41, text, horizontalalignment=\"right\", verticalalignment=\"center\", color=color, fontweight='bold', rotation=-90)\n",
" if position == 'tl':\n",
" self.ax.text( 83*col+5,83 * row +5, text, verticalalignment = 'top', horizontalalignment=\"left\", color=color, fontweight='bold')\n",
" if position == 'tr':\n",
" self.ax.text( 83*(col+1)-5, 83 * row +5, text, verticalalignment = 'top', horizontalalignment=\"right\", color=color, fontweight='bold')\n",
"\n",
" # Draws a set of states\n",
" def draw_path(self, path, color1, color2):\n",
" for i in range(len(path)-1):\n",
" row_start = np.floor(path[i]/self.n_col)\n",
" row_end = np.floor(path[i+1]/self.n_col)\n",
" col_start = path[i] - row_start * self.n_col\n",
" col_end = path[i+1] - row_end * self.n_col\n",
"\n",
" color_index = int(np.floor(255 * i/(len(path)-1.)))\n",
" self.ax.plot([col_start * 83+41 + i, col_end * 83+41 + i ],[row_start * 83+41 + i, row_end * 83+41 + i ], color=(self.colormap[color_index,0],self.colormap[color_index,1],self.colormap[color_index,2]))\n",
"\n",
"\n",
" # Draw deterministic policy\n",
" def draw_deterministic_policy(self,i, action):\n",
" row = np.floor(i/self.n_col)\n",
" col = i - row * self.n_col\n",
" center_x = 83 * col + 41\n",
" center_y = 83 * row + 41\n",
" arrow_base_width = 10\n",
" arrow_height = 15\n",
" # Draw arrow pointing upward\n",
" if action ==0:\n",
" triangle_indices = np.array([[center_x, center_y-arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y+arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y+arrow_height/2]])\n",
" # Draw arrow pointing right\n",
" if action ==1:\n",
" triangle_indices = np.array([[center_x + arrow_height/2, center_y],\n",
" [center_x - arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x - arrow_height/2, center_y+arrow_base_width/2]])\n",
" # Draw arrow pointing downward\n",
" if action ==2:\n",
" triangle_indices = np.array([[center_x, center_y+arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y-arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y-arrow_height/2]])\n",
" # Draw arrow pointing left\n",
" if action ==3:\n",
" triangle_indices = np.array([[center_x - arrow_height/2, center_y],\n",
" [center_x + arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x + arrow_height/2, center_y+arrow_base_width/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw stochastic policy\n",
" def draw_stochastic_policy(self,i, action_probs):\n",
" row = np.floor(i/self.n_col)\n",
" col = i - row * self.n_col\n",
" offset = 20\n",
" # Draw arrow pointing upward\n",
" center_x = 83 * col + 41\n",
" center_y = 83 * row + 41 - offset\n",
" arrow_base_width = 15 * action_probs[0]\n",
" arrow_height = 20 * action_probs[0]\n",
" triangle_indices = np.array([[center_x, center_y-arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y+arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y+arrow_height/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw arrow pointing right\n",
" center_x = 83 * col + 41 + offset\n",
" center_y = 83 * row + 41\n",
" arrow_base_width = 15 * action_probs[1]\n",
" arrow_height = 20 * action_probs[1]\n",
" triangle_indices = np.array([[center_x + arrow_height/2, center_y],\n",
" [center_x - arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x - arrow_height/2, center_y+arrow_base_width/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw arrow pointing downward\n",
" center_x = 83 * col + 41\n",
" center_y = 83 * row + 41 +offset\n",
" arrow_base_width = 15 * action_probs[2]\n",
" arrow_height = 20 * action_probs[2]\n",
" triangle_indices = np.array([[center_x, center_y+arrow_height/2],\n",
" [center_x - arrow_base_width/2, center_y-arrow_height/2],\n",
" [center_x + arrow_base_width/2, center_y-arrow_height/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
" # Draw arrow pointing left\n",
" center_x = 83 * col + 41 -offset\n",
" center_y = 83 * row + 41\n",
" arrow_base_width = 15 * action_probs[3]\n",
" arrow_height = 20 * action_probs[3]\n",
" triangle_indices = np.array([[center_x - arrow_height/2, center_y],\n",
" [center_x + arrow_height/2, center_y-arrow_base_width/2],\n",
" [center_x + arrow_height/2, center_y+arrow_base_width/2]])\n",
" self.ax.fill(triangle_indices[:,0], triangle_indices[:,1],facecolor='cyan', edgecolor='darkcyan', linewidth=1)\n",
"\n",
"\n",
" def draw(self, layout, state=None, draw_state_index= False, rewards=None, policy=None, state_values=None, state_action_values=None,path1=None, path2 = None):\n",
" # Construct the image\n",
" image_out = np.zeros((self.n_row * 83, self.n_col * 83, 4),dtype='uint8')\n",
" for c_row in range (self.n_row):\n",
" for c_col in range(self.n_col):\n",
" if layout[c_row * self.n_col + c_col]==0:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.empty_image\n",
" elif layout[c_row * self.n_col + c_col]==1:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.hole_image\n",
" else:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.fish_image\n",
" if state is not None and state == c_row * self.n_col + c_col:\n",
" image_out[c_row*83:c_row*83+83, c_col*83:c_col*83+83,:] = self.penguin_image\n",
"\n",
" # Draw the image\n",
" plt.imshow(image_out)\n",
" self.ax.get_xaxis().set_visible(False)\n",
" self.ax.get_yaxis().set_visible(False)\n",
" self.ax.spines['top'].set_visible(False)\n",
" self.ax.spines['right'].set_visible(False)\n",
" self.ax.spines['bottom'].set_visible(False)\n",
" self.ax.spines['left'].set_visible(False)\n",
"\n",
" if draw_state_index:\n",
" for c_cell in range(layout.size):\n",
" self.draw_text(\"%d\"%(c_cell), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'tl','k')\n",
"\n",
" # Draw the policy as triangles\n",
" if policy is not None:\n",
" # If the policy is deterministic\n",
" if len(policy) == len(layout):\n",
" for i in range(len(layout)):\n",
" self.draw_deterministic_policy(i, policy[i])\n",
" # Else it is stochastic\n",
" else:\n",
" for i in range(len(layout)):\n",
" self.draw_stochastic_policy(i,policy[:,i])\n",
"\n",
"\n",
" if path1 is not None:\n",
" self.draw_path(path1, np.array([1.0, 0.0, 0.0]), np.array([0.0, 1.0, 1.0]))\n",
"\n",
" if rewards is not None:\n",
" for c_cell in range(layout.size):\n",
" self.draw_text(\"%d\"%(rewards[c_cell]), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'tr','r')\n",
"\n",
" if state_values is not None:\n",
" for c_cell in range(layout.size):\n",
" self.draw_text(\"%2.2f\"%(state_values[c_cell]), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'bc','black')\n",
"\n",
" if state_action_values is not None:\n",
" for c_cell in range(layout.size):\n",
" self.draw_text(\"%2.2f\"%(state_action_values[0, c_cell]), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'tc','black')\n",
" self.draw_text(\"%2.2f\"%(state_action_values[1, c_cell]), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'rc','black')\n",
" self.draw_text(\"%2.2f\"%(state_action_values[2, c_cell]), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'bc','black')\n",
" self.draw_text(\"%2.2f\"%(state_action_values[3, c_cell]), np.floor(c_cell/self.n_col), c_cell-np.floor(c_cell/self.n_col)*self.n_col,'lc','black')\n",
"\n",
" plt.show()"
],
"metadata": {
"id": "Gq1HfJsHN3SB"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# We're going to work on the problem depicted in figure 19.10a\n",
"n_rows = 4; n_cols = 4\n",
"layout = np.zeros(n_rows * n_cols)\n",
"reward_structure = np.zeros(n_rows * n_cols)\n",
"layout[9] = 1 ; reward_structure[9] = -2\n",
"layout[10] = 1; reward_structure[10] = -2\n",
"layout[14] = 1; reward_structure[14] = -2\n",
"layout[15] = 2; reward_structure[15] = 3\n",
"initial_state = 0\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, state = initial_state, rewards=reward_structure, draw_state_index = True)"
],
"metadata": {
"id": "eBQ7lTpJQBSe"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"For clarity, the black numbers are the state number and the red numbers are the reward for being in that state. Note that the states are indexed from 0 rather than 1 as in the book to make the code neater."
],
"metadata": {
"id": "6Vku6v_se2IG"
}
},
{
"cell_type": "markdown",
"source": [
"Now let's define the state transition function $Pr(s_{t+1}|s_{t},a)$ in full where $a$ is the actions. Here $a=0$ means try to go upward, $a=1$, right, $a=2$ down and $a=3$ right. However, the ice is slippery, so we don't always go the direction we want to.\n",
"\n",
"Note that as for the states, we've indexed the actions from zero (unlike in the book) so they map to the indices of arrays better"
],
"metadata": {
"id": "Fhc6DzZNOjiC"
}
},
{
"cell_type": "code",
"source": [
"transition_probabilities_given_action0 = np.array(\\\n",
"[[0.00 , 0.33, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.33, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.33, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.34, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.34, 0.00, 0.00, 0.17, 0.00, 0.25, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.75, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.17, 0.00, 0.25, 0.00, 0.00, 0.50, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.75 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.25 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.25, 0.00 ],\n",
"])\n",
"\n",
"transition_probabilities_given_action1 = np.array(\\\n",
"[[0.00 , 0.25, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.75 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.50, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.25 , 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.25, 0.00, 0.00, 0.50, 0.00, 0.17, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.25, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.75, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.50, 0.00 ],\n",
"])\n",
"\n",
"transition_probabilities_given_action2 = np.array(\\\n",
"[[0.00 , 0.25, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.25 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.25, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.75 , 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.50, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.50, 0.00, 0.00, 0.16, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.75, 0.00, 0.00, 0.16, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.17, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00, 0.17, 0.00, 0.00, 0.33, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.16, 0.00, 0.25, 0.00, 0.00, 0.33, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.16, 0.00, 0.00, 0.00, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.33, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.33, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.34, 0.00, 0.50 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.34, 0.00 ],\n",
"])\n",
"\n",
"transition_probabilities_given_action3 = np.array(\\\n",
"[[0.00 , 0.25, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.50, 0.00, 0.75, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.50, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.50 , 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.33, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.25, 0.00, 0.00, 0.33, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.50, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00, 0.50, 0.00, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.33, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.17, 0.00, 0.50, 0.00, 0.00, 0.25, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.17, 0.00, 0.00, 0.00, 0.00, 0.25 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.34, 0.00, 0.00, 0.00, 0.00, 0.50, 0.00, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.50, 0.00, 0.50, 0.00 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.16, 0.00, 0.00, 0.25, 0.00, 0.75 ],\n",
" [0.00 , 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.00, 0.25, 0.00, 0.00, 0.25, 0.00 ],\n",
"])\n",
"\n",
"# Store all of these in a three dimension array\n",
"# Pr(s_{t+1}=2|s_{t}=1, a_{t}=3] is stored at position [2,1,3]\n",
"transition_probabilities_given_action = np.concatenate((np.expand_dims(transition_probabilities_given_action0,2),\n",
" np.expand_dims(transition_probabilities_given_action1,2),\n",
" np.expand_dims(transition_probabilities_given_action2,2),\n",
" np.expand_dims(transition_probabilities_given_action3,2)),axis=2)"
],
"metadata": {
"id": "l7rT78BbOgTi"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def q_learning_step(state_action_values, reward, state, new_state, action, gamma, alpha = 0.1):\n",
" # TODO -- write this function\n",
" # Replace this line\n",
" state_action_values_after = np.copy(state_action_values)\n",
"\n",
" return state_action_values_after"
],
"metadata": {
"id": "5pO6-9ACWhiV"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# This takes a single step from an MDP which just has a completely random policy\n",
"def markov_decision_process_step(state, transition_probabilities_given_action, reward_structure):\n",
" # Pick action\n",
" action = np.random.randint(4)\n",
" # Update the state\n",
" new_state = np.random.choice(a=np.arange(0,transition_probabilities_given_action.shape[0]),p = transition_probabilities_given_action[:,state,action])\n",
" # Return the reward -- here the reward is for leaving the state\n",
" reward = reward_structure[state]\n",
"\n",
" return new_state, reward, action"
],
"metadata": {
"id": "akjrncMF-FkU"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Initialize the state-action values to random numbers\n",
"np.random.seed(0)\n",
"n_state = transition_probabilities_given_action.shape[0]\n",
"n_action = transition_probabilities_given_action.shape[2]\n",
"state_action_values = np.random.normal(size=(n_action, n_state))\n",
"gamma = 0.9\n",
"\n",
"policy = np.argmax(state_action_values, axis=0).astype(int)\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, policy = policy, state_action_values = state_action_values, rewards = reward_structure)\n",
"\n",
"# Now let's simulate a single Q-learning step\n",
"initial_state = 9\n",
"print(\"Initial state = \", initial_state)\n",
"new_state, reward, action = markov_decision_process_step(initial_state, transition_probabilities_given_action, reward_structure)\n",
"print(\"Action = \", action)\n",
"print(\"New state = \", new_state)\n",
"print(\"Reward = \", reward)\n",
"\n",
"state_action_values_after = q_learning_step(state_action_values, reward, initial_state, new_state, action, gamma)\n",
"print(\"Your value:\",state_action_values_after[action, initial_state])\n",
"print(\"True value: 0.27650262412468796\")\n",
"\n",
"policy = np.argmax(state_action_values, axis=0).astype(int)\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, policy = policy, state_action_values = state_action_values_after, rewards = reward_structure)\n"
],
"metadata": {
"id": "Fu5_VjvbSwfJ"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's run this for a while and watch the policy improve"
],
"metadata": {
"id": "Ogh0qucmb68J"
}
},
{
"cell_type": "code",
"source": [
"# Initialize the state-action values to random numbers\n",
"np.random.seed(0)\n",
"n_state = transition_probabilities_given_action.shape[0]\n",
"n_action = transition_probabilities_given_action.shape[2]\n",
"state_action_values = np.random.normal(size=(n_action, n_state))\n",
"# Hard code termination state of finding fish\n",
"state_action_values[:,n_state-1] = 3.0\n",
"gamma = 0.9\n",
"\n",
"# Draw the initial setup\n",
"policy = np.argmax(state_action_values, axis=0).astype(int)\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, policy = policy, state_action_values = state_action_values, rewards = reward_structure)\n",
"\n",
"\n",
"state= np.random.randint(n_state-1)\n",
"\n",
"# Run for a number of iterations\n",
"for c_iter in range(10000):\n",
" new_state, reward, action = markov_decision_process_step(state, transition_probabilities_given_action, reward_structure)\n",
" state_action_values_after = q_learning_step(state_action_values, reward, state, new_state, action, gamma)\n",
" # If in termination state, reset state randomly\n",
" if new_state==15:\n",
" state= np.random.randint(n_state-1)\n",
" else:\n",
" state = new_state\n",
" # Update the policy\n",
" state_action_values = np.copy(state_action_values_after)\n",
" policy = np.argmax(state_action_values, axis=0).astype(int)\n",
"\n",
"# Draw the final situation\n",
"mdp_drawer = DrawMDP(n_rows, n_cols)\n",
"mdp_drawer.draw(layout, policy = policy, state_action_values = state_action_values, rewards = reward_structure)"
],
"metadata": {
"id": "qQFhwVqPcCFH"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -0,0 +1,170 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyO6CLgMIO5bUVAMkzPT3z4y",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap19/19_5_Control_Variates.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 19.5: Control variates**\n",
"\n",
"This notebook investigates the method of control variates as described in figure 19.16\n",
"\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions."
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt"
],
"metadata": {
"id": "OLComQyvCIJ7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Genearate from our two variables, $a$ and $b$. We are interested in estimating the mean of $a$, but we can use $b$$ to improve our estimates if it is correlated"
],
"metadata": {
"id": "uwmhcAZBzTRO"
}
},
{
"cell_type": "code",
"source": [
"# Sample from two variables with mean zero, standard deviation one, and a given correlation coefficient\n",
"def get_samples(n_samples, correlation_coeff=0.8):\n",
" a = np.random.normal(size=(1,n_samples))\n",
" temp = np.random.normal(size=(1, n_samples))\n",
" b = correlation_coeff * a + np.sqrt(1-correlation_coeff * correlation_coeff) * temp\n",
" return a, b"
],
"metadata": {
"id": "bC8MBXPawQJ3"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"N = 10000000\n",
"a,b, = get_samples(N)\n",
"\n",
"# Verify that these two variables have zero mean and unit standard deviation\n",
"print(\"Mean of a = %3.3f, Std of a = %3.3f\"%(np.mean(a),np.std(a)))\n",
"print(\"Mean of b = %3.3f, Std of b = %3.3f\"%(np.mean(b),np.std(b)))"
],
"metadata": {
"id": "1cT66nbRyW34"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's samples $N=10$ examples from $a$ and estimate their mean $\\mathbb{E}[a]$. We'll do this 1000000 times and then compute the variance of those estimates."
],
"metadata": {
"id": "PWoYRpjS0Nlf"
}
},
{
"cell_type": "code",
"source": [
"n_estimate = 1000000\n",
"\n",
"N = 5\n",
"\n",
"# TODO -- sample N examples of variable $a$\n",
"# Compute the mean of each\n",
"# Compute the mean and variance of these estimates of the mean\n",
"# Replace this line\n",
"mean_of_estimator_1 = -1; std_of_estimator_1 = -1\n",
"\n",
"print(\"Standard estimator mean = %3.3f, Standard estimator variance = %3.3f\"%(mean_of_estimator_1, std_of_estimator_1))"
],
"metadata": {
"id": "n6Uem2aYzBp7"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Now let's estimate the mean $\\mathbf{E}[a]$ of $a$ by computing $a-b$ where $b$ is correlated with $a$"
],
"metadata": {
"id": "F-af86z13TFc"
}
},
{
"cell_type": "code",
"source": [
"n_estimate = 1000000\n",
"\n",
"N = 5\n",
"\n",
"# TODO -- sample N examples of variables $a$ and $b$\n",
"# Compute $c=a-b$ for each and then compute the mean of $c$\n",
"# Compute the mean and variance of these estimates of the mean of $c$\n",
"# Replace this line\n",
"mean_of_estimator_2 = -1; std_of_estimator_2 = -1\n",
"\n",
"print(\"Control variate estimator mean = %3.3f, Control variate estimator variance = %3.3f\"%(mean_of_estimator_2, std_of_estimator_2))"
],
"metadata": {
"id": "MrEVDggY0IGU"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Note that they both have a very similar mean, but the second estimator has a lower variance. \n",
"\n",
"TODO -- Experiment with different samples sizes $N$ and correlation coefficients."
],
"metadata": {
"id": "Jklzkca14ofS"
}
}
]
}

BIN
Notebooks/Chap19/Empty.png Normal file

Binary file not shown.

After

Width:  |  Height:  |  Size: 12 KiB

BIN
Notebooks/Chap19/Fish.png Normal file

Binary file not shown.

After

Width:  |  Height:  |  Size: 12 KiB

BIN
Notebooks/Chap19/Hole.png Normal file

Binary file not shown.

After

Width:  |  Height:  |  Size: 9.2 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 13 KiB

View File

@@ -0,0 +1,305 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyPkSYbEjOcEmLt8tU6HxNuR",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notebooks/Chap20/20_1_Random_Data.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 20.1: Random Data**\n",
"\n",
"This notebook investigates training the network with random data, as illustrated in figure 20.1.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions.\n",
"\n"
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"# Run this if you're in a Colab to make a local copy of the MNIST 1D repository\n",
"!git clone https://github.com/greydanus/mnist1d"
],
"metadata": {
"id": "D5yLObtZCi9J"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import os\n",
"import torch, torch.nn as nn\n",
"from torch.utils.data import TensorDataset, DataLoader\n",
"from torch.optim.lr_scheduler import StepLR\n",
"import matplotlib.pyplot as plt\n",
"import mnist1d\n",
"import random\n",
"from IPython.display import display, clear_output"
],
"metadata": {
"id": "YrXWAH7sUWvU"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"args = mnist1d.data.get_dataset_args()\n",
"data = mnist1d.data.get_dataset(args, path='./mnist1d_data.pkl', download=False, regenerate=False)\n",
"\n",
"# The training and test input and outputs are in\n",
"# data['x'], data['y'], data['x_test'], and data['y_test']\n",
"print(\"Examples in training set: {}\".format(len(data['y'])))\n",
"print(\"Examples in test set: {}\".format(len(data['y_test'])))\n",
"print(\"Length of each example: {}\".format(data['x'].shape[-1]))"
],
"metadata": {
"id": "twI72ZCrCt5z"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Define the network"
],
"metadata": {
"id": "_sFvRDGrl4qe"
}
},
{
"cell_type": "code",
"source": [
"D_i = 40 # Input dimensions\n",
"D_k = 300 # Hidden dimensions\n",
"D_o = 10 # Output dimensions\n",
"\n",
"model = nn.Sequential(\n",
"nn.Linear(D_i, D_k),\n",
"nn.ReLU(),\n",
"nn.Linear(D_k, D_k),\n",
"nn.ReLU(),\n",
"nn.Linear(D_k, D_k),\n",
"nn.ReLU(),\n",
"nn.Linear(D_k, D_k),\n",
"nn.ReLU(),\n",
"nn.Linear(D_k, D_o))"
],
"metadata": {
"id": "FslroPJJffrh"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# He initialization of weights\n",
"def weights_init(layer_in):\n",
" if isinstance(layer_in, nn.Linear):\n",
" nn.init.kaiming_uniform_(layer_in.weight)\n",
" layer_in.bias.data.fill_(0.0)"
],
"metadata": {
"id": "YgLaex1pfhqz"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"def train_model(train_data_x, train_data_y, n_epoch):\n",
" # choose cross entropy loss function (equation 5.24 in the loss notes)\n",
" loss_function = nn.CrossEntropyLoss()\n",
" # construct SGD optimizer and initialize learning rate and momentum\n",
" optimizer = torch.optim.SGD(model.parameters(), lr = 0.02, momentum=0.9)\n",
" # object that decreases learning rate by half every 20 epochs\n",
" scheduler = StepLR(optimizer, step_size=20, gamma=0.5)\n",
" # create 100 dummy data points and store in data loader class\n",
" x_train = torch.tensor(train_data_x.transpose().astype('float32'))\n",
" y_train = torch.tensor(train_data_y.astype('long'))\n",
"\n",
" # load the data into a class that creates the batches\n",
" data_loader = DataLoader(TensorDataset(x_train,y_train), batch_size=100, shuffle=True, worker_init_fn=np.random.seed(1))\n",
"\n",
" # Initialize model weights\n",
" model.apply(weights_init)\n",
"\n",
" # store the loss and the % correct at each epoch\n",
" losses_train = np.zeros((n_epoch))\n",
"\n",
" for epoch in range(n_epoch):\n",
" # loop over batches\n",
" for i, data in enumerate(data_loader):\n",
" # retrieve inputs and labels for this batch\n",
" x_batch, y_batch = data\n",
" # zero the parameter gradients\n",
" optimizer.zero_grad()\n",
" # forward pass -- calculate model output\n",
" pred = model(x_batch)\n",
" # compute the loss\n",
" loss = loss_function(pred, y_batch)\n",
" # backward pass\n",
" loss.backward()\n",
" # SGD update\n",
" optimizer.step()\n",
"\n",
" # Run whole dataset to get statistics -- normally wouldn't do this\n",
" pred_train = model(x_train)\n",
" _, predicted_train_class = torch.max(pred_train.data, 1)\n",
" losses_train[epoch] = loss_function(pred_train, y_train).item()\n",
" if epoch % 5 == 0:\n",
" clear_output(wait=True)\n",
" display(\"Epoch %d, train loss %3.3f\"%(epoch, losses_train[epoch]))\n",
"\n",
" # tell scheduler to consider updating learning rate\n",
" scheduler.step()\n",
"\n",
" return losses_train"
],
"metadata": {
"id": "NYw8I_3mmX5c"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Load in the data\n",
"train_data_x = data['x'].transpose()\n",
"train_data_y = data['y']\n",
"# Print out sizes\n",
"print(\"Train data: %d examples (columns), each of which has %d dimensions (rows)\"%((train_data_x.shape[1],train_data_x.shape[0])))"
],
"metadata": {
"id": "4FE3HQ_vedXO"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Compute loss for proper data and plot\n",
"n_epoch = 60\n",
"loss_true_labels = train_model(train_data_x, train_data_y, n_epoch)\n",
"# Plot the results\n",
"fig, ax = plt.subplots()\n",
"ax.plot(loss_true_labels,'r-',label='true_labels')\n",
"# ax.set_ylim(0,0.7); ax.set_xlim(0,n_epoch)\n",
"ax.set_xlabel('Epoch'); ax.set_ylabel('Loss')\n",
"ax.legend()\n",
"plt.show()"
],
"metadata": {
"id": "b56wdODqemF1"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO -- Randomize the input data (train_data_x), but retain overall mean and variance\n",
"# Replace this line\n",
"train_data_x_randomized = np.copy(train_data_x)"
],
"metadata": {
"id": "SbPCiiUKgTLw"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Compute loss for true labels and plot\n",
"n_epoch = 60\n",
"loss_randomized_data = train_model(train_data_x_randomized, train_data_y, n_epoch)\n",
"# Plot the results\n",
"fig, ax = plt.subplots()\n",
"ax.plot(loss_true_labels,'r-',label='true_labels')\n",
"ax.plot(loss_randomized_data,'b-',label='random_data')\n",
"# ax.set_ylim(0,0.7); ax.set_xlim(0,n_epoch)\n",
"ax.set_xlabel('Epoch'); ax.set_ylabel('Loss')\n",
"ax.legend()\n",
"plt.show()"
],
"metadata": {
"id": "y7CcCJvvjLnn"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# TODO -- Permute the labels\n",
"# Replace this line:\n",
"train_data_y_permuted = np.copy(train_data_y)"
],
"metadata": {
"id": "ojaMTrzKj_74"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Compute loss for true labels and plot\n",
"n_epoch = 60\n",
"loss_permuted_labels = train_model(train_data_x, train_data_y_permuted, n_epoch)\n",
"# Plot the results\n",
"fig, ax = plt.subplots()\n",
"ax.plot(loss_true_labels,'r-',label='true_labels')\n",
"ax.plot(loss_randomized_data,'b-',label='random_data')\n",
"ax.plot(loss_permuted_labels,'g-',label='random_labels')\n",
"# ax.set_ylim(0,0.7); ax.set_xlim(0,n_epoch)\n",
"ax.set_xlabel('Epoch'); ax.set_ylabel('Loss')\n",
"ax.legend()\n",
"plt.show()"
],
"metadata": {
"id": "LaYCSjyMo9LQ"
},
"execution_count": null,
"outputs": []
}
]
}

View File

@@ -1,277 +0,0 @@
{
"nbformat": 4,
"nbformat_minor": 0,
"metadata": {
"colab": {
"provenance": [],
"authorship_tag": "ABX9TyMJvfoCDFcSK7Z0/HkcGunb",
"include_colab_link": true
},
"kernelspec": {
"name": "python3",
"display_name": "Python 3"
},
"language_info": {
"name": "python"
}
},
"cells": [
{
"cell_type": "markdown",
"metadata": {
"id": "view-in-github",
"colab_type": "text"
},
"source": [
"<a href=\"https://colab.research.google.com/github/udlbook/udlbook/blob/main/Notesbooks/Chap11/11_2_Residual_Networks.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>"
]
},
{
"cell_type": "markdown",
"source": [
"# **Notebook 11.2: Residual Networks**\n",
"\n",
"This notebook adapts the networks for MNIST1D to use residual connections.\n",
"\n",
"Work through the cells below, running each cell in turn. In various places you will see the words \"TO DO\". Follow the instructions at these places and make predictions about what is going to happen or write code to complete the functions.\n",
"\n",
"Contact me at udlbookmail@gmail.com if you find any mistakes or have any suggestions.\n",
"\n"
],
"metadata": {
"id": "t9vk9Elugvmi"
}
},
{
"cell_type": "code",
"source": [
"# Run this if you're in a Colab to make a local copy of the MNIST 1D repository\n",
"!git clone https://github.com/greydanus/mnist1d"
],
"metadata": {
"id": "D5yLObtZCi9J"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"import numpy as np\n",
"import os\n",
"import torch, torch.nn as nn\n",
"from torch.utils.data import TensorDataset, DataLoader\n",
"from torch.optim.lr_scheduler import StepLR\n",
"import matplotlib.pyplot as plt\n",
"import mnist1d\n",
"import random"
],
"metadata": {
"id": "YrXWAH7sUWvU"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"args = mnist1d.data.get_dataset_args()\n",
"data = mnist1d.data.get_dataset(args, path='./mnist1d_data.pkl', download=False, regenerate=False)\n",
"\n",
"# The training and test input and outputs are in\n",
"# data['x'], data['y'], data['x_test'], and data['y_test']\n",
"print(\"Examples in training set: {}\".format(len(data['y'])))\n",
"print(\"Examples in test set: {}\".format(len(data['y_test'])))\n",
"print(\"Length of each example: {}\".format(data['x'].shape[-1]))"
],
"metadata": {
"id": "twI72ZCrCt5z"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Load in the data\n",
"train_data_x = data['x'].transpose()\n",
"train_data_y = data['y']\n",
"val_data_x = data['x_test'].transpose()\n",
"val_data_y = data['y_test']\n",
"# Print out sizes\n",
"print(\"Train data: %d examples (columns), each of which has %d dimensions (rows)\"%((train_data_x.shape[1],train_data_x.shape[0])))\n",
"print(\"Validation data: %d examples (columns), each of which has %d dimensions (rows)\"%((val_data_x.shape[1],val_data_x.shape[0])))"
],
"metadata": {
"id": "8bKADvLHbiV5"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"Define the network"
],
"metadata": {
"id": "_sFvRDGrl4qe"
}
},
{
"cell_type": "code",
"source": [
"# There are 40 input dimensions and 10 output dimensions for this data\n",
"# The inputs correspond to the 40 offsets in the MNIST1D template.\n",
"D_i = 40\n",
"# The outputs correspond to the 10 digits\n",
"D_o = 10\n",
"\n",
"\n",
"# We will adapt this model to have residual connections around the linear layers\n",
"# This is the same model we used in practical 8.1, but we can't use the sequential\n",
"# class for residual networks (which aren't strictly sequential). Hence, I've rewritten\n",
"# it as a model that inherits from a base class\n",
"\n",
"class ResidualNetwork(torch.nn.Module):\n",
" def __init__(self, input_size, output_size, hidden_size=100):\n",
" super(ResidualNetwork, self).__init__()\n",
" self.linear1 = nn.Linear(input_size, hidden_size)\n",
" self.linear2 = nn.Linear(hidden_size, hidden_size)\n",
" self.linear3 = nn.Linear(hidden_size, hidden_size)\n",
" self.linear4 = nn.Linear(hidden_size, output_size)\n",
" print(\"Initialized MLPBase model with {} parameters\".format(self.count_params()))\n",
"\n",
" def count_params(self):\n",
" return sum([p.view(-1).shape[0] for p in self.parameters()])\n",
"\n",
"# # TODO -- Add residual connections to this model\n",
"# # The order of operations should similar to figure 11.5b\n",
"# # linear1 first, ReLU+linear2 in first residual block, ReLU+linear3 in second residual block), linear4 at end\n",
"# # Replace this function\n",
" def forward(self, x):\n",
" h1 = self.linear1(x).relu()\n",
" h2 = self.linear2(h1).relu()\n",
" h3 = self.linear3(h2).relu()\n",
" return self.linear4(h3)\n"
],
"metadata": {
"id": "FslroPJJffrh"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# He initialization of weights\n",
"def weights_init(layer_in):\n",
" if isinstance(layer_in, nn.Linear):\n",
" nn.init.kaiming_uniform_(layer_in.weight)\n",
" layer_in.bias.data.fill_(0.0)"
],
"metadata": {
"id": "YgLaex1pfhqz"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"#Define the model\n",
"model = ResidualNetwork(40, 10)\n",
"\n",
"# choose cross entropy loss function (equation 5.24 in the loss notes)\n",
"loss_function = nn.CrossEntropyLoss()\n",
"# construct SGD optimizer and initialize learning rate and momentum\n",
"optimizer = torch.optim.SGD(model.parameters(), lr = 0.05, momentum=0.9)\n",
"# object that decreases learning rate by half every 20 epochs\n",
"scheduler = StepLR(optimizer, step_size=20, gamma=0.5)\n",
"# create 100 dummy data points and store in data loader class\n",
"x_train = torch.tensor(train_data_x.transpose().astype('float32'))\n",
"y_train = torch.tensor(train_data_y.astype('long'))\n",
"x_val= torch.tensor(val_data_x.transpose().astype('float32'))\n",
"y_val = torch.tensor(val_data_y.astype('long'))\n",
"\n",
"# load the data into a class that creates the batches\n",
"data_loader = DataLoader(TensorDataset(x_train,y_train), batch_size=100, shuffle=True, worker_init_fn=np.random.seed(1))\n",
"\n",
"# Initialize model weights\n",
"model.apply(weights_init)\n",
"\n",
"# loop over the dataset n_epoch times\n",
"n_epoch = 100\n",
"# store the loss and the % correct at each epoch\n",
"losses_train = np.zeros((n_epoch))\n",
"errors_train = np.zeros((n_epoch))\n",
"losses_val = np.zeros((n_epoch))\n",
"errors_val = np.zeros((n_epoch))\n",
"\n",
"for epoch in range(n_epoch):\n",
" # loop over batches\n",
" for i, data in enumerate(data_loader):\n",
" # retrieve inputs and labels for this batch\n",
" x_batch, y_batch = data\n",
" # zero the parameter gradients\n",
" optimizer.zero_grad()\n",
" # forward pass -- calculate model output\n",
" pred = model(x_batch)\n",
" # compute the loss\n",
" loss = loss_function(pred, y_batch)\n",
" # backward pass\n",
" loss.backward()\n",
" # SGD update\n",
" optimizer.step()\n",
"\n",
" # Run whole dataset to get statistics -- normally wouldn't do this\n",
" pred_train = model(x_train)\n",
" pred_val = model(x_val)\n",
" _, predicted_train_class = torch.max(pred_train.data, 1)\n",
" _, predicted_val_class = torch.max(pred_val.data, 1)\n",
" errors_train[epoch] = 100 - 100 * (predicted_train_class == y_train).float().sum() / len(y_train)\n",
" errors_val[epoch]= 100 - 100 * (predicted_val_class == y_val).float().sum() / len(y_val)\n",
" losses_train[epoch] = loss_function(pred_train, y_train).item()\n",
" losses_val[epoch]= loss_function(pred_val, y_val).item()\n",
" print(f'Epoch {epoch:5d}, train loss {losses_train[epoch]:.6f}, train error {errors_train[epoch]:3.2f}, val loss {losses_val[epoch]:.6f}, percent error {errors_val[epoch]:3.2f}')\n",
"\n",
" # tell scheduler to consider updating learning rate\n",
" scheduler.step()"
],
"metadata": {
"id": "NYw8I_3mmX5c"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "code",
"source": [
"# Plot the results\n",
"fig, ax = plt.subplots()\n",
"ax.plot(errors_train,'r-',label='train')\n",
"ax.plot(errors_val,'b-',label='test')\n",
"ax.set_ylim(0,100); ax.set_xlim(0,n_epoch)\n",
"ax.set_xlabel('Epoch'); ax.set_ylabel('Error')\n",
"ax.set_title('TrainError %3.2f, Val Error %3.2f'%(errors_train[-1],errors_val[-1]))\n",
"ax.legend()\n",
"plt.show()"
],
"metadata": {
"id": "CcP_VyEmE2sv"
},
"execution_count": null,
"outputs": []
},
{
"cell_type": "markdown",
"source": [
"The primary motivation of residual networks is to allow training of much deeper networks. \n",
"\n",
"TODO: Try running this network with and without the residual connections. Does adding the residual connections change the performance?"
],
"metadata": {
"id": "wMmqhmxuAx0M"
}
}
]
}

View File

@@ -1,161 +1,376 @@
<h1>Understanding Deep Learning</h1> <!DOCTYPE html>
by Simon J.D. Prince <html lang="en">
<br> <head>
To be published by MIT Press Dec 5th 2023.<br> <meta charset="UTF-8">
<title>udlbook</title>
<link rel="stylesheet" href="style.css">
</head>
<img src="https://raw.githubusercontent.com/udlbook/udlbook/main/UDLCoverSmall.jpg" alt="front cover"> <body>
<div id="head">
<div>
<h1 style="margin: 0; font-size: 36px">Understanding Deep Learning</h1>
by Simon J.D. Prince
<br>To be published by MIT Press Dec 5th 2023.<br>
<ul>
<li>
<p style="font-size: larger; margin-bottom: 0">Download draft PDF Chapters 1-21 <a
href="https://github.com/udlbook/udlbook/releases/download/v1.14/UnderstandingDeepLearning_13_10_23_C.pdf">here</a>
</p>2023-10-13. CC-BY-NC-ND license<br>
<img src="https://img.shields.io/github/downloads/udlbook/udlbook/total" alt="download stats shield">
</li>
<li> Report errata via <a href="https://github.com/udlbook/udlbook/issues">github</a>
or contact me directly at udlbookmail@gmail.com
<li> Follow me on <a href="https://twitter.com/SimonPrinceAI">Twitter</a> or <a
href="https://www.linkedin.com/in/simon-prince-615bb9165/">LinkedIn</a> for updates.
</ul>
<h2>Table of contents</h2>
<ul>
<li> Chapter 1 - Introduction
<li> Chapter 2 - Supervised learning
<li> Chapter 3 - Shallow neural networks
<li> Chapter 4 - Deep neural networks
<li> Chapter 5 - Loss functions
<li> Chapter 6 - Training models
<li> Chapter 7 - Gradients and initialization
<li> Chapter 8 - Measuring performance
<li> Chapter 9 - Regularization
<li> Chapter 10 - Convolutional networks
<li> Chapter 11 - Residual networks
<li> Chapter 12 - Transformers
<li> Chapter 13 - Graph neural networks
<li> Chapter 14 - Unsupervised learning
<li> Chapter 15 - Generative adversarial networks
<li> Chapter 16 - Normalizing flows
<li> Chapter 17 - Variational autoencoders
<li> Chapter 18 - Diffusion models
<li> Chapter 19 - Deep reinforcement learning
<li> Chapter 20 - Why does deep learning work?
<li> Chapter 21 - Deep learning and ethics
</ul>
</div>
<div id="cover">
<img src="https://raw.githubusercontent.com/udlbook/udlbook/main/UDLCoverSmall.jpg"
alt="front cover">
</div>
</div>
<div id="body">
<h2>Resources for instructors </h2>
<p>Instructor answer booklet available with proof of credentials via <a
href="https://mitpress.mit.edu/9780262048644/understanding-deep-learning"> MIT Press</a>.</p>
<p>Figures in PDF (vector) / SVG (vector) / Powerpoint (images):
<ul>
<li> Chapter 1 - Introduction: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap1PDF.zip">PDF
Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1udnl5pUOAc8DcAQ7HQwyzP9pwL95ynnv">
SVG
Figures</a> / <a
href="https://docs.google.com/presentation/d/1IjTqIUvWCJc71b5vEJYte-Dwujcp7rvG/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 2 - Supervised learning: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap2PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1VSxcU5y1qNFlmd3Lb3uOWyzILuOj1Dla"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1Br7R01ROtRWPlNhC_KOommeHAWMBpWtz/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 3 - Shallow neural networks: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap3PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=19kZFWlXhzN82Zx02ByMmSZOO4T41fmqI"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1e9M3jB5I9qZ4dCBY90Q3Hwft_i068QVQ/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 4 - Deep neural networks: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap4PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1ojr0ebsOhzvS04ItAflX2cVmYqHQHZUa"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1LTSsmY4mMrJbqXVvoTOCkQwHrRKoYnJj/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 5 - Loss functions: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap5PDF.zip">PDF
Figures</a> / <a href="https://drive.google.com/uc?export=download&id=17MJO7fiMpFZVqKeqXTbQ36AMpmR4GizZ">
SVG
Figures</a> / <a
href="https://docs.google.com/presentation/d/1gcpC_3z9oRp87eMkoco-kdLD-MM54Puk/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 6 - Training models: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap6PDF.zip">PDF
Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1VPdhFRnCr9_idTrX0UdHKGAw2shUuwhK">
SVG
Figures</a> / <a
href="https://docs.google.com/presentation/d/1AKoeggAFBl9yLC7X5tushAGzCCxmB7EY/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 7 - Gradients and initialization: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap7PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1TTl4gvrTvNbegnml4CoGoKOOd6O8-PGs"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/11zhB6PI-Dp6Ogmr4IcI6fbvbqNqLyYcz/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 8 - Measuring performance: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap8PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=19eQOnygd_l0DzgtJxXuYnWa4z7QKJrJx"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1SHRmJscDLUuQrG7tmysnScb3ZUAqVMZo/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 9 - Regularization: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap9PDF.zip">PDF
Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1LprgnUGL7xAM9-jlGZC9LhMPeefjY0r0">
SVG
Figures</a> / <a
href="https://docs.google.com/presentation/d/1VwIfvjpdfTny6sEfu4ZETwCnw6m8Eg-5/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 10 - Convolutional networks: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap10PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1-Wb3VzaSvVeRzoUzJbI2JjZE0uwqupM9"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1MtfKBC4Y9hWwGqeP6DVwUNbi1j5ncQCg/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 11 - Residual networks: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap11PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1Mr58jzEVseUAfNYbGWCQyDtEDwvfHRi1"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1saY8Faz0KTKAAifUrbkQdLA2qkyEjOPI/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 12 - Transformers: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap12PDF.zip">PDF
Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1txzOVNf8-jH4UfJ6SLnrtOfPd1Q3ebzd">
SVG
Figures</a> / <a
href="https://docs.google.com/presentation/d/1GVNvYWa0WJA6oKg89qZre-UZEhABfm0l/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 13 - Graph neural networks: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap13PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1lQIV6nRp6LVfaMgpGFhuwEXG-lTEaAwe"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1YwF3U82c1mQ74c1WqHVTzLZ0j7GgKaWP/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 14 - Unsupervised learning: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap14PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1aMbI6iCuUvOywqk5pBOmppJu1L1anqsM"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1A-lBGv3NHl4L32NvfFgy1EKeSwY-0UeB/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">
PowerPoint Figures</a>
<li> Chapter 15 - Generative adversarial networks: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap15PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1EErnlZCOlXc3HK7m83T2Jh_0NzIUHvtL"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/10Ernk41ShOTf4IYkMD-l4dJfKATkXH4w/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 16 - Normalizing flows: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap16PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1B9bxtmdugwtg-b7Y4AdQKAIEVWxjx8l3"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1nLLzqb9pdfF_h6i1HUDSyp7kSMIkSUUA/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 17 - Variational autoencoders: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap17PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1SNtNIY7khlHQYMtaOH-FosSH3kWwL4b7"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1lQE4Bu7-LgvV2VlJOt_4dQT-kusYl7Vo/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Chapter 18 - Diffusion models: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap18PDF.zip">PDF Figures</a> / <a
href="https://docs.google.com/presentation/d/1x_ufIBtVPzWUvRieKMkpw5SdRjXWwdfR/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">
PowerPoint Figures</a>
<li> Chapter 19 - Deep reinforcement learning: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap19PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1a5WUoF7jeSgwC_PVdckJi1Gny46fCqh0"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1TnYmVbFNhmMFetbjyfXGmkxp1EHauMqr/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">
PowerPoint Figures </a>
<li> Chapter 20 - Why does deep learning work?: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap20PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1M2d0DHEgddAQoIedKSDTTt7m1ZdmBLQ3"> SVG Figures</a>
/
<a href="https://docs.google.com/presentation/d/1coxF4IsrCzDTLrNjRagHvqB_FBy10miA/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">
PowerPoint Figures</a>
<li> Chapter 21 - Deep learning and ethics: <a
href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap21PDF.zip">PDF Figures</a> / <a
href="https://drive.google.com/uc?export=download&id=1jixmFfwmZkW_UVYzcxmDcMsdFFtnZ0bU"> SVG Figures</a>/
<a
href="https://docs.google.com/presentation/d/1EtfzanZYILvi9_-Idm28zD94I_6OrN9R/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint
Figures</a>
<li> Appendices - <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLAppendixPDF.zip">PDF
Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1k2j7hMN40ISPSg9skFYWFL3oZT7r8v-l">
SVG
Figures</a> / <a
href="https://docs.google.com/presentation/d/1_2cJHRnsoQQHst0rwZssv-XH4o5SEHks/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">Powerpoint
Figures</a>
</ul>
<h2> Download draft PDF </h2> Instructions for editing figures / equations can be found <a
href="https://drive.google.com/file/d/1T_MXXVR4AfyMnlEFI-UVDh--FXI5deAp/view?usp=sharing">here</a>.
<a href="https://github.com/udlbook/udlbook/releases/download/v1.1.2/UnderstandingDeepLearning_06_08_23_C.pdf">Draft PDF Chapters 1-21</a><br> 2023-08-06. CC-BY-NC-ND license <h2>Resources for students</h2>
<br>
<img src="https://img.shields.io/github/downloads/udlbook/udlbook/total" alt="download stats shield">
<br>
<ul>
<li> Appendices and notebooks coming soon
<li> Report errata via <a href="https://github.com/udlbook/udlbook/issues">github</a> or contact me directly at udlbookmail@gmail.com
<li> Follow me on <a href="https://twitter.com/SimonPrinceAI">Twitter</a> or <a href="https://www.linkedin.com/in/simon-prince-615bb9165/">LinkedIn</a> for updates.
</ul>
<h2>Table of contents</h2> <p>Answers to selected questions: <a
<ul> href="https://github.com/udlbook/udlbook/raw/main/UDL_Answer_Booklet_Students.pdf">PDF</a>
<li> Chapter 1 - Introduction </p>
<li> Chapter 2 - Supervised learning <p>Python notebooks: (Early ones more thoroughly tested than later ones!)</p>
<li> Chapter 3 - Shallow neural networks
<li> Chapter 4 - Deep neural networks
<li> Chapter 5 - Loss functions
<li> Chapter 6 - Training models
<li> Chapter 7 - Gradients and initialization
<li> Chapter 8 - Measuring performance
<li> Chapter 9 - Regularization
<li> Chapter 10 - Convolutional networks
<li> Chapter 11 - Residual networks
<li> Chapter 12 - Transformers
<li> Chapter 13 - Graph neural networks
<li> Chapter 14 - Unsupervised learning
<li> Chapter 15 - Generative adversarial networks
<li> Chapter 16 - Normalizing flows
<li> Chapter 17 - Variational autoencoders
<li> Chapter 18 - Diffusion models
<li> Chapter 19 - Deep reinforcement learning
<li> Chapter 20 - Why does deep learning work?
<li> Chapter 21 - Deep learning and ethics
</ul>
<ul>
<h2>Resources for instructors </h2> <li> Notebook 1.1 - Background mathematics: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap01/1_1_BackgroundMathematics.ipynb">ipynb/colab</a>
<p></p>Instructor answer booklet available with proof of credentials via <a href="https://mitpress.mit.edu/9780262048644/understanding-deep-learning"/> MIT Press</a></p> </li>
<li> Notebook 2.1 - Supervised learning: <a
<p></p>Figures in PDF (vector) / SVG (vector) / Powerpoint (images): href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap02/2_1_Supervised_Learning.ipynb">ipynb/colab</a>
</li>
<ul> <li> Notebook 3.1 - Shallow networks I: <a
<li> Chapter 1 - Introduction: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap1PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1udnl5pUOAc8DcAQ7HQwyzP9pwL95ynnv"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1IjTqIUvWCJc71b5vEJYte-Dwujcp7rvG/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_1_Shallow_Networks_I.ipynb">ipynb/colab </a>
<li> Chapter 2 - Supervised learning: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap2PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1VSxcU5y1qNFlmd3Lb3uOWyzILuOj1Dla"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1Br7R01ROtRWPlNhC_KOommeHAWMBpWtz/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> </li>
<li> Chapter 3 - Shallow neural networks: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap3PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=19kZFWlXhzN82Zx02ByMmSZOO4T41fmqI"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1e9M3jB5I9qZ4dCBY90Q3Hwft_i068QVQ/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> <li> Notebook 3.2 - Shallow networks II: <a
<li> Chapter 4 - Deep neural networks: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap4PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1ojr0ebsOhzvS04ItAflX2cVmYqHQHZUa"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1LTSsmY4mMrJbqXVvoTOCkQwHrRKoYnJj/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_2_Shallow_Networks_II.ipynb">ipynb/colab </a>
<li> Chapter 5 - Loss functions: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap5PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=17MJO7fiMpFZVqKeqXTbQ36AMpmR4GizZ"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1gcpC_3z9oRp87eMkoco-kdLD-MM54Puk/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> </li>
<li> Chapter 6 - Training models: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap6PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1VPdhFRnCr9_idTrX0UdHKGAw2shUuwhK"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1AKoeggAFBl9yLC7X5tushAGzCCxmB7EY/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> <li> Notebook 3.3 - Shallow network regions: <a
<li> Chapter 7 - Gradients and initialization: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap7PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1TTl4gvrTvNbegnml4CoGoKOOd6O8-PGs"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/11zhB6PI-Dp6Ogmr4IcI6fbvbqNqLyYcz/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_3_Shallow_Network_Regions.ipynb">ipynb/colab </a>
<li> Chapter 8 - Measuring performance: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap8PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=19eQOnygd_l0DzgtJxXuYnWa4z7QKJrJx"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1SHRmJscDLUuQrG7tmysnScb3ZUAqVMZo/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> </li>
<li> Chapter 9 - Regularization: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap9PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1LprgnUGL7xAM9-jlGZC9LhMPeefjY0r0"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1VwIfvjpdfTny6sEfu4ZETwCnw6m8Eg-5/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> <li> Notebook 3.4 - Activation functions: <a
<li> Chapter 10 - Convolutional networks: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap10PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1-Wb3VzaSvVeRzoUzJbI2JjZE0uwqupM9"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1MtfKBC4Y9hWwGqeP6DVwUNbi1j5ncQCg/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_4_Activation_Functions.ipynb">ipynb/colab </a>
<li> Chapter 11 - Residual networks: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap11PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1Mr58jzEVseUAfNYbGWCQyDtEDwvfHRi1"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1saY8Faz0KTKAAifUrbkQdLA2qkyEjOPI/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> </li>
<li> Chapter 12 - Transformers: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap12PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1txzOVNf8-jH4UfJ6SLnrtOfPd1Q3ebzd"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1GVNvYWa0WJA6oKg89qZre-UZEhABfm0l/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> <li> Notebook 4.1 - Composing networks: <a
<li> Chapter 13 - Graph neural networks: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap13PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1lQIV6nRp6LVfaMgpGFhuwEXG-lTEaAwe"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1YwF3U82c1mQ74c1WqHVTzLZ0j7GgKaWP/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap04/4_1_Composing_Networks.ipynb">ipynb/colab </a>
<li> Chapter 14 - Unsupervised learning: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap14PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1aMbI6iCuUvOywqk5pBOmppJu1L1anqsM"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1A-lBGv3NHl4L32NvfFgy1EKeSwY-0UeB/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true"> Powerpoint Figures</a> </li>
<li> Chapter 15 - Generative adversarial networks: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap15PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1EErnlZCOlXc3HK7m83T2Jh_0NzIUHvtL"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/10Ernk41ShOTf4IYkMD-l4dJfKATkXH4w/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> <li> Notebook 4.2 - Clipping functions: <a
<li> Chapter 16 - Normalizing flows: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap16PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1B9bxtmdugwtg-b7Y4AdQKAIEVWxjx8l3"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1nLLzqb9pdfF_h6i1HUDSyp7kSMIkSUUA/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap04/4_2_Clipping_functions.ipynb">ipynb/colab </a>
<li> Chapter 17 - Variational autoencoders: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap17PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1SNtNIY7khlHQYMtaOH-FosSH3kWwL4b7"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1lQE4Bu7-LgvV2VlJOt_4dQT-kusYl7Vo/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> </li>
<li> Chapter 18 - Diffusion models: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap18PDF.zip">PDF Figures</a> / <a href="https://docs.google.com/presentation/d/1x_ufIBtVPzWUvRieKMkpw5SdRjXWwdfR/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true"> PowerPoint Figures</a> <li> Notebook 4.3 - Deep networks: <a
<li> Chapter 19 - Deep reinforcement learning: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap19PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1a5WUoF7jeSgwC_PVdckJi1Gny46fCqh0"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1TnYmVbFNhmMFetbjyfXGmkxp1EHauMqr/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true"> PowerPoint Figures </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap04/4_3_Deep_Networks.ipynb">ipynb/colab </a>
<li> Chapter 20 - Why does deep learning work?: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap20PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1M2d0DHEgddAQoIedKSDTTt7m1ZdmBLQ3"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1coxF4IsrCzDTLrNjRagHvqB_FBy10miA/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true"> PowerPoint Figures</a> </li>
<li> Chapter 21 - Deep learning and ethics: <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLChap21PDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1jixmFfwmZkW_UVYzcxmDcMsdFFtnZ0bU"> SVG Figures</a>/ <a href="https://docs.google.com/presentation/d/1EtfzanZYILvi9_-Idm28zD94I_6OrN9R/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">PowerPoint Figures</a> <li> Notebook 5.1 - Least squares loss: <a
<li> Appendices - <a href="https://github.com/udlbook/udlbook/raw/main/PDFFigures/UDLAppendixPDF.zip">PDF Figures</a> / <a href="https://drive.google.com/uc?export=download&id=1k2j7hMN40ISPSg9skFYWFL3oZT7r8v-l"> SVG Figures</a> / <a href="https://docs.google.com/presentation/d/1_2cJHRnsoQQHst0rwZssv-XH4o5SEHks/edit?usp=drive_link&ouid=110441678248547154185&rtpof=true&sd=true">Powerpoint Figures</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap05/5_1_Least_Squares_Loss.ipynb">ipynb/colab </a>
</ul> </li>
<li> Notebook 5.2 - Binary cross-entropy loss: <a
Instructions for editing figures / equations can be found <a href="https://drive.google.com/file/d/1T_MXXVR4AfyMnlEFI-UVDh--FXI5deAp/view?usp=sharing">here</a>.</p> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap05/5_2_Binary_Cross_Entropy_Loss.ipynb">ipynb/colab </a>
</li>
<h2>Resources for students</h2> <li> Notebook 5.3 - Multiclass cross-entropy loss: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap05/5_3_Multiclass_Cross_entropy_Loss.ipynb">ipynb/colab </a>
<p>Answers to selected questions: <a href="https://github.com/udlbook/udlbook/raw/main/UDL_Answer_Booklet_Students.pdf">PDF</a></p> </li>
<p>Python notebooks:</p> <li> Notebook 6.1 - Line search: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_1_Line_Search.ipynb">ipynb/colab </a>
<ul> </li>
<li> Notebook 1.1 - Background mathematics: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap01/1_1_BackgroundMathematics.ipynb">ipynb/colab</a> <li> Notebook 6.2 - Gradient descent: <a
<li> Notebook 2.1 - Supervised learning: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap02/2_1_Supervised_Learning.ipynb"">ipynb/colab</a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_2_Gradient_Descent.ipynb">ipynb/colab </a>
<li> Notebook 3.1 - Shallow networks I: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_1_Shallow_Networks_I.ipynb">ipynb/colab </a> </li>
<li> Notebook 3.2 - Shallow networks II: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_2_Shallow_Networks_II.ipynb">ipynb/colab </a> <li> Notebook 6.3 - Stochastic gradient descent: <a
<li> Notebook 3.3 - Shallow network regions: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_3_Shallow_Network_Regions.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_3_Stochastic_Gradient_Descent.ipynb">ipynb/colab </a>
<li> Notebook 3.4 - Activation functions: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap03/3_4_Activation_Functions.ipynb">ipynb/colab </a> </li>
<li> Notebook 4.1 - Composing networks: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap04/4_1_Composing_Networks.ipynb">ipynb/colab </a> <li> Notebook 6.4 - Momentum: <a
<li> Notebook 4.2 - Clipping functions: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap04/4_2_Clipping_functions.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_4_Momentum.ipynb">ipynb/colab </a>
<li> Notebook 4.3 - Deep networks: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap04/4_3_Deep_Networks.ipynb">ipynb/colab </a> </li>
<li> Notebook 5.1 - Least squares loss: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap05/5_1_Least_Squares_Loss.ipynb">ipynb/colab </a> <li> Notebook 6.5 - Adam: <a
<li> Notebook 5.2 - Binary cross-entropy loss: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap05/5_2_Binary_Cross_Entropy_Loss.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_5_Adam.ipynb">ipynb/colab </a>
<li> Notebook 5.3 - Multiclass cross-entropy loss: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap05/5_3_Multiclass_Cross_entropy_Loss.ipynb">ipynb/colab </a> </li>
<li> Notebook 6.1 - Line search: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_1_Line_Search.ipynb">ipynb/colab </a> <li> Notebook 7.1 - Backpropagation in toy model: <a
<li> Notebook 6.2 - Gradient descent: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_2_Gradient_Descent.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap07/7_1_Backpropagation_in_Toy_Model.ipynb">ipynb/colab </a>
<li> Notebook 6.3 - Stochastic gradient descent: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_3_Stochastic_Gradient_Descent.ipynb">ipynb/colab </a> </li>
<li> Notebook 6.4 - Momentum: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_4_Momentum.ipynb">ipynb/colab </a> <li> Notebook 7.2 - Backpropagation: <a
<li> Notebook 6.5 - Adam: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap06/6_5_Adam.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap07/7_2_Backpropagation.ipynb">ipynb/colab </a>
<li> Notebook 7.1 - Backpropagtion in toy model: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap07/7_1_Backpropagation_in_Toy_Model.ipynb"">ipynb/colab </a> </li>
<li> Notebook 7.2 - Backpropagation: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap07/7_2_Backpropagation.ipynb">ipynb/colab </a> <li> Notebook 7.3 - Initialization: <a
<li> Notebook 7.3 - Initialization: <a href=""https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap07/7_3_Initialization.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap07/7_3_Initialization.ipynb">ipynb/colab </a>
<li> Notebook 8.1 - MNIST-1D performance: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_1_MNIST_1D_Performance.ipynb"">ipynb/colab </a> </li>
<li> Notebook 8.2 - Bias-variance trade-off: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_2_Bias_Variance_Trade_Off.ipynb">ipynb/colab </a> <li> Notebook 8.1 - MNIST-1D performance: <a
<li> Notebook 8.3 - Double descent: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_3_Double_Descent.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_1_MNIST_1D_Performance.ipynb">ipynb/colab </a>
<li> Notebook 8.4 - High-dimensional spaces: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_4_High_Dimensional_Spaces.ipynb">ipynb/colab </a> </li>
<li> Notebook 9.1 - L2 regularization: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_1_L2_Regularization.ipynb">ipynb/colab </a> <li> Notebook 8.2 - Bias-variance trade-off: <a
<li> Notebook 9.2 - Implicit regularization: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_2_Implicit_Regularization.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_2_Bias_Variance_Trade_Off.ipynb">ipynb/colab </a>
<li> Notebook 9.3 - Ensembling: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_3_Ensembling.ipynb">ipynb/colab </a> </li>
<li> Notebook 9.4 - Bayesian approach: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_4_Bayesian_Approach.ipynb">ipynb/colab </a> <li> Notebook 8.3 - Double descent: <a
<li> Notebook 9.5 - Augmentation <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_5_Augmentation.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_3_Double_Descent.ipynb">ipynb/colab </a>
<li> Notebook 10.1 - 1D convolution: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_1_1D_Convolution.ipynb">ipynb/colab </a> </li>
<li> Notebook 10.2 - Convolution for MNIST-1D: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_2_Convolution_for_MNIST_1D.ipynb">ipynb/colab </a> <li> Notebook 8.4 - High-dimensional spaces: <a
<li> Notebook 10.3 - 2D convolution: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_3_2D_Convolution.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap08/8_4_High_Dimensional_Spaces.ipynb">ipynb/colab </a>
<li> Notebook 10.4 - Downsampling & upsampling: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_4_Downsampling_and_Upsampling.ipynb">ipynb/colab </a> </li>
<li> Notebook 10.5 - Convolution for MNIST: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_5_Convolution_For_MNIST.ipynb">ipynb/colab </a> <li> Notebook 9.1 - L2 regularization: <a
<li> Notebook 11.1 - Shattered gradients: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_1_L2_Regularization.ipynb">ipynb/colab </a>
<li> Notebook 11.2 - Residual networks: (coming soon) </li>
<li> Notebook 11.3 - Batch normalization: (coming soon) <li> Notebook 9.2 - Implicit regularization: <a
<li> Notebook 12.1 - Self-attention: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_2_Implicit_Regularization.ipynb">ipynb/colab </a>
<li> Notebook 12.2 - Multi-head self-attention: (coming soon) </li>
<li> Notebook 12.3 - Tokenization: (coming soon) <li> Notebook 9.3 - Ensembling: <a
<li> Notebook 12.4 - Decoding strategies: <a href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap12/12_4_Decoding_Strategies.ipynb">ipynb/colab </a> href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_3_Ensembling.ipynb">ipynb/colab </a>
<li> Notebook 13.1 - Encoding graphs: (coming soon) </li>
<li> Notebook 13.2 - Graph classification : (coming soon) <li> Notebook 9.4 - Bayesian approach: <a
<li> Notebook 13.3 - Neighborhood sampling: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_4_Bayesian_Approach.ipynb">ipynb/colab </a>
<li> Notebook 13.4 - Graph attention: (coming soon) </li>
<li> Notebook 15.1 - GAN toy example: (coming soon) <li> Notebook 9.5 - Augmentation <a
<li> Notebook 15.2 - Wasserstein distance: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap09/9_5_Augmentation.ipynb">ipynb/colab </a>
<li> Notebook 16.1 - 1D normalizing flows: (coming soon) </li>
<li> Notebook 16.2 - Autoregressive flows: (coming soon) <li> Notebook 10.1 - 1D convolution: <a
<li> Notebook 16.3 - Contraction mappings: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_1_1D_Convolution.ipynb">ipynb/colab </a>
<li> Notebook 17.1 - Latent variable models: (coming soon) </li>
<li> Notebook 17.2 - Reparameterization trick: (coming soon) <li> Notebook 10.2 - Convolution for MNIST-1D: <a
<li> Notebook 17.3 - Importance sampling: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_2_Convolution_for_MNIST_1D.ipynb">ipynb/colab </a>
<li> Notebook 18.1 - Diffusion encoder: (coming soon) </li>
<li> Notebook 18.2 - 1D diffusion model: (coming soon) <li> Notebook 10.3 - 2D convolution: <a
<li> Notebook 18.3 - Reparameterized model: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_3_2D_Convolution.ipynb">ipynb/colab </a>
<li> Notebook 18.4 - Families of diffusion models: (coming soon) </li>
<li> Notebook 19.1 - Markov decision processes: (coming soon) <li> Notebook 10.4 - Downsampling & upsampling: <a
<li> Notebook 19.2 - Dynamic programming: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_4_Downsampling_and_Upsampling.ipynb">ipynb/colab </a>
<li> Notebook 19.3 - Monte-Carlo methods: (coming soon) </li>
<li> Notebook 19.4 - Temporal difference methods: (coming soon) <li> Notebook 10.5 - Convolution for MNIST: <a
<li> Notebook 19.5 - Control variates: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap10/10_5_Convolution_For_MNIST.ipynb">ipynb/colab </a>
<li> Notebook 20.1 - Random data: (coming soon) </li>
<li> Notebook 20.2 - Full-batch gradient descent: (coming soon) <li> Notebook 11.1 - Shattered gradients: <a
<li> Notebook 20.3 - Lottery tickets: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap11/11_1_Shattered_Gradients.ipynb">ipynb/colab </a>
<li> Notebook 20.4 - Adversarial attacks: (coming soon) </li>
<li> Notebook 21.1 - Bias mitigation: (coming soon) <li> Notebook 11.2 - Residual networks: <a
<li> Notebook 21.2 - Explainability: (coming soon) href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap11/11_2_Residual_Networks.ipynb">ipynb/colab </a>
</ul> </li>
<li> Notebook 11.3 - Batch normalization: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap11/11_3_Batch_Normalization.ipynb">ipynb/colab </a>
</li>
<li> Notebook 12.1 - Self-attention: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap12/12_1_Self_Attention.ipynb">ipynb/colab </a>
</li>
<li> Notebook 12.2 - Multi-head self-attention: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap12/12_2_Multihead_Self_Attention.ipynb">ipynb/colab </a>
</li>
<li> Notebook 12.3 - Tokenization: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap12/12_3_Tokenization.ipynb">ipynb/colab </a>
</li>
<li> Notebook 12.4 - Decoding strategies: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap12/12_4_Decoding_Strategies.ipynb">ipynb/colab </a>
</li>
<li> Notebook 13.1 - Encoding graphs: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap13/13_1_Graph_Representation.ipynb">ipynb/colab </a>
</li>
<li> Notebook 13.2 - Graph classification : <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap13/13_2_Graph_Classification.ipynb">ipynb/colab </a>
</li>
<li> Notebook 13.3 - Neighborhood sampling: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap13/13_3_Neighborhood_Sampling.ipynb">ipynb/colab </a>
</li>
<li> Notebook 13.4 - Graph attention: <a
href="https://github.com/udlbook/udlbook/blob/main/Notebooks/Chap13/13_4_Graph_Attention_Networks.ipynb">ipynb/colab </a>
</li>
<li> Notebook 15.1 - GAN toy example: (coming soon)</li>
<li> Notebook 15.2 - Wasserstein distance: (coming soon)</li>
<li> Notebook 16.1 - 1D normalizing flows: (coming soon)</li>
<li> Notebook 16.2 - Autoregressive flows: (coming soon)</li>
<li> Notebook 16.3 - Contraction mappings: (coming soon)</li>
<li> Notebook 17.1 - Latent variable models: (coming soon)</li>
<li> Notebook 17.2 - Reparameterization trick: (coming soon)</li>
<li> Notebook 17.3 - Importance sampling: (coming soon)</li>
<li> Notebook 18.1 - Diffusion encoder: (coming soon)</li>
<li> Notebook 18.2 - 1D diffusion model: (coming soon)</li>
<li> Notebook 18.3 - Reparameterized model: (coming soon)</li>
<li> Notebook 18.4 - Families of diffusion models: (coming soon)</li>
<li> Notebook 19.1 - Markov decision processes: (coming soon)</li>
<li> Notebook 19.2 - Dynamic programming: (coming soon)</li>
<li> Notebook 19.3 - Monte-Carlo methods: (coming soon)</li>
<li> Notebook 19.4 - Temporal difference methods: (coming soon)</li>
<li> Notebook 19.5 - Control variates: (coming soon)</li>
<li> Notebook 20.1 - Random data: (coming soon)</li>
<li> Notebook 20.2 - Full-batch gradient descent: (coming soon)</li>
<li> Notebook 20.3 - Lottery tickets: (coming soon)</li>
<li> Notebook 20.4 - Adversarial attacks: (coming soon)</li>
<li> Notebook 21.1 - Bias mitigation: (coming soon)</li>
<li> Notebook 21.2 - Explainability: (coming soon)</li>
</ul>
<br> <br>
<h2>Citation:</h2> <h2>Citation</h2>
<pre><code> <pre><code>
@book{prince2023understanding, @book{prince2023understanding,
author = "Simon J.D. Prince", author = "Simon J.D. Prince",
title = "Understanding Deep Learning", title = "Understanding Deep Learning",
@@ -163,4 +378,6 @@ Instructions for editing figures / equations can be found <a href="https://drive
year = 2023, year = 2023,
url = "http://udlbook.com" url = "http://udlbook.com"
} }
</code></pre> </code></pre>
</div>
</body>

23
style.css Normal file
View File

@@ -0,0 +1,23 @@
body {
font-size: 17px;
margin: 2% 10%;
}
#head {
display: flex;
flex-direction: row;
flex-wrap: wrap-reverse;
justify-content: space-between;
width: 100%;
}
#cover {
justify-content: center;
display: flex;
width: 30%;
}
#cover img {
width: 100%;
height: min-content;
}